// Licensed to the Apache Software Foundation (ASF) under one
// or more contributor license agreements. See the NOTICE file
// distributed with this work for additional information
// regarding copyright ownership. The ASF licenses this file
// to you under the Apache License, Version 2.0 (the
// "License"); you may not use this file except in compliance
// with the License. You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing,
// software distributed under the License is distributed on an
// "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
// KIND, either express or implied. See the License for the
// specific language governing permissions and limitations
// under the License.
package com.cloud.hypervisor.vmware.resource;
import java.io.File;
import java.io.IOException;
import java.io.UnsupportedEncodingException;
import java.net.ConnectException;
import java.net.InetSocketAddress;
import java.net.URI;
import java.nio.channels.SocketChannel;
import java.rmi.RemoteException;
import org.joda.time.Duration;
import java.util.ArrayList;
import java.util.Arrays;
import java.util.Collection;
import java.util.Collections;
import java.util.Comparator;
import java.util.Date;
import java.util.EnumMap;
import java.util.HashMap;
import java.util.HashSet;
import java.util.List;
import java.util.Map;
import java.util.Random;
import java.util.Set;
import java.util.TimeZone;
import java.util.UUID;
import javax.naming.ConfigurationException;
import org.apache.log4j.Logger;
import org.apache.log4j.NDC;
import com.google.gson.Gson;
import com.vmware.vim25.AboutInfo;
import com.vmware.vim25.BoolPolicy;
import com.vmware.vim25.ComputeResourceSummary;
import com.vmware.vim25.CustomFieldStringValue;
import com.vmware.vim25.DasVmPriority;
import com.vmware.vim25.DVPortConfigInfo;
import com.vmware.vim25.DVPortConfigSpec;
import com.vmware.vim25.DatastoreSummary;
import com.vmware.vim25.DistributedVirtualPort;
import com.vmware.vim25.DistributedVirtualSwitchPortConnection;
import com.vmware.vim25.DistributedVirtualSwitchPortCriteria;
import com.vmware.vim25.DynamicProperty;
import com.vmware.vim25.HostCapability;
import com.vmware.vim25.HostHostBusAdapter;
import com.vmware.vim25.HostInternetScsiHba;
import com.vmware.vim25.ManagedObjectReference;
import com.vmware.vim25.ObjectContent;
import com.vmware.vim25.OptionValue;
import com.vmware.vim25.PerfCounterInfo;
import com.vmware.vim25.PerfEntityMetric;
import com.vmware.vim25.PerfEntityMetricBase;
import com.vmware.vim25.PerfMetricId;
import com.vmware.vim25.PerfMetricIntSeries;
import com.vmware.vim25.PerfMetricSeries;
import com.vmware.vim25.PerfQuerySpec;
import com.vmware.vim25.PerfSampleInfo;
import com.vmware.vim25.RuntimeFaultFaultMsg;
import com.vmware.vim25.ToolsUnavailableFaultMsg;
import com.vmware.vim25.VMwareDVSPortSetting;
import com.vmware.vim25.VimPortType;
import com.vmware.vim25.VirtualDevice;
import com.vmware.vim25.VirtualDeviceBackingInfo;
import com.vmware.vim25.VirtualDeviceConfigSpec;
import com.vmware.vim25.VirtualDeviceConfigSpecOperation;
import com.vmware.vim25.VirtualUSBController;
import com.vmware.vim25.VirtualDisk;
import com.vmware.vim25.VirtualDiskFlatVer2BackingInfo;
import com.vmware.vim25.VirtualEthernetCard;
import com.vmware.vim25.VirtualEthernetCardDistributedVirtualPortBackingInfo;
import com.vmware.vim25.VirtualEthernetCardNetworkBackingInfo;
import com.vmware.vim25.VirtualEthernetCardOpaqueNetworkBackingInfo;
import com.vmware.vim25.VirtualMachineConfigSpec;
import com.vmware.vim25.VirtualMachineFileInfo;
import com.vmware.vim25.VirtualMachineFileLayoutEx;
import com.vmware.vim25.VirtualMachineFileLayoutExFileInfo;
import com.vmware.vim25.VirtualMachineGuestOsIdentifier;
import com.vmware.vim25.VirtualMachinePowerState;
import com.vmware.vim25.VirtualMachineRelocateSpec;
import com.vmware.vim25.VirtualMachineRelocateSpecDiskLocator;
import com.vmware.vim25.VirtualMachineRuntimeInfo;
import com.vmware.vim25.VirtualMachineVideoCard;
import com.vmware.vim25.VmwareDistributedVirtualSwitchVlanIdSpec;
import org.apache.cloudstack.storage.command.CopyCommand;
import org.apache.cloudstack.storage.command.StorageSubSystemCommand;
import org.apache.cloudstack.storage.resource.NfsSecondaryStorageResource;
import org.apache.cloudstack.storage.to.PrimaryDataStoreTO;
import org.apache.cloudstack.storage.to.TemplateObjectTO;
import org.apache.cloudstack.storage.to.VolumeObjectTO;
import org.apache.commons.lang.math.NumberUtils;
import com.cloud.agent.IAgentControl;
import com.cloud.agent.api.Answer;
import com.cloud.agent.api.AttachIsoCommand;
import com.cloud.agent.api.BackupSnapshotAnswer;
import com.cloud.agent.api.BackupSnapshotCommand;
import com.cloud.agent.api.CheckHealthAnswer;
import com.cloud.agent.api.CheckHealthCommand;
import com.cloud.agent.api.CheckNetworkAnswer;
import com.cloud.agent.api.CheckNetworkCommand;
import com.cloud.agent.api.CheckOnHostAnswer;
import com.cloud.agent.api.CheckOnHostCommand;
import com.cloud.agent.api.CheckVirtualMachineAnswer;
import com.cloud.agent.api.CheckVirtualMachineCommand;
import com.cloud.agent.api.Command;
import com.cloud.agent.api.CreatePrivateTemplateFromSnapshotCommand;
import com.cloud.agent.api.CreatePrivateTemplateFromVolumeCommand;
import com.cloud.agent.api.CreateStoragePoolCommand;
import com.cloud.agent.api.CreateVMSnapshotAnswer;
import com.cloud.agent.api.CreateVMSnapshotCommand;
import com.cloud.agent.api.CreateVolumeFromSnapshotAnswer;
import com.cloud.agent.api.CreateVolumeFromSnapshotCommand;
import com.cloud.agent.api.DeleteStoragePoolCommand;
import com.cloud.agent.api.DeleteVMSnapshotAnswer;
import com.cloud.agent.api.DeleteVMSnapshotCommand;
import com.cloud.agent.api.GetHostStatsAnswer;
import com.cloud.agent.api.GetHostStatsCommand;
import com.cloud.agent.api.GetStorageStatsAnswer;
import com.cloud.agent.api.GetStorageStatsCommand;
import com.cloud.agent.api.GetVmDiskStatsAnswer;
import com.cloud.agent.api.GetVmDiskStatsCommand;
import com.cloud.agent.api.GetVmStatsAnswer;
import com.cloud.agent.api.GetVmStatsCommand;
import com.cloud.agent.api.GetVncPortAnswer;
import com.cloud.agent.api.GetVncPortCommand;
import com.cloud.agent.api.HostStatsEntry;
import com.cloud.agent.api.HostVmStateReportEntry;
import com.cloud.agent.api.MaintainAnswer;
import com.cloud.agent.api.MaintainCommand;
import com.cloud.agent.api.ManageSnapshotAnswer;
import com.cloud.agent.api.ManageSnapshotCommand;
import com.cloud.agent.api.MigrateAnswer;
import com.cloud.agent.api.MigrateCommand;
import com.cloud.agent.api.MigrateWithStorageAnswer;
import com.cloud.agent.api.MigrateWithStorageCommand;
import com.cloud.agent.api.ModifySshKeysCommand;
import com.cloud.agent.api.ModifyStoragePoolAnswer;
import com.cloud.agent.api.ModifyStoragePoolCommand;
import com.cloud.agent.api.ModifyTargetsAnswer;
import com.cloud.agent.api.ModifyTargetsCommand;
import com.cloud.agent.api.NetworkUsageAnswer;
import com.cloud.agent.api.NetworkUsageCommand;
import com.cloud.agent.api.PingCommand;
import com.cloud.agent.api.PingRoutingCommand;
import com.cloud.agent.api.PingTestCommand;
import com.cloud.agent.api.PlugNicAnswer;
import com.cloud.agent.api.PlugNicCommand;
import com.cloud.agent.api.PrepareForMigrationAnswer;
import com.cloud.agent.api.PrepareForMigrationCommand;
import com.cloud.agent.api.PvlanSetupCommand;
import com.cloud.agent.api.ReadyAnswer;
import com.cloud.agent.api.ReadyCommand;
import com.cloud.agent.api.RebootAnswer;
import com.cloud.agent.api.RebootCommand;
import com.cloud.agent.api.RebootRouterCommand;
import com.cloud.agent.api.RevertToVMSnapshotAnswer;
import com.cloud.agent.api.RevertToVMSnapshotCommand;
import com.cloud.agent.api.ScaleVmAnswer;
import com.cloud.agent.api.ScaleVmCommand;
import com.cloud.agent.api.SetupAnswer;
import com.cloud.agent.api.SetupCommand;
import com.cloud.agent.api.SetupGuestNetworkCommand;
import com.cloud.agent.api.StartAnswer;
import com.cloud.agent.api.StartCommand;
import com.cloud.agent.api.StartupCommand;
import com.cloud.agent.api.StartupRoutingCommand;
import com.cloud.agent.api.StartupStorageCommand;
import com.cloud.agent.api.StopAnswer;
import com.cloud.agent.api.StopCommand;
import com.cloud.agent.api.StoragePoolInfo;
import com.cloud.agent.api.UnPlugNicAnswer;
import com.cloud.agent.api.UnPlugNicCommand;
import com.cloud.agent.api.UnregisterNicCommand;
import com.cloud.agent.api.UnregisterVMCommand;
import com.cloud.agent.api.UpgradeSnapshotCommand;
import com.cloud.agent.api.ValidateSnapshotAnswer;
import com.cloud.agent.api.ValidateSnapshotCommand;
import com.cloud.agent.api.VmStatsEntry;
import com.cloud.agent.api.check.CheckSshAnswer;
import com.cloud.agent.api.check.CheckSshCommand;
import com.cloud.agent.api.routing.IpAssocCommand;
import com.cloud.agent.api.routing.IpAssocVpcCommand;
import com.cloud.agent.api.routing.NetworkElementCommand;
import com.cloud.agent.api.routing.SetNetworkACLCommand;
import com.cloud.agent.api.routing.SetSourceNatCommand;
import com.cloud.agent.api.storage.CopyVolumeAnswer;
import com.cloud.agent.api.storage.CopyVolumeCommand;
import com.cloud.agent.api.storage.CreatePrivateTemplateAnswer;
import com.cloud.agent.api.storage.DestroyCommand;
import com.cloud.agent.api.storage.MigrateVolumeAnswer;
import com.cloud.agent.api.storage.MigrateVolumeCommand;
import com.cloud.agent.api.storage.PrimaryStorageDownloadAnswer;
import com.cloud.agent.api.storage.PrimaryStorageDownloadCommand;
import com.cloud.agent.api.storage.ResizeVolumeAnswer;
import com.cloud.agent.api.storage.ResizeVolumeCommand;
import com.cloud.agent.api.to.DataStoreTO;
import com.cloud.agent.api.to.DiskTO;
import com.cloud.agent.api.to.IpAddressTO;
import com.cloud.agent.api.to.NfsTO;
import com.cloud.agent.api.to.NicTO;
import com.cloud.agent.api.to.StorageFilerTO;
import com.cloud.agent.api.to.VirtualMachineTO;
import com.cloud.agent.api.to.VolumeTO;
import com.cloud.agent.resource.virtualnetwork.VRScripts;
import com.cloud.agent.resource.virtualnetwork.VirtualRouterDeployer;
import com.cloud.agent.resource.virtualnetwork.VirtualRoutingResource;
import com.cloud.dc.DataCenter.NetworkType;
import com.cloud.dc.Vlan;
import com.cloud.exception.CloudException;
import com.cloud.exception.InternalErrorException;
import com.cloud.host.Host.Type;
import com.cloud.hypervisor.Hypervisor.HypervisorType;
import com.cloud.hypervisor.guru.VMwareGuru;
import com.cloud.hypervisor.vmware.manager.VmwareHostService;
import com.cloud.hypervisor.vmware.manager.VmwareManager;
import com.cloud.hypervisor.vmware.manager.VmwareStorageMount;
import com.cloud.hypervisor.vmware.mo.ClusterMO;
import com.cloud.hypervisor.vmware.mo.CustomFieldConstants;
import com.cloud.hypervisor.vmware.mo.CustomFieldsManagerMO;
import com.cloud.hypervisor.vmware.mo.DatacenterMO;
import com.cloud.hypervisor.vmware.mo.DatastoreFile;
import com.cloud.hypervisor.vmware.mo.DatastoreMO;
import com.cloud.hypervisor.vmware.mo.DiskControllerType;
import com.cloud.hypervisor.vmware.mo.FeatureKeyConstants;
import com.cloud.hypervisor.vmware.mo.HostMO;
import com.cloud.hypervisor.vmware.mo.HostStorageSystemMO;
import com.cloud.hypervisor.vmware.mo.HypervisorHostHelper;
import com.cloud.hypervisor.vmware.mo.NetworkDetails;
import com.cloud.hypervisor.vmware.mo.TaskMO;
import com.cloud.hypervisor.vmware.mo.VirtualEthernetCardType;
import org.apache.cloudstack.utils.volume.VirtualMachineDiskInfo;
import com.cloud.hypervisor.vmware.mo.VirtualMachineDiskInfoBuilder;
import com.cloud.hypervisor.vmware.mo.VirtualMachineMO;
import com.cloud.hypervisor.vmware.mo.VirtualSwitchType;
import com.cloud.hypervisor.vmware.mo.VmwareHypervisorHost;
import com.cloud.hypervisor.vmware.mo.VmwareHypervisorHostNetworkSummary;
import com.cloud.hypervisor.vmware.mo.VmwareHypervisorHostResourceSummary;
import com.cloud.hypervisor.vmware.util.VmwareContext;
import com.cloud.hypervisor.vmware.util.VmwareContextPool;
import com.cloud.hypervisor.vmware.util.VmwareHelper;
import com.cloud.network.Networks;
import com.cloud.network.Networks.BroadcastDomainType;
import com.cloud.network.Networks.TrafficType;
import com.cloud.network.VmwareTrafficLabel;
import com.cloud.resource.ServerResource;
import com.cloud.serializer.GsonHelper;
import com.cloud.storage.Storage;
import com.cloud.storage.Storage.StoragePoolType;
import com.cloud.storage.Volume;
import com.cloud.storage.resource.StoragePoolResource;
import com.cloud.storage.resource.StorageSubsystemCommandHandler;
import com.cloud.storage.resource.VmwareStorageLayoutHelper;
import com.cloud.storage.resource.VmwareStorageProcessor;
import com.cloud.storage.resource.VmwareStorageSubsystemCommandHandler;
import com.cloud.storage.resource.VmwareStorageProcessor.VmwareStorageProcessorConfigurableFields;
import com.cloud.storage.template.TemplateProp;
import com.cloud.utils.DateUtil;
import com.cloud.utils.ExecutionResult;
import com.cloud.utils.NumbersUtil;
import com.cloud.utils.Pair;
import com.cloud.utils.Ternary;
import com.cloud.utils.db.DB;
import com.cloud.utils.exception.CloudRuntimeException;
import com.cloud.utils.exception.ExceptionUtil;
import com.cloud.utils.mgmt.JmxUtil;
import com.cloud.utils.mgmt.PropertyMapDynamicBean;
import com.cloud.utils.net.NetUtils;
import com.cloud.utils.nicira.nvp.plugin.NiciraNvpApiVersion;
import com.cloud.utils.ssh.SshHelper;
import com.cloud.vm.VirtualMachine;
import com.cloud.vm.VirtualMachine.PowerState;
import com.cloud.vm.VirtualMachineName;
import com.cloud.vm.VmDetailConstants;
public class VmwareResource implements StoragePoolResource, ServerResource, VmwareHostService, VirtualRouterDeployer {
private static final Logger s_logger = Logger.getLogger(VmwareResource.class);
protected String _name;
protected final long _opsTimeout = 900000; // 15 minutes time out to time
protected final int _shutdownWaitMs = 300000; // wait up to 5 minutes for shutdown
// out an operation
protected final int _retry = 24;
protected final int _sleep = 10000;
protected final int DefaultDomRSshPort = 3922;
protected final int MazCmdMBean = 100;
protected String _url;
protected String _dcId;
protected String _pod;
protected String _cluster;
protected String _username;
protected String _password;
protected String _guid;
protected String _vCenterAddress;
protected Integer storageNfsVersion;
protected String _privateNetworkVSwitchName;
protected VmwareTrafficLabel _guestTrafficInfo = new VmwareTrafficLabel(TrafficType.Guest);
protected VmwareTrafficLabel _publicTrafficInfo = new VmwareTrafficLabel(TrafficType.Public);
protected Map<String, String> _vsmCredentials = null;
protected int _portsPerDvPortGroup;
protected boolean _fullCloneFlag = false;
protected boolean _instanceNameFlag = false;
protected boolean _recycleHungWorker = false;
protected DiskControllerType _rootDiskController = DiskControllerType.ide;
protected ManagedObjectReference _morHyperHost;
protected final static ThreadLocal<VmwareContext> s_serviceContext = new ThreadLocal<VmwareContext>();
protected String _hostName;
protected List<PropertyMapDynamicBean> _cmdMBeans = new ArrayList<PropertyMapDynamicBean>();
protected Gson _gson;
protected volatile long _cmdSequence = 1;
protected StorageSubsystemCommandHandler storageHandler;
private VmwareStorageProcessor _storageProcessor;
protected VirtualRoutingResource _vrResource;
protected final static HashMap<VirtualMachinePowerState, PowerState> s_powerStatesTable = new HashMap<VirtualMachinePowerState, PowerState>();
static {
s_powerStatesTable.put(VirtualMachinePowerState.POWERED_ON, PowerState.PowerOn);
s_powerStatesTable.put(VirtualMachinePowerState.POWERED_OFF, PowerState.PowerOff);
s_powerStatesTable.put(VirtualMachinePowerState.SUSPENDED, PowerState.PowerOn);
}
public Gson getGson() {
return _gson;
}
public VmwareResource() {
_gson = GsonHelper.getGsonLogger();
}
private String getCommandLogTitle(Command cmd) {
StringBuffer sb = new StringBuffer();
if (_hostName != null) {
sb.append(_hostName);
}
if (cmd.getContextParam("job") != null) {
sb.append(", ").append(cmd.getContextParam("job"));
}
sb.append(", cmd: ").append(cmd.getClass().getSimpleName());
return sb.toString();
}
@Override
public Answer executeRequest(Command cmd) {
if (s_logger.isTraceEnabled())
s_logger.trace("Begin executeRequest(), cmd: " + cmd.getClass().getSimpleName());
Answer answer = null;
NDC.push(getCommandLogTitle(cmd));
try {
long cmdSequence = _cmdSequence++;
Date startTime = DateUtil.currentGMTTime();
PropertyMapDynamicBean mbean = new PropertyMapDynamicBean();
mbean.addProp("StartTime", DateUtil.getDateDisplayString(TimeZone.getDefault(), startTime));
mbean.addProp("Command", _gson.toJson(cmd));
mbean.addProp("Sequence", String.valueOf(cmdSequence));
mbean.addProp("Name", cmd.getClass().getSimpleName());
Class<? extends Command> clz = cmd.getClass();
if (cmd instanceof NetworkElementCommand) {
return _vrResource.executeRequest((NetworkElementCommand)cmd);
} else if (clz == ReadyCommand.class) {
answer = execute((ReadyCommand)cmd);
} else if (clz == GetHostStatsCommand.class) {
answer = execute((GetHostStatsCommand)cmd);
} else if (clz == GetVmStatsCommand.class) {
answer = execute((GetVmStatsCommand)cmd);
} else if (clz == GetVmDiskStatsCommand.class) {
answer = execute((GetVmDiskStatsCommand)cmd);
} else if (clz == CheckHealthCommand.class) {
answer = execute((CheckHealthCommand)cmd);
} else if (clz == StopCommand.class) {
answer = execute((StopCommand)cmd);
} else if (clz == RebootRouterCommand.class) {
answer = execute((RebootRouterCommand)cmd);
} else if (clz == RebootCommand.class) {
answer = execute((RebootCommand)cmd);
} else if (clz == CheckVirtualMachineCommand.class) {
answer = execute((CheckVirtualMachineCommand)cmd);
} else if (clz == PrepareForMigrationCommand.class) {
answer = execute((PrepareForMigrationCommand)cmd);
} else if (clz == MigrateCommand.class) {
answer = execute((MigrateCommand)cmd);
} else if (clz == MigrateWithStorageCommand.class) {
answer = execute((MigrateWithStorageCommand)cmd);
} else if (clz == MigrateVolumeCommand.class) {
answer = execute((MigrateVolumeCommand)cmd);
} else if (clz == DestroyCommand.class) {
answer = execute((DestroyCommand)cmd);
} else if (clz == CreateStoragePoolCommand.class) {
return execute((CreateStoragePoolCommand)cmd);
} else if (clz == ModifyTargetsCommand.class) {
answer = execute((ModifyTargetsCommand)cmd);
} else if (clz == ModifyStoragePoolCommand.class) {
answer = execute((ModifyStoragePoolCommand)cmd);
} else if (clz == DeleteStoragePoolCommand.class) {
answer = execute((DeleteStoragePoolCommand)cmd);
} else if (clz == CopyVolumeCommand.class) {
answer = execute((CopyVolumeCommand)cmd);
} else if (clz == AttachIsoCommand.class) {
answer = execute((AttachIsoCommand)cmd);
} else if (clz == ValidateSnapshotCommand.class) {
answer = execute((ValidateSnapshotCommand)cmd);
} else if (clz == ManageSnapshotCommand.class) {
answer = execute((ManageSnapshotCommand)cmd);
} else if (clz == BackupSnapshotCommand.class) {
answer = execute((BackupSnapshotCommand)cmd);
} else if (clz == CreateVolumeFromSnapshotCommand.class) {
answer = execute((CreateVolumeFromSnapshotCommand)cmd);
} else if (clz == CreatePrivateTemplateFromVolumeCommand.class) {
answer = execute((CreatePrivateTemplateFromVolumeCommand)cmd);
} else if (clz == CreatePrivateTemplateFromSnapshotCommand.class) {
answer = execute((CreatePrivateTemplateFromSnapshotCommand)cmd);
} else if (clz == UpgradeSnapshotCommand.class) {
answer = execute((UpgradeSnapshotCommand)cmd);
} else if (clz == GetStorageStatsCommand.class) {
answer = execute((GetStorageStatsCommand)cmd);
} else if (clz == PrimaryStorageDownloadCommand.class) {
answer = execute((PrimaryStorageDownloadCommand)cmd);
} else if (clz == GetVncPortCommand.class) {
answer = execute((GetVncPortCommand)cmd);
} else if (clz == SetupCommand.class) {
answer = execute((SetupCommand)cmd);
} else if (clz == MaintainCommand.class) {
answer = execute((MaintainCommand)cmd);
} else if (clz == PingTestCommand.class) {
answer = execute((PingTestCommand)cmd);
} else if (clz == CheckOnHostCommand.class) {
answer = execute((CheckOnHostCommand)cmd);
} else if (clz == ModifySshKeysCommand.class) {
answer = execute((ModifySshKeysCommand)cmd);
} else if (clz == NetworkUsageCommand.class) {
answer = execute((NetworkUsageCommand)cmd);
} else if (clz == StartCommand.class) {
answer = execute((StartCommand)cmd);
} else if (clz == CheckSshCommand.class) {
answer = execute((CheckSshCommand)cmd);
} else if (clz == CheckNetworkCommand.class) {
answer = execute((CheckNetworkCommand)cmd);
} else if (clz == PlugNicCommand.class) {
answer = execute((PlugNicCommand)cmd);
} else if (clz == UnPlugNicCommand.class) {
answer = execute((UnPlugNicCommand)cmd);
} else if (cmd instanceof CreateVMSnapshotCommand) {
return execute((CreateVMSnapshotCommand)cmd);
} else if (cmd instanceof DeleteVMSnapshotCommand) {
return execute((DeleteVMSnapshotCommand)cmd);
} else if (cmd instanceof RevertToVMSnapshotCommand) {
return execute((RevertToVMSnapshotCommand)cmd);
} else if (clz == ResizeVolumeCommand.class) {
return execute((ResizeVolumeCommand)cmd);
} else if (clz == UnregisterVMCommand.class) {
return execute((UnregisterVMCommand) cmd);
} else if (cmd instanceof StorageSubSystemCommand) {
checkStorageProcessorAndHandlerNfsVersionAttribute((StorageSubSystemCommand)cmd);
return storageHandler.handleStorageCommands((StorageSubSystemCommand) cmd);
} else if (clz == ScaleVmCommand.class) {
return execute((ScaleVmCommand)cmd);
} else if (clz == PvlanSetupCommand.class) {
return execute((PvlanSetupCommand)cmd);
} else if (clz == UnregisterNicCommand.class) {
answer = execute((UnregisterNicCommand)cmd);
} else {
answer = Answer.createUnsupportedCommandAnswer(cmd);
}
if (cmd.getContextParam("checkpoint") != null) {
answer.setContextParam("checkpoint", cmd.getContextParam("checkpoint"));
}
Date doneTime = DateUtil.currentGMTTime();
mbean.addProp("DoneTime", DateUtil.getDateDisplayString(TimeZone.getDefault(), doneTime));
mbean.addProp("Answer", _gson.toJson(answer));
synchronized (this) {
try {
JmxUtil.registerMBean("VMware " + _morHyperHost.getValue(), "Command " + cmdSequence + "-" + cmd.getClass().getSimpleName(), mbean);
_cmdMBeans.add(mbean);
if (_cmdMBeans.size() >= MazCmdMBean) {
PropertyMapDynamicBean mbeanToRemove = _cmdMBeans.get(0);
_cmdMBeans.remove(0);
JmxUtil.unregisterMBean("VMware " + _morHyperHost.getValue(),
"Command " + mbeanToRemove.getProp("Sequence") + "-" + mbeanToRemove.getProp("Name"));
}
} catch (Exception e) {
if (s_logger.isTraceEnabled())
s_logger.trace("Unable to register JMX monitoring due to exception " + ExceptionUtil.toString(e));
}
}
} finally {
recycleServiceContext();
NDC.pop();
}
if (s_logger.isTraceEnabled())
s_logger.trace("End executeRequest(), cmd: " + cmd.getClass().getSimpleName());
return answer;
}
/**
* Check if storage NFS version is already set or needs to be reconfigured.<br>
* If _storageNfsVersion is not null -> nothing to do, version already set.<br>
* If _storageNfsVersion is null -> examine StorageSubSystemCommand to get NFS version and set it
* to the storage processor and storage handler.
* @param cmd command to execute
*/
protected void checkStorageProcessorAndHandlerNfsVersionAttribute(StorageSubSystemCommand cmd) {
if (storageNfsVersion != null) return;
if (cmd instanceof CopyCommand){
EnumMap<VmwareStorageProcessorConfigurableFields,Object> params = new EnumMap<VmwareStorageProcessorConfigurableFields,Object>(VmwareStorageProcessorConfigurableFields.class);
examineStorageSubSystemCommandNfsVersion((CopyCommand) cmd, params);
params = examineStorageSubSystemCommandFullCloneFlagForVmware((CopyCommand) cmd, params);
reconfigureProcessorByHandler(params);
}
}
/**
* Reconfigure processor by handler
* @param params params
*/
protected void reconfigureProcessorByHandler(EnumMap<VmwareStorageProcessorConfigurableFields,Object> params) {
VmwareStorageSubsystemCommandHandler handler = (VmwareStorageSubsystemCommandHandler) storageHandler;
boolean success = handler.reconfigureStorageProcessor(params);
if (success){
s_logger.info("VmwareStorageProcessor and VmwareStorageSubsystemCommandHandler successfully reconfigured");
} else {
s_logger.error("Error while reconfiguring VmwareStorageProcessor and VmwareStorageSubsystemCommandHandler, params=" + _gson.toJson(params));
}
}
/**
* Examine StorageSubSystem command to get full clone flag, if provided
* @param cmd command to execute
* @param params params
* @return copy of params including new values, if suitable
*/
protected EnumMap<VmwareStorageProcessorConfigurableFields,Object> examineStorageSubSystemCommandFullCloneFlagForVmware(CopyCommand cmd, EnumMap<VmwareStorageProcessorConfigurableFields,Object> params) {
EnumMap<VmwareStorageProcessorConfigurableFields, Object> paramsCopy = new EnumMap<VmwareStorageProcessorConfigurableFields, Object>(params);
HypervisorType hypervisor = cmd.getDestTO().getHypervisorType();
if (hypervisor != null && hypervisor.equals(HypervisorType.VMware)){
DataStoreTO destDataStore = cmd.getDestTO().getDataStore();
if (destDataStore instanceof PrimaryDataStoreTO){
PrimaryDataStoreTO dest = (PrimaryDataStoreTO) destDataStore;
if (dest.isFullCloneFlag() != null){
paramsCopy.put(VmwareStorageProcessorConfigurableFields.FULL_CLONE_FLAG, dest.isFullCloneFlag().booleanValue());
}
}
}
return paramsCopy;
}
/**
* Examine StorageSubSystem command to get storage NFS version, if provided
* @param cmd command to execute
* @param params params
*/
protected void examineStorageSubSystemCommandNfsVersion(CopyCommand cmd, EnumMap<VmwareStorageProcessorConfigurableFields,Object> params){
DataStoreTO srcDataStore = cmd.getSrcTO().getDataStore();
boolean nfsVersionFound = false;
if (srcDataStore instanceof NfsTO){
nfsVersionFound = getStorageNfsVersionFromNfsTO((NfsTO) srcDataStore);
}
if (nfsVersionFound){
params.put(VmwareStorageProcessorConfigurableFields.NFS_VERSION, storageNfsVersion);
}
}
/**
* Get storage NFS version from NfsTO
* @param nfsTO nfsTO
* @return true if NFS version was found and not null, false in other case
*/
protected boolean getStorageNfsVersionFromNfsTO(NfsTO nfsTO){
if (nfsTO != null && nfsTO.getNfsVersion() != null){
storageNfsVersion = nfsTO.getNfsVersion();
return true;
}
return false;
}
/**
* Registers the vm to the inventory given the vmx file.
*/
private void registerVm(String vmName, DatastoreMO dsMo) throws Exception{
//1st param
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
ManagedObjectReference dcMor = hyperHost.getHyperHostDatacenter();
DatacenterMO dataCenterMo = new DatacenterMO(getServiceContext(), dcMor);
ManagedObjectReference vmFolderMor = dataCenterMo.getVmFolder();
//2nd param
String vmxFilePath = dsMo.searchFileInSubFolders(vmName + ".vmx", false);
// 5th param
ManagedObjectReference morPool = hyperHost.getHyperHostOwnerResourcePool();
ManagedObjectReference morTask = getServiceContext().getService().registerVMTask(vmFolderMor, vmxFilePath, vmName, false, morPool, hyperHost.getMor());
boolean result = getServiceContext().getVimClient().waitForTask(morTask);
if (!result) {
throw new Exception("Unable to register vm due to " + TaskMO.getTaskFailureInfo(getServiceContext(), morTask));
} else {
getServiceContext().waitForTaskProgressDone(morTask);
}
}
private Answer execute(ResizeVolumeCommand cmd) {
String path = cmd.getPath();
String vmName = cmd.getInstanceName();
long newSize = cmd.getNewSize() / 1024;
long oldSize = cmd.getCurrentSize()/1024;
boolean useWorkerVm = false;
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
String poolId = cmd.getPoolUuid();
VirtualMachineMO vmMo = null;
DatastoreMO dsMo = null;
ManagedObjectReference morDS = null;
String vmdkDataStorePath = null;
try {
if (newSize < oldSize) {
throw new Exception("VMware doesn't support shrinking volume from larger size: " + oldSize/(1024*1024) + " GB to a smaller size: " + newSize/(1024*1024) + " GB");
} else if (newSize == oldSize) {
return new ResizeVolumeAnswer(cmd, true, "success", newSize*1024);
}
if (vmName.equalsIgnoreCase("none")) {
// we need to spawn a worker VM to attach the volume to and
// resize the volume.
useWorkerVm = true;
vmName = getWorkerName(getServiceContext(), cmd, 0);
morDS = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(hyperHost, poolId);
dsMo = new DatastoreMO(hyperHost.getContext(), morDS);
s_logger.info("Create worker VM " + vmName);
vmMo = HypervisorHostHelper.createWorkerVM(hyperHost, dsMo, vmName);
if (vmMo == null) {
throw new Exception("Unable to create a worker VM for volume resize");
}
synchronized (this) {
vmdkDataStorePath = VmwareStorageLayoutHelper.getLegacyDatastorePathFromVmdkFileName(dsMo, path + ".vmdk");
vmMo.attachDisk(new String[] { vmdkDataStorePath }, morDS);
}
}
// find VM through datacenter (VM is not at the target host yet)
vmMo = hyperHost.findVmOnPeerHyperHost(vmName);
if (vmMo == null) {
String msg = "VM " + vmName + " does not exist in VMware datacenter";
s_logger.error(msg);
throw new Exception(msg);
}
Pair<VirtualDisk, String> vdisk = vmMo.getDiskDevice(path);
if (vdisk == null) {
if (s_logger.isTraceEnabled())
s_logger.trace("resize volume done (failed)");
throw new Exception("No such disk device: " + path);
}
// IDE virtual disk cannot be re-sized if VM is running
if (vdisk.second() != null && vdisk.second().contains("ide")) {
throw new Exception("Re-sizing a virtual disk over IDE controller is not supported in VMware hypervisor. " +
"Please re-try when virtual disk is attached to a VM using SCSI controller.");
}
if (vdisk.second() != null && !vdisk.second().toLowerCase().startsWith("scsi"))
{
s_logger.error("Unsupported disk device bus "+ vdisk.second());
throw new Exception("Unsupported disk device bus "+ vdisk.second());
}
VirtualDisk disk = vdisk.first();
if ((VirtualDiskFlatVer2BackingInfo)disk.getBacking() != null && ((VirtualDiskFlatVer2BackingInfo)disk.getBacking()).getParent() != null)
{
s_logger.error("Resize is not supported because Disk device has Parent "+ ((VirtualDiskFlatVer2BackingInfo)disk.getBacking()).getParent().getUuid());
throw new Exception("Resize is not supported because Disk device has Parent "+ ((VirtualDiskFlatVer2BackingInfo)disk.getBacking()).getParent().getUuid());
}
String vmdkAbsFile = getAbsoluteVmdkFile(disk);
if (vmdkAbsFile != null && !vmdkAbsFile.isEmpty()) {
vmMo.updateAdapterTypeIfRequired(vmdkAbsFile);
}
disk.setCapacityInKB(newSize);
VirtualMachineConfigSpec vmConfigSpec = new VirtualMachineConfigSpec();
VirtualDeviceConfigSpec deviceConfigSpec = new VirtualDeviceConfigSpec();
deviceConfigSpec.setDevice(disk);
deviceConfigSpec.setOperation(VirtualDeviceConfigSpecOperation.EDIT);
vmConfigSpec.getDeviceChange().add(deviceConfigSpec);
if (!vmMo.configureVm(vmConfigSpec)) {
throw new Exception("Failed to configure VM to resize disk. vmName: " + vmName);
}
return new ResizeVolumeAnswer(cmd, true, "success", newSize * 1024);
} catch (Exception e) {
s_logger.error("Unable to resize volume", e);
String error = "Failed to resize volume: " + e.getMessage();
return new ResizeVolumeAnswer(cmd, false, error);
} finally {
try {
if (useWorkerVm == true) {
s_logger.info("Destroy worker VM after volume resize");
vmMo.detachDisk(vmdkDataStorePath, false);
vmMo.destroy();
}
} catch (Throwable e) {
s_logger.info("Failed to destroy worker VM: " + vmName);
}
}
}
protected Answer execute(CheckNetworkCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CheckNetworkCommand " + _gson.toJson(cmd));
}
// TODO setup portgroup for private network needs to be done here now
return new CheckNetworkAnswer(cmd, true, "Network Setup check by names is done");
}
protected Answer execute(NetworkUsageCommand cmd) {
if (cmd.isForVpc()) {
return VPCNetworkUsage(cmd);
}
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource NetworkUsageCommand " + _gson.toJson(cmd));
}
if (cmd.getOption() != null && cmd.getOption().equals("create")) {
String result = networkUsage(cmd.getPrivateIP(), "create", null);
NetworkUsageAnswer answer = new NetworkUsageAnswer(cmd, result, 0L, 0L);
return answer;
}
long[] stats = getNetworkStats(cmd.getPrivateIP());
NetworkUsageAnswer answer = new NetworkUsageAnswer(cmd, "", stats[0], stats[1]);
return answer;
}
protected NetworkUsageAnswer VPCNetworkUsage(NetworkUsageCommand cmd) {
String privateIp = cmd.getPrivateIP();
String option = cmd.getOption();
String publicIp = cmd.getGatewayIP();
String args = "-l " + publicIp + " ";
if (option.equals("get")) {
args += "-g";
} else if (option.equals("create")) {
args += "-c";
String vpcCIDR = cmd.getVpcCIDR();
args += " -v " + vpcCIDR;
} else if (option.equals("reset")) {
args += "-r";
} else if (option.equals("vpn")) {
args += "-n";
} else if (option.equals("remove")) {
args += "-d";
} else {
return new NetworkUsageAnswer(cmd, "success", 0L, 0L);
}
ExecutionResult callResult = executeInVR(privateIp, "vpc_netusage.sh", args);
if (!callResult.isSuccess()) {
s_logger.error("Unable to execute NetworkUsage command on DomR (" + privateIp + "), domR may not be ready yet. failure due to " + callResult.getDetails());
}
if (option.equals("get") || option.equals("vpn")) {
String result = callResult.getDetails();
if (result == null || result.isEmpty()) {
s_logger.error(" vpc network usage get returns empty ");
}
long[] stats = new long[2];
if (result != null) {
String[] splitResult = result.split(":");
int i = 0;
while (i < splitResult.length - 1) {
stats[0] += Long.parseLong(splitResult[i++]);
stats[1] += Long.parseLong(splitResult[i++]);
}
return new NetworkUsageAnswer(cmd, "success", stats[0], stats[1]);
}
}
return new NetworkUsageAnswer(cmd, "success", 0L, 0L);
}
@Override
public ExecutionResult createFileInVR(String routerIp, String filePath, String fileName, String content) {
VmwareManager mgr = getServiceContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
File keyFile = mgr.getSystemVMKeyFile();
try {
SshHelper.scpTo(routerIp, 3922, "root", keyFile, null, filePath, content.getBytes("UTF-8"), fileName, null);
} catch (Exception e) {
s_logger.warn("Fail to create file " + filePath + fileName + " in VR " + routerIp, e);
return new ExecutionResult(false, e.getMessage());
}
return new ExecutionResult(true, null);
}
@Override
public ExecutionResult prepareCommand(NetworkElementCommand cmd) {
//Update IP used to access router
cmd.setRouterAccessIp(getRouterSshControlIp(cmd));
assert cmd.getRouterAccessIp() != null;
if (cmd instanceof IpAssocVpcCommand) {
return prepareNetworkElementCommand((IpAssocVpcCommand)cmd);
} else if (cmd instanceof IpAssocCommand) {
return prepareNetworkElementCommand((IpAssocCommand)cmd);
} else if (cmd instanceof SetSourceNatCommand) {
return prepareNetworkElementCommand((SetSourceNatCommand)cmd);
} else if (cmd instanceof SetupGuestNetworkCommand) {
return prepareNetworkElementCommand((SetupGuestNetworkCommand)cmd);
} else if (cmd instanceof SetNetworkACLCommand) {
return prepareNetworkElementCommand((SetNetworkACLCommand)cmd);
}
return new ExecutionResult(true, null);
}
@Override
public ExecutionResult cleanupCommand(NetworkElementCommand cmd) {
return new ExecutionResult(true, null);
}
//
// list IP with eth devices
// ifconfig ethx |grep -B1 "inet addr" | awk '{ if ( $1 == "inet" ) { print $2 } else if ( $2 == "Link" ) { printf "%s:" ,$1 } }'
// | awk -F: '{ print $1 ": " $3 }'
//
// returns
// eth0:xx.xx.xx.xx
//
//
private int findRouterEthDeviceIndex(String domrName, String routerIp, String mac) throws Exception {
VmwareManager mgr = getServiceContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
s_logger.info("findRouterEthDeviceIndex. mac: " + mac);
ArrayList<String> skipInterfaces = new ArrayList<String>(Arrays.asList("all", "default", "lo"));
// when we dynamically plug in a new NIC into virtual router, it may take time to show up in guest OS
// we use a waiting loop here as a workaround to synchronize activities in systems
long startTick = System.currentTimeMillis();
long waitTimeoutMillis = VmwareManager.s_vmwareNicHotplugWaitTimeout.value();
while (System.currentTimeMillis() - startTick < waitTimeoutMillis) {
// TODO : this is a temporary very inefficient solution, will refactor it later
Pair<Boolean, String> result = SshHelper.sshExecute(routerIp, DefaultDomRSshPort, "root", mgr.getSystemVMKeyFile(), null, "ls /proc/sys/net/ipv4/conf");
if (result.first()) {
String[] tokens = result.second().split("\\s+");
for (String token : tokens) {
if (!(skipInterfaces.contains(token))) {
String cmd = String.format("ip address show %s | grep link/ether | sed -e 's/^[ \t]*//' | cut -d' ' -f2", token);
if (s_logger.isDebugEnabled())
s_logger.debug("Run domr script " + cmd);
Pair<Boolean, String> result2 = SshHelper.sshExecute(routerIp, DefaultDomRSshPort, "root", mgr.getSystemVMKeyFile(), null,
// TODO need to find the dev index inside router based on IP address
cmd);
if (s_logger.isDebugEnabled())
s_logger.debug("result: " + result2.first() + ", output: " + result2.second());
if (result2.first() && result2.second().trim().equalsIgnoreCase(mac.trim())) {
return Integer.parseInt(token.substring(3));
} else {
skipInterfaces.add(token);
}
}
}
}
s_logger.warn("can not find intereface associated with mac: " + mac + ", guest OS may still at loading state, retry...");
try {
Thread.currentThread();
Thread.sleep(1000);
} catch (InterruptedException e) {
s_logger.debug("[ignored] interupted while trying to get mac.");
}
}
return -1;
}
private VirtualDevice findVirtualNicDevice(VirtualMachineMO vmMo, String mac) throws Exception {
VirtualDevice[] nics = vmMo.getNicDevices();
for (VirtualDevice nic : nics) {
if (nic instanceof VirtualEthernetCard) {
if (((VirtualEthernetCard)nic).getMacAddress().equals(mac))
return nic;
}
}
return null;
}
protected ExecutionResult prepareNetworkElementCommand(SetupGuestNetworkCommand cmd) {
NicTO nic = cmd.getNic();
String routerIp = getRouterSshControlIp(cmd);
String domrName =
cmd.getAccessDetail(NetworkElementCommand.ROUTER_NAME);
try {
int ethDeviceNum = findRouterEthDeviceIndex(domrName, routerIp,
nic.getMac());
nic.setDeviceId(ethDeviceNum);
} catch (Exception e) {
String msg = "Prepare SetupGuestNetwork failed due to " + e.toString();
s_logger.warn(msg, e);
return new ExecutionResult(false, msg);
}
return new ExecutionResult(true, null);
}
private ExecutionResult prepareNetworkElementCommand(IpAssocVpcCommand cmd) {
String routerName = cmd.getAccessDetail(NetworkElementCommand.ROUTER_NAME);
String routerIp = getRouterSshControlIp(cmd);
try {
IpAddressTO[] ips = cmd.getIpAddresses();
for (IpAddressTO ip : ips) {
int ethDeviceNum = findRouterEthDeviceIndex(routerName, routerIp, ip.getVifMacAddress());
if (ethDeviceNum < 0) {
if (ip.isAdd()) {
throw new InternalErrorException("Failed to find DomR VIF to associate/disassociate IP with.");
} else {
s_logger.debug("VIF to deassociate IP with does not exist, return success");
continue;
}
}
ip.setNicDevId(ethDeviceNum);
}
} catch (Exception e) {
s_logger.error("Prepare Ip Assoc failure on applying one ip due to exception: ", e);
return new ExecutionResult(false, e.toString());
}
return new ExecutionResult(true, null);
}
protected ExecutionResult prepareNetworkElementCommand(SetSourceNatCommand cmd) {
String routerName = cmd.getAccessDetail(NetworkElementCommand.ROUTER_NAME);
String routerIp = getRouterSshControlIp(cmd);
IpAddressTO pubIp = cmd.getIpAddress();
try {
int ethDeviceNum = findRouterEthDeviceIndex(routerName, routerIp, pubIp.getVifMacAddress());
pubIp.setNicDevId(ethDeviceNum);
} catch (Exception e) {
String msg = "Prepare Ip SNAT failure due to " + e.toString();
s_logger.error(msg, e);
return new ExecutionResult(false, e.toString());
}
return new ExecutionResult(true, null);
}
private ExecutionResult prepareNetworkElementCommand(SetNetworkACLCommand cmd) {
NicTO nic = cmd.getNic();
String routerName =
cmd.getAccessDetail(NetworkElementCommand.ROUTER_NAME);
String routerIp = getRouterSshControlIp(cmd);
try {
int ethDeviceNum = findRouterEthDeviceIndex(routerName, routerIp,
nic.getMac());
nic.setDeviceId(ethDeviceNum);
} catch (Exception e) {
String msg = "Prepare SetNetworkACL failed due to " + e.toString();
s_logger.error(msg, e);
return new ExecutionResult(false, msg);
}
return new ExecutionResult(true, null);
}
private PlugNicAnswer execute(PlugNicCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource PlugNicCommand " + _gson.toJson(cmd));
}
getServiceContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
VmwareContext context = getServiceContext();
try {
VmwareHypervisorHost hyperHost = getHyperHost(context);
String vmName = cmd.getVmName();
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(vmName);
if (vmMo == null) {
if (hyperHost instanceof HostMO) {
ClusterMO clusterMo = new ClusterMO(hyperHost.getContext(), ((HostMO)hyperHost).getParentMor());
vmMo = clusterMo.findVmOnHyperHost(vmName);
}
}
if (vmMo == null) {
String msg = "Router " + vmName + " no longer exists to execute PlugNic command";
s_logger.error(msg);
throw new Exception(msg);
}
/*
if(!isVMWareToolsInstalled(vmMo)){
String errMsg = "vmware tools is not installed or not running, cannot add nic to vm " + vmName;
s_logger.debug(errMsg);
return new PlugNicAnswer(cmd, false, "Unable to execute PlugNicCommand due to " + errMsg);
}
*/
// Fallback to E1000 if no specific nicAdapter is passed
VirtualEthernetCardType nicDeviceType = VirtualEthernetCardType.E1000;
Map<String, String> details = cmd.getDetails();
if (details != null) {
nicDeviceType = VirtualEthernetCardType.valueOf((String) details.get("nicAdapter"));
}
// find a usable device number in VMware environment
VirtualDevice[] nicDevices = vmMo.getNicDevices();
int deviceNumber = -1;
for (VirtualDevice device : nicDevices) {
if (device.getUnitNumber() > deviceNumber)
deviceNumber = device.getUnitNumber();
}
deviceNumber++;
NicTO nicTo = cmd.getNic();
VirtualDevice nic;
Pair<ManagedObjectReference, String> networkInfo = prepareNetworkFromNicInfo(vmMo.getRunningHost(), nicTo, false, cmd.getVMType());
String dvSwitchUuid = null;
if (VmwareHelper.isDvPortGroup(networkInfo.first())) {
ManagedObjectReference dcMor = hyperHost.getHyperHostDatacenter();
DatacenterMO dataCenterMo = new DatacenterMO(context, dcMor);
ManagedObjectReference dvsMor = dataCenterMo.getDvSwitchMor(networkInfo.first());
dvSwitchUuid = dataCenterMo.getDvSwitchUuid(dvsMor);
s_logger.info("Preparing NIC device on dvSwitch : " + dvSwitchUuid);
nic =
VmwareHelper.prepareDvNicDevice(vmMo, networkInfo.first(), nicDeviceType, networkInfo.second(), dvSwitchUuid, nicTo.getMac(), deviceNumber,
deviceNumber + 1, true, true);
} else {
s_logger.info("Preparing NIC device on network " + networkInfo.second());
nic =
VmwareHelper.prepareNicDevice(vmMo, networkInfo.first(), nicDeviceType, networkInfo.second(), nicTo.getMac(), deviceNumber, deviceNumber + 1, true,
true);
}
VirtualMachineConfigSpec vmConfigSpec = new VirtualMachineConfigSpec();
//VirtualDeviceConfigSpec[] deviceConfigSpecArray = new VirtualDeviceConfigSpec[1];
VirtualDeviceConfigSpec deviceConfigSpec = new VirtualDeviceConfigSpec();
deviceConfigSpec.setDevice(nic);
deviceConfigSpec.setOperation(VirtualDeviceConfigSpecOperation.ADD);
vmConfigSpec.getDeviceChange().add(deviceConfigSpec);
setNuageVspVrIpInExtraConfig(vmConfigSpec.getExtraConfig(), nicTo, dvSwitchUuid);
if (!vmMo.configureVm(vmConfigSpec)) {
throw new Exception("Failed to configure devices when running PlugNicCommand");
}
return new PlugNicAnswer(cmd, true, "success");
} catch (Exception e) {
s_logger.error("Unexpected exception: ", e);
return new PlugNicAnswer(cmd, false, "Unable to execute PlugNicCommand due to " + e.toString());
}
}
private UnPlugNicAnswer execute(UnPlugNicCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource UnPlugNicCommand " + _gson.toJson(cmd));
}
VmwareContext context = getServiceContext();
try {
VmwareHypervisorHost hyperHost = getHyperHost(context);
String vmName = cmd.getVmName();
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(vmName);
if (vmMo == null) {
if (hyperHost instanceof HostMO) {
ClusterMO clusterMo = new ClusterMO(hyperHost.getContext(), ((HostMO)hyperHost).getParentMor());
vmMo = clusterMo.findVmOnHyperHost(vmName);
}
}
if (vmMo == null) {
String msg = "VM " + vmName + " no longer exists to execute UnPlugNic command";
s_logger.error(msg);
throw new Exception(msg);
}
/*
if(!isVMWareToolsInstalled(vmMo)){
String errMsg = "vmware tools not installed or not running, cannot remove nic from vm " + vmName;
s_logger.debug(errMsg);
return new UnPlugNicAnswer(cmd, false, "Unable to execute unPlugNicCommand due to " + errMsg);
}
*/
VirtualDevice nic = findVirtualNicDevice(vmMo, cmd.getNic().getMac());
if (nic == null) {
return new UnPlugNicAnswer(cmd, true, "success");
}
VirtualMachineConfigSpec vmConfigSpec = new VirtualMachineConfigSpec();
//VirtualDeviceConfigSpec[] deviceConfigSpecArray = new VirtualDeviceConfigSpec[1];
VirtualDeviceConfigSpec deviceConfigSpec = new VirtualDeviceConfigSpec();
deviceConfigSpec.setDevice(nic);
deviceConfigSpec.setOperation(VirtualDeviceConfigSpecOperation.REMOVE);
vmConfigSpec.getDeviceChange().add(deviceConfigSpec);
if (!vmMo.configureVm(vmConfigSpec)) {
throw new Exception("Failed to configure devices when running unplugNicCommand");
}
return new UnPlugNicAnswer(cmd, true, "success");
} catch (Exception e) {
s_logger.error("Unexpected exception: ", e);
return new UnPlugNicAnswer(cmd, false, "Unable to execute unPlugNicCommand due to " + e.toString());
}
}
private void plugPublicNic(VirtualMachineMO vmMo, final String vlanId, final String vifMacAddress) throws Exception {
// TODO : probably need to set traffic shaping
Pair<ManagedObjectReference, String> networkInfo = null;
VirtualSwitchType vSwitchType = VirtualSwitchType.StandardVirtualSwitch;
if (_publicTrafficInfo != null) {
vSwitchType = _publicTrafficInfo.getVirtualSwitchType();
}
/** FIXME We have no clue which network this nic is on and that means that we can't figure out the BroadcastDomainType
* so we assume that it's VLAN for now
*/
if (VirtualSwitchType.StandardVirtualSwitch == vSwitchType) {
networkInfo = HypervisorHostHelper.prepareNetwork(_publicTrafficInfo.getVirtualSwitchName(),
"cloud.public", vmMo.getRunningHost(), vlanId, null, null,
_opsTimeout, true, BroadcastDomainType.Vlan, null);
} else {
networkInfo =
HypervisorHostHelper.prepareNetwork(_publicTrafficInfo.getVirtualSwitchName(), "cloud.public", vmMo.getRunningHost(), vlanId, null, null, null,
_opsTimeout, vSwitchType, _portsPerDvPortGroup, null, false, BroadcastDomainType.Vlan, _vsmCredentials);
}
int nicIndex = allocPublicNicIndex(vmMo);
try {
VirtualDevice[] nicDevices = vmMo.getNicDevices();
VirtualEthernetCard device = (VirtualEthernetCard)nicDevices[nicIndex];
if (VirtualSwitchType.StandardVirtualSwitch == vSwitchType) {
VirtualEthernetCardNetworkBackingInfo nicBacking = new VirtualEthernetCardNetworkBackingInfo();
nicBacking.setDeviceName(networkInfo.second());
nicBacking.setNetwork(networkInfo.first());
device.setBacking(nicBacking);
} else {
HostMO hostMo = vmMo.getRunningHost();
DatacenterMO dataCenterMo = new DatacenterMO(hostMo.getContext(), hostMo.getHyperHostDatacenter());
device.setBacking(dataCenterMo.getDvPortBackingInfo(networkInfo));
}
VirtualMachineConfigSpec vmConfigSpec = new VirtualMachineConfigSpec();
//VirtualDeviceConfigSpec[] deviceConfigSpecArray = new VirtualDeviceConfigSpec[1];
VirtualDeviceConfigSpec deviceConfigSpec = new VirtualDeviceConfigSpec();
deviceConfigSpec.setDevice(device);
deviceConfigSpec.setOperation(VirtualDeviceConfigSpecOperation.EDIT);
vmConfigSpec.getDeviceChange().add(deviceConfigSpec);
if (!vmMo.configureVm(vmConfigSpec)) {
throw new Exception("Failed to configure devices when plugPublicNic");
}
} catch (Exception e) {
// restore allocation mask in case of exceptions
String nicMasksStr = vmMo.getCustomFieldValue(CustomFieldConstants.CLOUD_NIC_MASK);
int nicMasks = Integer.parseInt(nicMasksStr);
nicMasks &= ~(1 << nicIndex);
vmMo.setCustomFieldValue(CustomFieldConstants.CLOUD_NIC_MASK, String.valueOf(nicMasks));
throw e;
}
}
private int allocPublicNicIndex(VirtualMachineMO vmMo) throws Exception {
String nicMasksStr = vmMo.getCustomFieldValue(CustomFieldConstants.CLOUD_NIC_MASK);
if (nicMasksStr == null || nicMasksStr.isEmpty()) {
throw new Exception("Could not find NIC allocation info");
}
int nicMasks = Integer.parseInt(nicMasksStr);
VirtualDevice[] nicDevices = vmMo.getNicDevices();
for (int i = 3; i < nicDevices.length; i++) {
if ((nicMasks & (1 << i)) == 0) {
nicMasks |= (1 << i);
vmMo.setCustomFieldValue(CustomFieldConstants.CLOUD_NIC_MASK, String.valueOf(nicMasks));
return i;
}
}
throw new Exception("Could not allocate a free public NIC");
}
private ExecutionResult prepareNetworkElementCommand(IpAssocCommand cmd) {
VmwareContext context = getServiceContext();
try {
VmwareHypervisorHost hyperHost = getHyperHost(context);
IpAddressTO[] ips = cmd.getIpAddresses();
String routerName = cmd.getAccessDetail(NetworkElementCommand.ROUTER_NAME);
String controlIp = VmwareResource.getRouterSshControlIp(cmd);
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(routerName);
// command may sometimes be redirect to a wrong host, we relax
// the check and will try to find it within cluster
if (vmMo == null) {
if (hyperHost instanceof HostMO) {
ClusterMO clusterMo = new ClusterMO(hyperHost.getContext(), ((HostMO)hyperHost).getParentMor());
vmMo = clusterMo.findVmOnHyperHost(routerName);
}
}
if (vmMo == null) {
String msg = "Router " + routerName + " no longer exists to execute IPAssoc command";
s_logger.error(msg);
throw new Exception(msg);
}
for (IpAddressTO ip : ips) {
/**
* TODO support other networks
*/
URI broadcastUri = BroadcastDomainType.fromString(ip.getBroadcastUri());
if (BroadcastDomainType.getSchemeValue(broadcastUri) != BroadcastDomainType.Vlan) {
throw new InternalErrorException("Unable to assign a public IP to a VIF on network " + ip.getBroadcastUri());
}
String vlanId = BroadcastDomainType.getValue(broadcastUri);
String publicNeworkName = HypervisorHostHelper.getPublicNetworkNamePrefix(vlanId);
Pair<Integer, VirtualDevice> publicNicInfo = vmMo.getNicDeviceIndex(publicNeworkName);
if (s_logger.isDebugEnabled()) {
s_logger.debug("Find public NIC index, public network name: " + publicNeworkName + ", index: " + publicNicInfo.first());
}
boolean addVif = false;
if (ip.isAdd() && publicNicInfo.first().intValue() == -1) {
if (s_logger.isDebugEnabled()) {
s_logger.debug("Plug new NIC to associate" + controlIp + " to " + ip.getPublicIp());
}
addVif = true;
}
if (addVif) {
plugPublicNic(vmMo, vlanId, ip.getVifMacAddress());
publicNicInfo = vmMo.getNicDeviceIndex(publicNeworkName);
if (publicNicInfo.first().intValue() >= 0) {
networkUsage(controlIp, "addVif", "eth" + publicNicInfo.first());
}
}
if (publicNicInfo.first().intValue() < 0) {
String msg = "Failed to find DomR VIF to associate/disassociate IP with.";
s_logger.error(msg);
throw new InternalErrorException(msg);
}
ip.setNicDevId(publicNicInfo.first().intValue());
ip.setNewNic(addVif);
}
} catch (Throwable e) {
s_logger.error("Unexpected exception: " + e.toString() + " will shortcut rest of IPAssoc commands", e);
return new ExecutionResult(false, e.toString());
}
return new ExecutionResult(true, null);
}
@Override
public ExecutionResult executeInVR(String routerIP, String script, String args) {
return executeInVR(routerIP, script, args, VRScripts.VR_SCRIPT_EXEC_TIMEOUT);
}
@Override
public ExecutionResult executeInVR(String routerIP, String script, String args, Duration timeout) {
Pair<Boolean, String> result;
//TODO: Password should be masked, cannot output to log directly
if (s_logger.isDebugEnabled()) {
s_logger.debug("Run command on VR: " + routerIP + ", script: " + script + " with args: " + args);
}
try {
VmwareManager mgr = getServiceContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
result = SshHelper.sshExecute(routerIP, DefaultDomRSshPort, "root", mgr.getSystemVMKeyFile(), null, "/opt/cloud/bin/" + script + " " + args,
VRScripts.CONNECTION_TIMEOUT, VRScripts.CONNECTION_TIMEOUT, timeout);
} catch (Exception e) {
String msg = "Command failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg);
result = new Pair<Boolean, String>(false, msg);
}
if (s_logger.isDebugEnabled()) {
s_logger.debug(script + " execution result: " + result.first().toString());
}
return new ExecutionResult(result.first(), result.second());
}
protected CheckSshAnswer execute(CheckSshCommand cmd) {
String vmName = cmd.getName();
String privateIp = cmd.getIp();
int cmdPort = cmd.getPort();
if (s_logger.isDebugEnabled()) {
s_logger.debug("Ping command port, " + privateIp + ":" + cmdPort);
}
try {
String result = connect(cmd.getName(), privateIp, cmdPort);
if (result != null) {
s_logger.error("Can not ping System vm " + vmName + "due to:" + result);
return new CheckSshAnswer(cmd, "Can not ping System vm " + vmName + "due to:" + result);
}
} catch (Exception e) {
s_logger.error("Can not ping System vm " + vmName + "due to exception");
return new CheckSshAnswer(cmd, e);
}
if (s_logger.isDebugEnabled()) {
s_logger.debug("Ping command port succeeded for vm " + vmName);
}
if (VirtualMachineName.isValidRouterName(vmName)) {
if (s_logger.isDebugEnabled()) {
s_logger.debug("Execute network usage setup command on " + vmName);
}
networkUsage(privateIp, "create", null);
}
return new CheckSshAnswer(cmd);
}
private DiskTO[] validateDisks(DiskTO[] disks) {
List<DiskTO> validatedDisks = new ArrayList<DiskTO>();
for (DiskTO vol : disks) {
if (vol.getType() != Volume.Type.ISO) {
VolumeObjectTO volumeTO = (VolumeObjectTO)vol.getData();
DataStoreTO primaryStore = volumeTO.getDataStore();
if (primaryStore.getUuid() != null && !primaryStore.getUuid().isEmpty()) {
validatedDisks.add(vol);
}
} else if (vol.getType() == Volume.Type.ISO) {
TemplateObjectTO templateTO = (TemplateObjectTO)vol.getData();
if (templateTO.getPath() != null && !templateTO.getPath().isEmpty()) {
validatedDisks.add(vol);
}
} else {
if (s_logger.isDebugEnabled()) {
s_logger.debug("Drop invalid disk option, volumeTO: " + _gson.toJson(vol));
}
}
}
return validatedDisks.toArray(new DiskTO[0]);
}
private static DiskTO getIsoDiskTO(DiskTO[] disks) {
for (DiskTO vol : disks) {
if (vol.getType() == Volume.Type.ISO) {
return vol;
}
}
return null;
}
protected ScaleVmAnswer execute(ScaleVmCommand cmd) {
VmwareContext context = getServiceContext();
VirtualMachineTO vmSpec = cmd.getVirtualMachine();
try {
VmwareHypervisorHost hyperHost = getHyperHost(context);
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(cmd.getVmName());
VirtualMachineConfigSpec vmConfigSpec = new VirtualMachineConfigSpec();
int ramMb = getReservedMemoryMb(vmSpec);
long hotaddIncrementSizeInMb;
long hotaddMemoryLimitInMb;
long requestedMaxMemoryInMb = vmSpec.getMaxRam() / (1024 * 1024);
// Check if VM is really running on hypervisor host
if (getVmPowerState(vmMo) != PowerState.PowerOn) {
throw new CloudRuntimeException("Found that the VM " + vmMo.getVmName() + " is not running. Unable to scale-up this VM");
}
// Check max hot add limit
hotaddIncrementSizeInMb = vmMo.getHotAddMemoryIncrementSizeInMb();
hotaddMemoryLimitInMb = vmMo.getHotAddMemoryLimitInMb();
if (requestedMaxMemoryInMb > hotaddMemoryLimitInMb) {
throw new CloudRuntimeException("Memory of VM " + vmMo.getVmName() + " cannot be scaled to " + requestedMaxMemoryInMb + "MB." +
" Requested memory limit is beyond the hotadd memory limit for this VM at the moment is " + hotaddMemoryLimitInMb + "MB.");
}
// Check increment is multiple of increment size
long reminder = requestedMaxMemoryInMb % hotaddIncrementSizeInMb;
if (reminder != 0) {
requestedMaxMemoryInMb = requestedMaxMemoryInMb + hotaddIncrementSizeInMb - reminder;
}
// Check if license supports the feature
VmwareHelper.isFeatureLicensed(hyperHost, FeatureKeyConstants.HOTPLUG);
VmwareHelper.setVmScaleUpConfig(vmConfigSpec, vmSpec.getCpus(), vmSpec.getMaxSpeed(), vmSpec.getMinSpeed(), (int)requestedMaxMemoryInMb, ramMb,
vmSpec.getLimitCpuUse());
if (!vmMo.configureVm(vmConfigSpec)) {
throw new Exception("Unable to execute ScaleVmCommand");
}
} catch (Exception e) {
s_logger.error("Unexpected exception: ", e);
return new ScaleVmAnswer(cmd, false, "Unable to execute ScaleVmCommand due to " + e.toString());
}
return new ScaleVmAnswer(cmd, true, null);
}
protected void ensureDiskControllers(VirtualMachineMO vmMo, Pair<String, String> controllerInfo) throws Exception {
if (vmMo == null) {
return;
}
String msg;
String rootDiskController = controllerInfo.first();
String dataDiskController = controllerInfo.second();
String scsiDiskController;
String recommendedDiskController = null;
if (VmwareHelper.isControllerOsRecommended(dataDiskController) || VmwareHelper.isControllerOsRecommended(rootDiskController)) {
recommendedDiskController = vmMo.getRecommendedDiskController(null);
}
scsiDiskController = HypervisorHostHelper.getScsiController(new Pair<String, String>(rootDiskController, dataDiskController), recommendedDiskController);
if (scsiDiskController == null) {
return;
}
vmMo.getScsiDeviceControllerKeyNoException();
// This VM needs SCSI controllers.
// Get count of existing scsi controllers. Helps not to attempt to create more than the maximum allowed 4
// Get maximum among the bus numbers in use by scsi controllers. Safe to pick maximum, because we always go sequential allocating bus numbers.
Ternary<Integer, Integer, DiskControllerType> scsiControllerInfo = vmMo.getScsiControllerInfo();
int requiredNumScsiControllers = VmwareHelper.MAX_SCSI_CONTROLLER_COUNT - scsiControllerInfo.first();
int availableBusNum = scsiControllerInfo.second() + 1; // method returned current max. bus number
if (requiredNumScsiControllers == 0) {
return;
}
if (scsiControllerInfo.first() > 0) {
// For VMs which already have a SCSI controller, do NOT attempt to add any more SCSI controllers & return the sub type.
// For Legacy VMs would have only 1 LsiLogic Parallel SCSI controller, and doesn't require more.
// For VMs created post device ordering support, 4 SCSI subtype controllers are ensured during deployment itself. No need to add more.
// For fresh VM deployment only, all required controllers should be ensured.
return;
}
ensureScsiDiskControllers(vmMo, scsiDiskController, requiredNumScsiControllers, availableBusNum);
}
private void ensureScsiDiskControllers(VirtualMachineMO vmMo, String scsiDiskController, int requiredNumScsiControllers, int availableBusNum) throws Exception {
// Pick the sub type of scsi
if (DiskControllerType.getType(scsiDiskController) == DiskControllerType.pvscsi) {
if (!vmMo.isPvScsiSupported()) {
String msg = "This VM doesn't support Vmware Paravirtual SCSI controller for virtual disks, because the virtual hardware version is less than 7.";
throw new Exception(msg);
}
vmMo.ensurePvScsiDeviceController(requiredNumScsiControllers, availableBusNum);
} else if (DiskControllerType.getType(scsiDiskController) == DiskControllerType.lsisas1068) {
vmMo.ensureLsiLogicSasDeviceControllers(requiredNumScsiControllers, availableBusNum);
} else if (DiskControllerType.getType(scsiDiskController) == DiskControllerType.buslogic) {
vmMo.ensureBusLogicDeviceControllers(requiredNumScsiControllers, availableBusNum);
} else if (DiskControllerType.getType(scsiDiskController) == DiskControllerType.lsilogic) {
vmMo.ensureScsiDeviceControllers(requiredNumScsiControllers, availableBusNum);
}
}
protected StartAnswer execute(StartCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource StartCommand: " + _gson.toJson(cmd));
}
VirtualMachineTO vmSpec = cmd.getVirtualMachine();
boolean vmAlreadyExistsInVcenter = false;
String existingVmName = null;
VirtualMachineFileInfo existingVmFileInfo = null;
VirtualMachineFileLayoutEx existingVmFileLayout = null;
Pair<String, String> names = composeVmNames(vmSpec);
String vmInternalCSName = names.first();
String vmNameOnVcenter = names.second();
String dataDiskController = vmSpec.getDetails().get(VmDetailConstants.DATA_DISK_CONTROLLER);
String rootDiskController = vmSpec.getDetails().get(VmDetailConstants.ROOT_DISK_CONTROLLER);
DiskTO rootDiskTO = null;
// If root disk controller is scsi, then data disk controller would also be scsi instead of using 'osdefault'
// This helps avoid mix of different scsi subtype controllers in instance.
if (DiskControllerType.lsilogic == DiskControllerType.getType(rootDiskController)) {
dataDiskController = DiskControllerType.scsi.toString();
}
// Validate the controller types
dataDiskController = DiskControllerType.getType(dataDiskController).toString();
rootDiskController = DiskControllerType.getType(rootDiskController).toString();
if (DiskControllerType.getType(rootDiskController) == DiskControllerType.none) {
throw new CloudRuntimeException("Invalid root disk controller detected : " + rootDiskController);
}
if (DiskControllerType.getType(dataDiskController) == DiskControllerType.none) {
throw new CloudRuntimeException("Invalid data disk controller detected : " + dataDiskController);
}
Pair<String, String> controllerInfo = new Pair<String, String>(rootDiskController, dataDiskController);
Boolean systemVm = vmSpec.getType().isUsedBySystem();
// Thus, vmInternalCSName always holds i-x-y, the cloudstack generated internal VM name.
VmwareContext context = getServiceContext();
DatacenterMO dcMo = null;
try {
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
VmwareHypervisorHost hyperHost = getHyperHost(context);
dcMo = new DatacenterMO(hyperHost.getContext(), hyperHost.getHyperHostDatacenter());
// Validate VM name is unique in Datacenter
VirtualMachineMO vmInVcenter = dcMo.checkIfVmAlreadyExistsInVcenter(vmNameOnVcenter, vmInternalCSName);
if(vmInVcenter != null) {
vmAlreadyExistsInVcenter = true;
String msg = "VM with name: " + vmNameOnVcenter +" already exists in vCenter.";
s_logger.error(msg);
throw new Exception(msg);
}
String guestOsId = translateGuestOsIdentifier(vmSpec.getArch(), vmSpec.getOs(), vmSpec.getPlatformEmulator()).value();
DiskTO[] disks = validateDisks(vmSpec.getDisks());
assert (disks.length > 0);
NicTO[] nics = vmSpec.getNics();
HashMap<String, Pair<ManagedObjectReference, DatastoreMO>> dataStoresDetails = inferDatastoreDetailsFromDiskInfo(hyperHost, context, disks, cmd);
if ((dataStoresDetails == null) || (dataStoresDetails.isEmpty())) {
String msg = "Unable to locate datastore details of the volumes to be attached";
s_logger.error(msg);
throw new Exception(msg);
}
DatastoreMO dsRootVolumeIsOn = getDatastoreThatRootDiskIsOn(dataStoresDetails, disks);
if (dsRootVolumeIsOn == null) {
String msg = "Unable to locate datastore details of root volume";
s_logger.error(msg);
throw new Exception(msg);
}
VirtualMachineDiskInfoBuilder diskInfoBuilder = null;
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(vmInternalCSName);
DiskControllerType systemVmScsiControllerType = DiskControllerType.lsilogic;
int firstScsiControllerBusNum = 0;
int numScsiControllerForSystemVm = 1;
boolean hasSnapshot = false;
if (vmMo != null) {
s_logger.info("VM " + vmInternalCSName + " already exists, tear down devices for reconfiguration");
if (getVmPowerState(vmMo) != PowerState.PowerOff)
vmMo.safePowerOff(_shutdownWaitMs);
// retrieve disk information before we tear down
diskInfoBuilder = vmMo.getDiskInfoBuilder();
hasSnapshot = vmMo.hasSnapshot();
if (!hasSnapshot)
vmMo.tearDownDevices(new Class<?>[] {VirtualDisk.class, VirtualEthernetCard.class});
else
vmMo.tearDownDevices(new Class<?>[] {VirtualEthernetCard.class});
if (systemVm) {
ensureScsiDiskControllers(vmMo, systemVmScsiControllerType.toString(), numScsiControllerForSystemVm, firstScsiControllerBusNum);
} else {
ensureDiskControllers(vmMo, controllerInfo);
}
} else {
ManagedObjectReference morDc = hyperHost.getHyperHostDatacenter();
assert (morDc != null);
vmMo = hyperHost.findVmOnPeerHyperHost(vmInternalCSName);
if (vmMo != null) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Found vm " + vmInternalCSName + " at other host, relocate to " + hyperHost.getHyperHostName());
}
takeVmFromOtherHyperHost(hyperHost, vmInternalCSName);
if (getVmPowerState(vmMo) != PowerState.PowerOff)
vmMo.safePowerOff(_shutdownWaitMs);
diskInfoBuilder = vmMo.getDiskInfoBuilder();
hasSnapshot = vmMo.hasSnapshot();
if (!hasSnapshot)
vmMo.tearDownDevices(new Class<?>[] {VirtualDisk.class, VirtualEthernetCard.class});
else
vmMo.tearDownDevices(new Class<?>[] {VirtualEthernetCard.class});
if (systemVm) {
// System volumes doesn't require more than 1 SCSI controller as there is no requirement for data volumes.
ensureScsiDiskControllers(vmMo, systemVmScsiControllerType.toString(), numScsiControllerForSystemVm, firstScsiControllerBusNum);
} else {
ensureDiskControllers(vmMo, controllerInfo);
}
} else {
// If a VM with the same name is found in a different cluster in the DC, unregister the old VM and configure a new VM (cold-migration).
VirtualMachineMO existingVmInDc = dcMo.findVm(vmInternalCSName);
if (existingVmInDc != null) {
s_logger.debug("Found VM: " + vmInternalCSName + " on a host in a different cluster. Unregistering the exisitng VM.");
existingVmName = existingVmInDc.getName();
existingVmFileInfo = existingVmInDc.getFileInfo();
existingVmFileLayout = existingVmInDc.getFileLayout();
existingVmInDc.unregisterVm();
}
Pair<ManagedObjectReference, DatastoreMO> rootDiskDataStoreDetails = null;
for (DiskTO vol : disks) {
if (vol.getType() == Volume.Type.ROOT) {
Map<String, String> details = vol.getDetails();
boolean managed = false;
if (details != null) {
managed = Boolean.parseBoolean(details.get(DiskTO.MANAGED));
}
if (managed) {
String datastoreName = VmwareResource.getDatastoreName(details.get(DiskTO.IQN));
rootDiskDataStoreDetails = dataStoresDetails.get(datastoreName);
}
else {
DataStoreTO primaryStore = vol.getData().getDataStore();
rootDiskDataStoreDetails = dataStoresDetails.get(primaryStore.getUuid());
}
}
}
assert (vmSpec.getMinSpeed() != null) && (rootDiskDataStoreDetails != null);
boolean vmFolderExists = rootDiskDataStoreDetails.second().folderExists(String.format("[%s]", rootDiskDataStoreDetails.second().getName()), vmNameOnVcenter);
String vmxFileFullPath = dsRootVolumeIsOn.searchFileInSubFolders(vmNameOnVcenter + ".vmx", false);
if (vmFolderExists && vmxFileFullPath != null) { // VM can be registered only if .vmx is present.
registerVm(vmNameOnVcenter, dsRootVolumeIsOn);
vmMo = hyperHost.findVmOnHyperHost(vmInternalCSName);
if (vmMo != null) {
if (s_logger.isDebugEnabled()) {
s_logger.debug("Found registered vm " + vmInternalCSName + " at host " + hyperHost.getHyperHostName());
}
}
tearDownVm(vmMo);
}else if (!hyperHost.createBlankVm(vmNameOnVcenter, vmInternalCSName, vmSpec.getCpus(), vmSpec.getMaxSpeed().intValue(),
getReservedCpuMHZ(vmSpec), vmSpec.getLimitCpuUse(), (int)(vmSpec.getMaxRam() / (1024 * 1024)), getReservedMemoryMb(vmSpec),
guestOsId, rootDiskDataStoreDetails.first(), false, controllerInfo, systemVm)) {
throw new Exception("Failed to create VM. vmName: " + vmInternalCSName);
}
}
vmMo = hyperHost.findVmOnHyperHost(vmInternalCSName);
if (vmMo == null) {
throw new Exception("Failed to find the newly create or relocated VM. vmName: " + vmInternalCSName);
}
}
int totalChangeDevices = disks.length + nics.length;
DiskTO volIso = null;
if (vmSpec.getType() != VirtualMachine.Type.User) {
// system VM needs a patch ISO
totalChangeDevices++;
} else {
volIso = getIsoDiskTO(disks);
if (volIso == null)
totalChangeDevices++;
}
VirtualMachineConfigSpec vmConfigSpec = new VirtualMachineConfigSpec();
VmwareHelper.setBasicVmConfig(vmConfigSpec, vmSpec.getCpus(), vmSpec.getMaxSpeed(),
getReservedCpuMHZ(vmSpec), (int)(vmSpec.getMaxRam() / (1024 * 1024)), getReservedMemoryMb(vmSpec),
guestOsId, vmSpec.getLimitCpuUse());
// Check for multi-cores per socket settings
int numCoresPerSocket = 1;
String coresPerSocket = vmSpec.getDetails().get("cpu.corespersocket");
if (coresPerSocket != null) {
String apiVersion = HypervisorHostHelper.getVcenterApiVersion(vmMo.getContext());
// Property 'numCoresPerSocket' is supported since vSphere API 5.0
if (apiVersion.compareTo("5.0") >= 0) {
numCoresPerSocket = NumbersUtil.parseInt(coresPerSocket, 1);
vmConfigSpec.setNumCoresPerSocket(numCoresPerSocket);
}
}
// Check for hotadd settings
vmConfigSpec.setMemoryHotAddEnabled(vmMo.isMemoryHotAddSupported(guestOsId));
String hostApiVersion = ((HostMO)hyperHost).getHostAboutInfo().getApiVersion();
if (numCoresPerSocket > 1 && hostApiVersion.compareTo("5.0") < 0) {
s_logger.warn("Dynamic scaling of CPU is not supported for Virtual Machines with multi-core vCPUs in case of ESXi hosts 4.1 and prior. Hence CpuHotAdd will not be"
+ " enabled for Virtual Machine: " + vmInternalCSName);
vmConfigSpec.setCpuHotAddEnabled(false);
} else {
vmConfigSpec.setCpuHotAddEnabled(vmMo.isCpuHotAddSupported(guestOsId));
}
configNestedHVSupport(vmMo, vmSpec, vmConfigSpec);
VirtualDeviceConfigSpec[] deviceConfigSpecArray = new VirtualDeviceConfigSpec[totalChangeDevices];
int i = 0;
int ideUnitNumber = 0;
int scsiUnitNumber = 0;
int nicUnitNumber = 0;
int ideControllerKey = vmMo.getIDEDeviceControllerKey();
int scsiControllerKey = vmMo.getGenericScsiDeviceControllerKeyNoException();
int controllerKey;
//
// Setup ISO device
//
// prepare systemvm patch ISO
if (vmSpec.getType() != VirtualMachine.Type.User) {
// attach ISO (for patching of system VM)
Pair<String, Long> secStoreUrlAndId = mgr.getSecondaryStorageStoreUrlAndId(Long.parseLong(_dcId));
String secStoreUrl = secStoreUrlAndId.first();
Long secStoreId = secStoreUrlAndId.second();
if (secStoreUrl == null) {
String msg = "secondary storage for dc " + _dcId + " is not ready yet?";
throw new Exception(msg);
}
mgr.prepareSecondaryStorageStore(secStoreUrl, secStoreId);
ManagedObjectReference morSecDs = prepareSecondaryDatastoreOnHost(secStoreUrl);
if (morSecDs == null) {
String msg = "Failed to prepare secondary storage on host, secondary store url: " + secStoreUrl;
throw new Exception(msg);
}
DatastoreMO secDsMo = new DatastoreMO(hyperHost.getContext(), morSecDs);
deviceConfigSpecArray[i] = new VirtualDeviceConfigSpec();
Pair<VirtualDevice, Boolean> isoInfo =
VmwareHelper.prepareIsoDevice(vmMo, String.format("[%s] systemvm/%s", secDsMo.getName(), mgr.getSystemVMIsoFileNameOnDatastore()), secDsMo.getMor(),
true, true, ideUnitNumber++, i + 1);
deviceConfigSpecArray[i].setDevice(isoInfo.first());
if (isoInfo.second()) {
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare ISO volume at new device " + _gson.toJson(isoInfo.first()));
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.ADD);
} else {
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare ISO volume at existing device " + _gson.toJson(isoInfo.first()));
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.EDIT);
}
} else {
// Note: we will always plug a CDROM device
if (volIso != null) {
TemplateObjectTO iso = (TemplateObjectTO)volIso.getData();
if (iso.getPath() != null && !iso.getPath().isEmpty()) {
DataStoreTO imageStore = iso.getDataStore();
if (!(imageStore instanceof NfsTO)) {
s_logger.debug("unsupported protocol");
throw new Exception("unsupported protocol");
}
NfsTO nfsImageStore = (NfsTO)imageStore;
String isoPath = nfsImageStore.getUrl() + File.separator + iso.getPath();
Pair<String, ManagedObjectReference> isoDatastoreInfo = getIsoDatastoreInfo(hyperHost, isoPath);
assert (isoDatastoreInfo != null);
assert (isoDatastoreInfo.second() != null);
deviceConfigSpecArray[i] = new VirtualDeviceConfigSpec();
Pair<VirtualDevice, Boolean> isoInfo =
VmwareHelper.prepareIsoDevice(vmMo, isoDatastoreInfo.first(), isoDatastoreInfo.second(), true, true, ideUnitNumber++, i + 1);
deviceConfigSpecArray[i].setDevice(isoInfo.first());
if (isoInfo.second()) {
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare ISO volume at new device " + _gson.toJson(isoInfo.first()));
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.ADD);
} else {
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare ISO volume at existing device " + _gson.toJson(isoInfo.first()));
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.EDIT);
}
}
} else {
deviceConfigSpecArray[i] = new VirtualDeviceConfigSpec();
Pair<VirtualDevice, Boolean> isoInfo = VmwareHelper.prepareIsoDevice(vmMo, null, null, true, true, ideUnitNumber++, i + 1);
deviceConfigSpecArray[i].setDevice(isoInfo.first());
if (isoInfo.second()) {
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare ISO volume at existing device " + _gson.toJson(isoInfo.first()));
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.ADD);
} else {
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare ISO volume at existing device " + _gson.toJson(isoInfo.first()));
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.EDIT);
}
}
}
i++;
//
// Setup ROOT/DATA disk devices
//
DiskTO[] sortedDisks = sortVolumesByDeviceId(disks);
for (DiskTO vol : sortedDisks) {
if (vol.getType() == Volume.Type.ISO)
continue;
VirtualMachineDiskInfo matchingExistingDisk = getMatchingExistingDisk(diskInfoBuilder, vol, hyperHost, context);
controllerKey = getDiskController(matchingExistingDisk, vol, vmSpec, ideControllerKey, scsiControllerKey);
String diskController = getDiskController(vmMo, matchingExistingDisk, vol, new Pair<String, String>(rootDiskController, dataDiskController));
if (DiskControllerType.getType(diskController) == DiskControllerType.osdefault) {
diskController = vmMo.getRecommendedDiskController(null);
}
if (DiskControllerType.getType(diskController) == DiskControllerType.ide) {
controllerKey = vmMo.getIDEControllerKey(ideUnitNumber);
if (vol.getType() == Volume.Type.DATADISK) {
// Could be result of flip due to user configured setting or "osdefault" for data disks
// Ensure maximum of 2 data volumes over IDE controller, 3 includeing root volume
if (vmMo.getNumberOfVirtualDisks() > 3) {
throw new CloudRuntimeException("Found more than 3 virtual disks attached to this VM [" + vmMo.getVmName() + "]. Unable to implement the disks over "
+ diskController + " controller, as maximum number of devices supported over IDE controller is 4 includeing CDROM device.");
}
}
} else {
controllerKey = vmMo.getScsiDiskControllerKeyNoException(diskController);
if (controllerKey == -1) {
// This may happen for ROOT legacy VMs which doesn't have recommended disk controller when global configuration parameter 'vmware.root.disk.controller' is set to "osdefault"
// Retrieve existing controller and use.
Ternary<Integer, Integer, DiskControllerType> vmScsiControllerInfo = vmMo.getScsiControllerInfo();
DiskControllerType existingControllerType = vmScsiControllerInfo.third();
controllerKey = vmMo.getScsiDiskControllerKeyNoException(existingControllerType.toString());
}
}
if (!hasSnapshot) {
deviceConfigSpecArray[i] = new VirtualDeviceConfigSpec();
VolumeObjectTO volumeTO = (VolumeObjectTO)vol.getData();
DataStoreTO primaryStore = volumeTO.getDataStore();
Map<String, String> details = vol.getDetails();
boolean managed = false;
String iScsiName = null;
if (details != null) {
managed = Boolean.parseBoolean(details.get(DiskTO.MANAGED));
iScsiName = details.get(DiskTO.IQN);
}
// if the storage is managed, iScsiName should not be null
String datastoreName = managed ? VmwareResource.getDatastoreName(iScsiName) : primaryStore.getUuid();
Pair<ManagedObjectReference, DatastoreMO> volumeDsDetails = dataStoresDetails.get(datastoreName);
assert (volumeDsDetails != null);
String[] diskChain = syncDiskChain(dcMo, vmMo, vmSpec,
vol, matchingExistingDisk,
dataStoresDetails);
if(controllerKey == scsiControllerKey && VmwareHelper.isReservedScsiDeviceNumber(scsiUnitNumber))
scsiUnitNumber++;
VirtualDevice device = VmwareHelper.prepareDiskDevice(vmMo, null, controllerKey,
diskChain,
volumeDsDetails.first(),
(controllerKey == vmMo.getIDEControllerKey(ideUnitNumber)) ? ((ideUnitNumber++) % VmwareHelper.MAX_IDE_CONTROLLER_COUNT) : scsiUnitNumber++, i + 1);
if (vol.getType() == Volume.Type.ROOT)
rootDiskTO = vol;
deviceConfigSpecArray[i].setDevice(device);
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.ADD);
if(s_logger.isDebugEnabled())
s_logger.debug("Prepare volume at new device " + _gson.toJson(device));
i++;
} else {
if (controllerKey == scsiControllerKey && VmwareHelper.isReservedScsiDeviceNumber(scsiUnitNumber))
scsiUnitNumber++;
if (controllerKey == vmMo.getIDEControllerKey(ideUnitNumber))
ideUnitNumber++;
else
scsiUnitNumber++;
}
}
//
// Setup USB devices
//
if (guestOsId.startsWith("darwin")) { //Mac OS
VirtualDevice[] devices = vmMo.getMatchedDevices(new Class<?>[] {VirtualUSBController.class});
if (devices.length == 0) {
s_logger.debug("No USB Controller device on VM Start. Add USB Controller device for Mac OS VM " + vmInternalCSName);
//For Mac OS X systems, the EHCI+UHCI controller is enabled by default and is required for USB mouse and keyboard access.
VirtualDevice usbControllerDevice = VmwareHelper.prepareUSBControllerDevice();
deviceConfigSpecArray[i] = new VirtualDeviceConfigSpec();
deviceConfigSpecArray[i].setDevice(usbControllerDevice);
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.ADD);
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare USB controller at new device " + _gson.toJson(deviceConfigSpecArray[i]));
i++;
} else {
s_logger.debug("USB Controller device exists on VM Start for Mac OS VM " + vmInternalCSName);
}
}
//
// Setup NIC devices
//
VirtualDevice nic;
int nicMask = 0;
int nicCount = 0;
VirtualEthernetCardType nicDeviceType = VirtualEthernetCardType.valueOf(vmSpec.getDetails().get(VmDetailConstants.NIC_ADAPTER));
if (s_logger.isDebugEnabled())
s_logger.debug("VM " + vmInternalCSName + " will be started with NIC device type: " + nicDeviceType);
NiciraNvpApiVersion.logNiciraApiVersion();
Map<String, String> nicUuidToDvSwitchUuid = new HashMap<String, String>();
for (NicTO nicTo : sortNicsByDeviceId(nics)) {
s_logger.info("Prepare NIC device based on NicTO: " + _gson.toJson(nicTo));
boolean configureVServiceInNexus = (nicTo.getType() == TrafficType.Guest) && (vmSpec.getDetails().containsKey("ConfigureVServiceInNexus"));
VirtualMachine.Type vmType = cmd.getVirtualMachine().getType();
Pair<ManagedObjectReference, String> networkInfo = prepareNetworkFromNicInfo(vmMo.getRunningHost(), nicTo, configureVServiceInNexus, vmType);
if ((nicTo.getBroadcastType() != BroadcastDomainType.Lswitch) ||
(nicTo.getBroadcastType() == BroadcastDomainType.Lswitch && NiciraNvpApiVersion.isApiVersionLowerThan("4.2"))){
if (VmwareHelper.isDvPortGroup(networkInfo.first())) {
String dvSwitchUuid;
ManagedObjectReference dcMor = hyperHost.getHyperHostDatacenter();
DatacenterMO dataCenterMo = new DatacenterMO(context, dcMor);
ManagedObjectReference dvsMor = dataCenterMo.getDvSwitchMor(networkInfo.first());
dvSwitchUuid = dataCenterMo.getDvSwitchUuid(dvsMor);
s_logger.info("Preparing NIC device on dvSwitch : " + dvSwitchUuid);
nic =
VmwareHelper.prepareDvNicDevice(vmMo, networkInfo.first(), nicDeviceType, networkInfo.second(), dvSwitchUuid, nicTo.getMac(), nicUnitNumber++,
i + 1, true, true);
if (nicTo.getUuid() != null) {
nicUuidToDvSwitchUuid.put(nicTo.getUuid(), dvSwitchUuid);
}
} else {
s_logger.info("Preparing NIC device on network " + networkInfo.second());
nic =
VmwareHelper.prepareNicDevice(vmMo, networkInfo.first(), nicDeviceType, networkInfo.second(), nicTo.getMac(), nicUnitNumber++, i + 1, true, true);
}
}
else{
//if NSX API VERSION >= 4.2, connect to br-int (nsx.network), do not create portgroup else previous behaviour
nic = VmwareHelper.prepareNicOpaque(vmMo, nicDeviceType, networkInfo.second(), nicTo.getMac(), nicUnitNumber++, i + 1, true, true);
}
deviceConfigSpecArray[i] = new VirtualDeviceConfigSpec();
deviceConfigSpecArray[i].setDevice(nic);
deviceConfigSpecArray[i].setOperation(VirtualDeviceConfigSpecOperation.ADD);
if (s_logger.isDebugEnabled())
s_logger.debug("Prepare NIC at new device " + _gson.toJson(deviceConfigSpecArray[i]));
// this is really a hacking for DomR, upon DomR startup, we will reset all the NIC allocation after eth3
if (nicCount < 3)
nicMask |= (1 << nicCount);
i++;
nicCount++;
}
for (int j = 0; j < i; j++)
vmConfigSpec.getDeviceChange().add(deviceConfigSpecArray[j]);
//
// Setup VM options
//
// pass boot arguments through machine.id & perform customized options to VMX
ArrayList<OptionValue> extraOptions = new ArrayList<OptionValue>();
configBasicExtraOption(extraOptions, vmSpec);
configNvpExtraOption(extraOptions, vmSpec, nicUuidToDvSwitchUuid);
configCustomExtraOption(extraOptions, vmSpec);
// config VNC
String keyboardLayout = null;
if (vmSpec.getDetails() != null)
keyboardLayout = vmSpec.getDetails().get(VmDetailConstants.KEYBOARD);
vmConfigSpec.getExtraConfig().addAll(
Arrays.asList(configureVnc(extraOptions.toArray(new OptionValue[0]), hyperHost, vmInternalCSName, vmSpec.getVncPassword(), keyboardLayout)));
// config video card
configureVideoCard(vmMo, vmSpec, vmConfigSpec);
//
// Configure VM
//
if (!vmMo.configureVm(vmConfigSpec)) {
throw new Exception("Failed to configure VM before start. vmName: " + vmInternalCSName);
}
if (vmSpec.getType() == VirtualMachine.Type.DomainRouter) {
hyperHost.setRestartPriorityForVM(vmMo, DasVmPriority.HIGH.value());
}
//For resizing root disk.
if (rootDiskTO != null && !hasSnapshot) {
resizeRootDisk(vmMo, rootDiskTO, hyperHost, context);
}
//
// Post Configuration
//
vmMo.setCustomFieldValue(CustomFieldConstants.CLOUD_NIC_MASK, String.valueOf(nicMask));
postNvpConfigBeforeStart(vmMo, vmSpec);
Map<String, String> iqnToPath = new HashMap<String, String>();
postDiskConfigBeforeStart(vmMo, vmSpec, sortedDisks, ideControllerKey, scsiControllerKey, iqnToPath, hyperHost, context);
//
// Power-on VM
//
if (!vmMo.powerOn()) {
throw new Exception("Failed to start VM. vmName: " + vmInternalCSName + " with hostname " + vmNameOnVcenter);
}
StartAnswer startAnswer = new StartAnswer(cmd);
startAnswer.setIqnToPath(iqnToPath);
// Since VM was successfully powered-on, if there was an existing VM in a different cluster that was unregistered, delete all the files associated with it.
if (existingVmName != null && existingVmFileLayout != null) {
deleteUnregisteredVmFiles(existingVmFileLayout, dcMo, true);
}
return startAnswer;
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "StartCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.warn(msg, e);
StartAnswer startAnswer = new StartAnswer(cmd, msg);
if(vmAlreadyExistsInVcenter) {
startAnswer.setContextParam("stopRetry", "true");
}
// Since VM start failed, if there was an existing VM in a different cluster that was unregistered, register it back.
if (existingVmName != null && existingVmFileInfo != null) {
s_logger.debug("Since VM start failed, registering back an existing VM: " + existingVmName + " that was unregistered");
try {
DatastoreFile fileInDatastore = new DatastoreFile(existingVmFileInfo.getVmPathName());
DatastoreMO existingVmDsMo = new DatastoreMO(dcMo.getContext(), dcMo.findDatastore(fileInDatastore.getDatastoreName()));
registerVm(existingVmName, existingVmDsMo);
} catch (Exception ex){
String message = "Failed to register an existing VM: " + existingVmName + " due to " + VmwareHelper.getExceptionMessage(ex);
s_logger.warn(message, ex);
}
}
return startAnswer;
} finally {
}
}
private void resizeRootDisk(VirtualMachineMO vmMo, DiskTO rootDiskTO, VmwareHypervisorHost hyperHost, VmwareContext context) throws Exception
{
Pair<VirtualDisk, String> vdisk = getVirtualDiskInfo(vmMo, rootDiskTO.getPath() + ".vmdk");
assert(vdisk != null);
Long reqSize=((VolumeObjectTO)rootDiskTO.getData()).getSize()/1024;
VirtualDisk disk = vdisk.first();
if (reqSize > disk.getCapacityInKB())
{
VirtualMachineDiskInfo diskInfo = getMatchingExistingDisk(vmMo.getDiskInfoBuilder(), rootDiskTO, hyperHost, context);
assert (diskInfo != null);
String[] diskChain = diskInfo.getDiskChain();
if (diskChain != null && diskChain.length>1)
{
s_logger.error("Unsupported Disk chain length "+ diskChain.length);
throw new Exception("Unsupported Disk chain length "+ diskChain.length);
}
if (diskInfo.getDiskDeviceBusName() == null || !diskInfo.getDiskDeviceBusName().toLowerCase().startsWith("scsi"))
{
s_logger.error("Unsupported root disk device bus "+ diskInfo.getDiskDeviceBusName() );
throw new Exception("Unsupported root disk device bus "+ diskInfo.getDiskDeviceBusName());
}
disk.setCapacityInKB(reqSize);
VirtualMachineConfigSpec vmConfigSpec = new VirtualMachineConfigSpec();
VirtualDeviceConfigSpec deviceConfigSpec = new VirtualDeviceConfigSpec();
deviceConfigSpec.setDevice(disk);
deviceConfigSpec.setOperation(VirtualDeviceConfigSpecOperation.EDIT);
vmConfigSpec.getDeviceChange().add(deviceConfigSpec);
if (!vmMo.configureVm(vmConfigSpec)) {
throw new Exception("Failed to configure VM for given root disk size. vmName: " + vmMo.getName());
}
}
}
/**
* Sets video card memory to the one provided in detail svga.vramSize (if provided) on {@code vmConfigSpec}.
* 64MB was always set before.
* Size must be in KB.
* @param vmMo virtual machine mo
* @param vmSpec virtual machine specs
* @param vmConfigSpec virtual machine config spec
* @throws Exception exception
*/
protected void configureVideoCard(VirtualMachineMO vmMo, VirtualMachineTO vmSpec, VirtualMachineConfigSpec vmConfigSpec) throws Exception {
if (vmSpec.getDetails().containsKey(VmDetailConstants.SVGA_VRAM_SIZE)){
String value = vmSpec.getDetails().get(VmDetailConstants.SVGA_VRAM_SIZE);
try {
long svgaVmramSize = Long.parseLong(value);
setNewVRamSizeVmVideoCard(vmMo, svgaVmramSize, vmConfigSpec);
}
catch (NumberFormatException e){
s_logger.error("Unexpected value, cannot parse " + value + " to long due to: " + e.getMessage());
}
}
}
/**
* Search for vm video card iterating through vm device list
* @param vmMo virtual machine mo
* @param svgaVmramSize new svga vram size (in KB)
* @param vmConfigSpec virtual machine config spec
*/
protected void setNewVRamSizeVmVideoCard(VirtualMachineMO vmMo, long svgaVmramSize, VirtualMachineConfigSpec vmConfigSpec) throws Exception {
for (VirtualDevice device : vmMo.getAllDeviceList()){
if (device instanceof VirtualMachineVideoCard){
VirtualMachineVideoCard videoCard = (VirtualMachineVideoCard) device;
modifyVmVideoCardVRamSize(videoCard, vmMo, svgaVmramSize, vmConfigSpec);
}
}
}
/**
* Modifies vm vram size if it was set to a different size to the one provided in svga.vramSize (user_vm_details or template_vm_details) on {@code vmConfigSpec}
* @param videoCard vm's video card device
* @param vmMo virtual machine mo
* @param svgaVmramSize new svga vram size (in KB)
* @param vmConfigSpec virtual machine config spec
*/
protected void modifyVmVideoCardVRamSize(VirtualMachineVideoCard videoCard, VirtualMachineMO vmMo, long svgaVmramSize, VirtualMachineConfigSpec vmConfigSpec) {
if (videoCard.getVideoRamSizeInKB().longValue() != svgaVmramSize){
s_logger.info("Video card memory was set " + videoCard.getVideoRamSizeInKB().longValue() + "kb instead of " + svgaVmramSize + "kb");
configureSpecVideoCardNewVRamSize(videoCard, svgaVmramSize, vmConfigSpec);
}
}
/**
* Add edit spec on {@code vmConfigSpec} to modify svga vram size
* @param videoCard video card device to edit providing the svga vram size
* @param svgaVmramSize new svga vram size (in KB)
* @param vmConfigSpec virtual machine spec
*/
protected void configureSpecVideoCardNewVRamSize(VirtualMachineVideoCard videoCard, long svgaVmramSize, VirtualMachineConfigSpec vmConfigSpec){
videoCard.setVideoRamSizeInKB(svgaVmramSize);
videoCard.setUseAutoDetect(false);
VirtualDeviceConfigSpec arrayVideoCardConfigSpecs = new VirtualDeviceConfigSpec();
arrayVideoCardConfigSpecs.setDevice(videoCard);
arrayVideoCardConfigSpecs.setOperation(VirtualDeviceConfigSpecOperation.EDIT);
vmConfigSpec.getDeviceChange().add(arrayVideoCardConfigSpecs);
}
private void tearDownVm(VirtualMachineMO vmMo) throws Exception{
if(vmMo == null) return;
boolean hasSnapshot = false;
hasSnapshot = vmMo.hasSnapshot();
if (!hasSnapshot)
vmMo.tearDownDevices(new Class<?>[] {VirtualDisk.class, VirtualEthernetCard.class});
else
vmMo.tearDownDevices(new Class<?>[] {VirtualEthernetCard.class});
vmMo.ensureScsiDeviceController();
}
int getReservedMemoryMb(VirtualMachineTO vmSpec) {
if (vmSpec.getDetails().get(VMwareGuru.VmwareReserveMemory.key()).equalsIgnoreCase("true")) {
return (int) (vmSpec.getMinRam() / (1024 * 1024));
}
return 0;
}
int getReservedCpuMHZ(VirtualMachineTO vmSpec) {
if (vmSpec.getDetails().get(VMwareGuru.VmwareReserveCpu.key()).equalsIgnoreCase("true")) {
return vmSpec.getMinSpeed() * vmSpec.getCpus();
}
return 0;
}
// return the finalized disk chain for startup, from top to bottom
private String[] syncDiskChain(DatacenterMO dcMo, VirtualMachineMO vmMo, VirtualMachineTO vmSpec, DiskTO vol, VirtualMachineDiskInfo diskInfo,
HashMap<String, Pair<ManagedObjectReference, DatastoreMO>> dataStoresDetails) throws Exception {
VolumeObjectTO volumeTO = (VolumeObjectTO)vol.getData();
DataStoreTO primaryStore = volumeTO.getDataStore();
Map<String, String> details = vol.getDetails();
boolean isManaged = false;
String iScsiName = null;
if (details != null) {
isManaged = Boolean.parseBoolean(details.get(DiskTO.MANAGED));
iScsiName = details.get(DiskTO.IQN);
}
// if the storage is managed, iScsiName should not be null
String datastoreName = isManaged ? VmwareResource.getDatastoreName(iScsiName) : primaryStore.getUuid();
Pair<ManagedObjectReference, DatastoreMO> volumeDsDetails = dataStoresDetails.get(datastoreName);
if (volumeDsDetails == null)
{
throw new Exception("Primary datastore " + primaryStore.getUuid() + " is not mounted on host.");
}
DatastoreMO dsMo = volumeDsDetails.second();
// we will honor vCenter's meta if it exists
if (diskInfo != null) {
// to deal with run-time upgrade to maintain the new datastore folder structure
String disks[] = diskInfo.getDiskChain();
for (int i = 0; i < disks.length; i++) {
DatastoreFile file = new DatastoreFile(disks[i]);
if (!isManaged && file.getDir() != null && file.getDir().isEmpty()) {
s_logger.info("Perform run-time datastore folder upgrade. sync " + disks[i] + " to VM folder");
disks[i] = VmwareStorageLayoutHelper.syncVolumeToVmDefaultFolder(dcMo, vmMo.getName(), dsMo, file.getFileBaseName());
}
}
return disks;
}
final String datastoreDiskPath;
if (isManaged) {
if (volumeTO.getVolumeType() == Volume.Type.ROOT) {
datastoreDiskPath = VmwareStorageLayoutHelper.syncVolumeToVmDefaultFolder(dcMo, vmMo.getName(), dsMo, volumeTO.getName());
}
else {
datastoreDiskPath = dsMo.getDatastorePath(dsMo.getName() + ".vmdk");
}
} else {
datastoreDiskPath = VmwareStorageLayoutHelper.syncVolumeToVmDefaultFolder(dcMo, vmMo.getName(), dsMo, volumeTO.getPath());
}
if (!dsMo.fileExists(datastoreDiskPath)) {
s_logger.warn("Volume " + volumeTO.getId() + " does not seem to exist on datastore, out of sync? path: " + datastoreDiskPath);
}
return new String[] {datastoreDiskPath};
}
// Pair<internal CS name, vCenter display name>
private Pair<String, String> composeVmNames(VirtualMachineTO vmSpec) {
String vmInternalCSName = vmSpec.getName();
String vmNameOnVcenter = vmSpec.getName();
if (_instanceNameFlag && vmSpec.getHostName() != null) {
vmNameOnVcenter = vmSpec.getHostName();
}
return new Pair<String, String>(vmInternalCSName, vmNameOnVcenter);
}
protected void configNestedHVSupport(VirtualMachineMO vmMo, VirtualMachineTO vmSpec, VirtualMachineConfigSpec vmConfigSpec) throws Exception {
VmwareContext context = vmMo.getContext();
if ("true".equals(vmSpec.getDetails().get(VmDetailConstants.NESTED_VIRTUALIZATION_FLAG))) {
if (s_logger.isDebugEnabled())
s_logger.debug("Nested Virtualization enabled in configuration, checking hypervisor capability");
ManagedObjectReference hostMor = vmMo.getRunningHost().getMor();
ManagedObjectReference computeMor = context.getVimClient().getMoRefProp(hostMor, "parent");
ManagedObjectReference environmentBrowser = context.getVimClient().getMoRefProp(computeMor, "environmentBrowser");
HostCapability hostCapability = context.getService().queryTargetCapabilities(environmentBrowser, hostMor);
Boolean nestedHvSupported = hostCapability.isNestedHVSupported();
if (nestedHvSupported == null) {
// nestedHvEnabled property is supported only since VMware 5.1. It's not defined for earlier versions.
s_logger.warn("Hypervisor doesn't support nested virtualization, unable to set config for VM " + vmSpec.getName());
} else if (nestedHvSupported.booleanValue()) {
s_logger.debug("Hypervisor supports nested virtualization, enabling for VM " + vmSpec.getName());
vmConfigSpec.setNestedHVEnabled(true);
} else {
s_logger.warn("Hypervisor doesn't support nested virtualization, unable to set config for VM " + vmSpec.getName());
vmConfigSpec.setNestedHVEnabled(false);
}
}
}
private static void configBasicExtraOption(List<OptionValue> extraOptions, VirtualMachineTO vmSpec) {
OptionValue newVal = new OptionValue();
newVal.setKey("machine.id");
newVal.setValue(vmSpec.getBootArgs());
extraOptions.add(newVal);
newVal = new OptionValue();
newVal.setKey("devices.hotplug");
newVal.setValue("true");
extraOptions.add(newVal);
}
private static void configNvpExtraOption(List<OptionValue> extraOptions, VirtualMachineTO vmSpec, Map<String, String> nicUuidToDvSwitchUuid) {
/**
* Extra Config : nvp.vm-uuid = uuid
* - Required for Nicira NVP integration
*/
OptionValue newVal = new OptionValue();
newVal.setKey("nvp.vm-uuid");
newVal.setValue(vmSpec.getUuid());
extraOptions.add(newVal);
/**
* Extra Config : nvp.iface-id.<num> = uuid
* - Required for Nicira NVP integration
*/
int nicNum = 0;
for (NicTO nicTo : sortNicsByDeviceId(vmSpec.getNics())) {
if (nicTo.getUuid() != null) {
newVal = new OptionValue();
newVal.setKey("nvp.iface-id." + nicNum);
newVal.setValue(nicTo.getUuid());
extraOptions.add(newVal);
setNuageVspVrIpInExtraConfig(extraOptions, nicTo, nicUuidToDvSwitchUuid.get(nicTo.getUuid()));
}
nicNum++;
}
}
private static void setNuageVspVrIpInExtraConfig(List<OptionValue> extraOptions, NicTO nicTo, String dvSwitchUuid) {
if (nicTo.getBroadcastType() != BroadcastDomainType.Vsp) {
return;
}
OptionValue newVal;
if (nicTo.getType().equals(TrafficType.Guest) && dvSwitchUuid != null && nicTo.getGateway() != null && nicTo.getNetmask() != null) {
String vrIp = nicTo.getBroadcastUri().getPath().substring(1);
newVal = new OptionValue();
newVal.setKey("vsp.vr-ip." + nicTo.getMac());
newVal.setValue(vrIp);
extraOptions.add(newVal);
newVal = new OptionValue();
newVal.setKey("vsp.dvswitch." + nicTo.getMac());
newVal.setValue(dvSwitchUuid);
extraOptions.add(newVal);
if (s_logger.isDebugEnabled()) {
s_logger.debug("NIC with MAC " + nicTo.getMac() + " and BroadcastDomainType " + nicTo.getBroadcastType() + " in network(" + nicTo.getGateway() + "/"
+ nicTo.getNetmask() + ") is " + nicTo.getType() + " traffic type. So, vsp-vr-ip is set in the extraconfig");
}
}
}
private static void configCustomExtraOption(List<OptionValue> extraOptions, VirtualMachineTO vmSpec) {
// we no longer to validation anymore
for (Map.Entry<String, String> entry : vmSpec.getDetails().entrySet()) {
OptionValue newVal = new OptionValue();
newVal.setKey(entry.getKey());
newVal.setValue(entry.getValue());
extraOptions.add(newVal);
}
}
private static void postNvpConfigBeforeStart(VirtualMachineMO vmMo, VirtualMachineTO vmSpec) throws Exception {
/**
* We need to configure the port on the DV switch after the host is
* connected. So make this happen between the configure and start of
* the VM
*/
int nicIndex = 0;
for (NicTO nicTo : sortNicsByDeviceId(vmSpec.getNics())) {
if (nicTo.getBroadcastType() == BroadcastDomainType.Lswitch) {
// We need to create a port with a unique vlan and pass the key to the nic device
s_logger.trace("Nic " + nicTo.toString() + " is connected to an NVP logicalswitch");
VirtualDevice nicVirtualDevice = vmMo.getNicDeviceByIndex(nicIndex);
if (nicVirtualDevice == null) {
throw new Exception("Failed to find a VirtualDevice for nic " + nicIndex); //FIXME Generic exceptions are bad
}
VirtualDeviceBackingInfo backing = nicVirtualDevice.getBacking();
if (backing instanceof VirtualEthernetCardDistributedVirtualPortBackingInfo) {
// This NIC is connected to a Distributed Virtual Switch
VirtualEthernetCardDistributedVirtualPortBackingInfo portInfo = (VirtualEthernetCardDistributedVirtualPortBackingInfo)backing;
DistributedVirtualSwitchPortConnection port = portInfo.getPort();
String portKey = port.getPortKey();
String portGroupKey = port.getPortgroupKey();
String dvSwitchUuid = port.getSwitchUuid();
s_logger.debug("NIC " + nicTo.toString() + " is connected to dvSwitch " + dvSwitchUuid + " pg " + portGroupKey + " port " + portKey);
ManagedObjectReference dvSwitchManager = vmMo.getContext().getVimClient().getServiceContent().getDvSwitchManager();
ManagedObjectReference dvSwitch = vmMo.getContext().getVimClient().getService().queryDvsByUuid(dvSwitchManager, dvSwitchUuid);
// Get all ports
DistributedVirtualSwitchPortCriteria criteria = new DistributedVirtualSwitchPortCriteria();
criteria.setInside(true);
criteria.getPortgroupKey().add(portGroupKey);
List<DistributedVirtualPort> dvPorts = vmMo.getContext().getVimClient().getService().fetchDVPorts(dvSwitch, criteria);
DistributedVirtualPort vmDvPort = null;
List<Integer> usedVlans = new ArrayList<Integer>();
for (DistributedVirtualPort dvPort : dvPorts) {
// Find the port for this NIC by portkey
if (portKey.equals(dvPort.getKey())) {
vmDvPort = dvPort;
}
VMwareDVSPortSetting settings = (VMwareDVSPortSetting)dvPort.getConfig().getSetting();
VmwareDistributedVirtualSwitchVlanIdSpec vlanId = (VmwareDistributedVirtualSwitchVlanIdSpec)settings.getVlan();
s_logger.trace("Found port " + dvPort.getKey() + " with vlan " + vlanId.getVlanId());
if (vlanId.getVlanId() > 0 && vlanId.getVlanId() < 4095) {
usedVlans.add(vlanId.getVlanId());
}
}
if (vmDvPort == null) {
throw new Exception("Empty port list from dvSwitch for nic " + nicTo.toString());
}
DVPortConfigInfo dvPortConfigInfo = vmDvPort.getConfig();
VMwareDVSPortSetting settings = (VMwareDVSPortSetting)dvPortConfigInfo.getSetting();
VmwareDistributedVirtualSwitchVlanIdSpec vlanId = (VmwareDistributedVirtualSwitchVlanIdSpec)settings.getVlan();
BoolPolicy blocked = settings.getBlocked();
if (blocked.isValue() == Boolean.TRUE) {
s_logger.trace("Port is blocked, set a vlanid and unblock");
DVPortConfigSpec dvPortConfigSpec = new DVPortConfigSpec();
VMwareDVSPortSetting edittedSettings = new VMwareDVSPortSetting();
// Unblock
blocked.setValue(Boolean.FALSE);
blocked.setInherited(Boolean.FALSE);
edittedSettings.setBlocked(blocked);
// Set vlan
int i;
for (i = 1; i < 4095; i++) {
if (!usedVlans.contains(i))
break;
}
vlanId.setVlanId(i); // FIXME should be a determined
// based on usage
vlanId.setInherited(false);
edittedSettings.setVlan(vlanId);
dvPortConfigSpec.setSetting(edittedSettings);
dvPortConfigSpec.setOperation("edit");
dvPortConfigSpec.setKey(portKey);
List<DVPortConfigSpec> dvPortConfigSpecs = new ArrayList<DVPortConfigSpec>();
dvPortConfigSpecs.add(dvPortConfigSpec);
ManagedObjectReference task = vmMo.getContext().getVimClient().getService().reconfigureDVPortTask(dvSwitch, dvPortConfigSpecs);
if (!vmMo.getContext().getVimClient().waitForTask(task)) {
throw new Exception("Failed to configure the dvSwitch port for nic " + nicTo.toString());
}
s_logger.debug("NIC " + nicTo.toString() + " connected to vlan " + i);
} else {
s_logger.trace("Port already configured and set to vlan " + vlanId.getVlanId());
}
} else if (backing instanceof VirtualEthernetCardNetworkBackingInfo) {
// This NIC is connected to a Virtual Switch
// Nothing to do
} else if (backing instanceof VirtualEthernetCardOpaqueNetworkBackingInfo) {
//if NSX API VERSION >= 4.2, connect to br-int (nsx.network), do not create portgroup else previous behaviour
//OK, connected to OpaqueNetwork
} else {
s_logger.error("nic device backing is of type " + backing.getClass().getName());
throw new Exception("Incompatible backing for a VirtualDevice for nic " + nicIndex); //FIXME Generic exceptions are bad
}
}
nicIndex++;
}
}
private VirtualMachineDiskInfo getMatchingExistingDisk(VirtualMachineDiskInfoBuilder diskInfoBuilder, DiskTO vol,
VmwareHypervisorHost hyperHost, VmwareContext context) throws Exception {
if (diskInfoBuilder != null) {
VolumeObjectTO volume = (VolumeObjectTO)vol.getData();
String dsName = null;
String diskBackingFileBaseName= null;
Map<String, String> details = vol.getDetails();
boolean isManaged = details != null && Boolean.parseBoolean(details.get(DiskTO.MANAGED));
if (isManaged) {
String iScsiName = details.get(DiskTO.IQN);
// if the storage is managed, iScsiName should not be null
dsName = VmwareResource.getDatastoreName(iScsiName);
diskBackingFileBaseName = new DatastoreFile(volume.getPath()).getFileBaseName();
}
else {
ManagedObjectReference morDs = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(hyperHost, volume.getDataStore().getUuid());
DatastoreMO dsMo = new DatastoreMO(context, morDs);
dsName = dsMo.getName();
diskBackingFileBaseName = volume.getPath();
}
VirtualMachineDiskInfo diskInfo =
diskInfoBuilder.getDiskInfoByBackingFileBaseName(diskBackingFileBaseName, dsName);
if (diskInfo != null) {
s_logger.info("Found existing disk info from volume path: " + volume.getPath());
return diskInfo;
} else {
String chainInfo = volume.getChainInfo();
if (chainInfo != null) {
VirtualMachineDiskInfo infoInChain = _gson.fromJson(chainInfo, VirtualMachineDiskInfo.class);
if (infoInChain != null) {
String[] disks = infoInChain.getDiskChain();
if (disks.length > 0) {
for (String diskPath : disks) {
DatastoreFile file = new DatastoreFile(diskPath);
diskInfo = diskInfoBuilder.getDiskInfoByBackingFileBaseName(file.getFileBaseName(), dsName);
if (diskInfo != null) {
s_logger.info("Found existing disk from chain info: " + diskPath);
return diskInfo;
}
}
}
if (diskInfo == null) {
diskInfo = diskInfoBuilder.getDiskInfoByDeviceBusName(infoInChain.getDiskDeviceBusName());
if (diskInfo != null) {
s_logger.info("Found existing disk from from chain device bus information: " + infoInChain.getDiskDeviceBusName());
return diskInfo;
}
}
}
}
}
}
return null;
}
private int getDiskController(VirtualMachineDiskInfo matchingExistingDisk, DiskTO vol, VirtualMachineTO vmSpec, int ideControllerKey, int scsiControllerKey) {
int controllerKey;
if (matchingExistingDisk != null) {
s_logger.info("Chose disk controller based on existing information: " + matchingExistingDisk.getDiskDeviceBusName());
if (matchingExistingDisk.getDiskDeviceBusName().startsWith("ide"))
return ideControllerKey;
else
return scsiControllerKey;
}
if (vol.getType() == Volume.Type.ROOT) {
Map<String, String> vmDetails = vmSpec.getDetails();
if (vmDetails != null && vmDetails.get(VmDetailConstants.ROOT_DISK_CONTROLLER) != null) {
if (vmDetails.get(VmDetailConstants.ROOT_DISK_CONTROLLER).equalsIgnoreCase("scsi")) {
s_logger.info("Chose disk controller for vol " + vol.getType() + " -> scsi, based on root disk controller settings: " +
vmDetails.get(VmDetailConstants.ROOT_DISK_CONTROLLER));
controllerKey = scsiControllerKey;
} else {
s_logger.info("Chose disk controller for vol " + vol.getType() + " -> ide, based on root disk controller settings: " +
vmDetails.get(VmDetailConstants.ROOT_DISK_CONTROLLER));
controllerKey = ideControllerKey;
}
} else {
s_logger.info("Chose disk controller for vol " + vol.getType() + " -> scsi. due to null root disk controller setting");
controllerKey = scsiControllerKey;
}
} else {
// DATA volume always use SCSI device
s_logger.info("Chose disk controller for vol " + vol.getType() + " -> scsi");
controllerKey = scsiControllerKey;
}
return controllerKey;
}
private String getDiskController(VirtualMachineMO vmMo, VirtualMachineDiskInfo matchingExistingDisk, DiskTO vol, Pair<String, String> controllerInfo) throws Exception {
int controllerKey;
DiskControllerType controllerType = DiskControllerType.none;
if (matchingExistingDisk != null) {
String currentBusName = matchingExistingDisk.getDiskDeviceBusName();
if (currentBusName != null) {
s_logger.info("Chose disk controller based on existing information: " + currentBusName);
if (currentBusName.startsWith("ide")) {
controllerType = DiskControllerType.ide;
} else if (currentBusName.startsWith("scsi")) {
controllerType = DiskControllerType.scsi;
}
}
if (controllerType == DiskControllerType.scsi || controllerType == DiskControllerType.none) {
Ternary<Integer, Integer, DiskControllerType> vmScsiControllerInfo = vmMo.getScsiControllerInfo();
controllerType = vmScsiControllerInfo.third();
}
return controllerType.toString();
}
if (vol.getType() == Volume.Type.ROOT) {
s_logger.info("Chose disk controller for vol " + vol.getType() + " -> " + controllerInfo.first()
+ ", based on root disk controller settings at global configuration setting.");
return controllerInfo.first();
} else {
s_logger.info("Chose disk controller for vol " + vol.getType() + " -> " + controllerInfo.second()
+ ", based on default data disk controller setting i.e. Operating system recommended."); // Need to bring in global configuration setting & template level setting.
return controllerInfo.second();
}
}
private void postDiskConfigBeforeStart(VirtualMachineMO vmMo, VirtualMachineTO vmSpec, DiskTO[] sortedDisks, int ideControllerKey,
int scsiControllerKey, Map<String, String> iqnToPath, VmwareHypervisorHost hyperHost, VmwareContext context) throws Exception {
VirtualMachineDiskInfoBuilder diskInfoBuilder = vmMo.getDiskInfoBuilder();
for (DiskTO vol : sortedDisks) {
if (vol.getType() == Volume.Type.ISO)
continue;
VolumeObjectTO volumeTO = (VolumeObjectTO)vol.getData();
VirtualMachineDiskInfo diskInfo = getMatchingExistingDisk(diskInfoBuilder, vol, hyperHost, context);
assert (diskInfo != null);
String[] diskChain = diskInfo.getDiskChain();
assert (diskChain.length > 0);
Map<String, String> details = vol.getDetails();
boolean managed = false;
if (details != null) {
managed = Boolean.parseBoolean(details.get(DiskTO.MANAGED));
}
DatastoreFile file = new DatastoreFile(diskChain[0]);
if (managed) {
DatastoreFile originalFile = new DatastoreFile(volumeTO.getPath());
if (!file.getFileBaseName().equalsIgnoreCase(originalFile.getFileBaseName())) {
if (s_logger.isInfoEnabled())
s_logger.info("Detected disk-chain top file change on volume: " + volumeTO.getId() + " " + volumeTO.getPath() + " -> " + diskChain[0]);
}
}
else {
if (!file.getFileBaseName().equalsIgnoreCase(volumeTO.getPath())) {
if (s_logger.isInfoEnabled())
s_logger.info("Detected disk-chain top file change on volume: " + volumeTO.getId() + " " + volumeTO.getPath() + " -> " + file.getFileBaseName());
}
}
VolumeObjectTO volInSpec = getVolumeInSpec(vmSpec, volumeTO);
if (volInSpec != null) {
if (managed) {
String datastoreVolumePath = diskChain[0];
iqnToPath.put(details.get(DiskTO.IQN), datastoreVolumePath);
vol.setPath(datastoreVolumePath);
volumeTO.setPath(datastoreVolumePath);
volInSpec.setPath(datastoreVolumePath);
} else {
volInSpec.setPath(file.getFileBaseName());
}
volInSpec.setChainInfo(_gson.toJson(diskInfo));
}
}
}
private void deleteUnregisteredVmFiles(VirtualMachineFileLayoutEx vmFileLayout, DatacenterMO dcMo, boolean deleteDisks) throws Exception {
s_logger.debug("Deleting files associated with an existing VM that was unregistered");
DatastoreFile vmFolder = null;
try {
List<VirtualMachineFileLayoutExFileInfo> fileInfo = vmFileLayout.getFile();
for (VirtualMachineFileLayoutExFileInfo file : fileInfo) {
DatastoreFile fileInDatastore = new DatastoreFile(file.getName());
// In case of linked clones, VM file layout includes the base disk so don't delete all disk files.
if (file.getType().startsWith("disk") || file.getType().startsWith("digest"))
continue;
else if (file.getType().equals("config"))
vmFolder = new DatastoreFile(fileInDatastore.getDatastoreName(), fileInDatastore.getDir());
DatastoreMO dsMo = new DatastoreMO(dcMo.getContext(), dcMo.findDatastore(fileInDatastore.getDatastoreName()));
s_logger.debug("Deleting file: " + file.getName());
dsMo.deleteFile(file.getName(), dcMo.getMor(), true);
}
// Delete files that are present in the VM folder - this will take care of the VM disks as well.
DatastoreMO vmFolderDsMo = new DatastoreMO(dcMo.getContext(), dcMo.findDatastore(vmFolder.getDatastoreName()));
String[] files = vmFolderDsMo.listDirContent(vmFolder.getPath());
if (deleteDisks) {
for (String file : files) {
String vmDiskFileFullPath = String.format("%s/%s", vmFolder.getPath(), file);
s_logger.debug("Deleting file: " + vmDiskFileFullPath);
vmFolderDsMo.deleteFile(vmDiskFileFullPath, dcMo.getMor(), true);
}
}
// Delete VM folder
if (deleteDisks || files.length == 0) {
s_logger.debug("Deleting folder: " + vmFolder.getPath());
vmFolderDsMo.deleteFolder(vmFolder.getPath(), dcMo.getMor());
}
} catch (Exception e) {
String message = "Failed to delete files associated with an existing VM that was unregistered due to " + VmwareHelper.getExceptionMessage(e);
s_logger.warn(message, e);
}
}
private static VolumeObjectTO getVolumeInSpec(VirtualMachineTO vmSpec, VolumeObjectTO srcVol) {
for (DiskTO disk : vmSpec.getDisks()) {
VolumeObjectTO vol = (VolumeObjectTO)disk.getData();
if (vol.getId() == srcVol.getId())
return vol;
}
return null;
}
private static NicTO[] sortNicsByDeviceId(NicTO[] nics) {
List<NicTO> listForSort = new ArrayList<NicTO>();
for (NicTO nic : nics) {
listForSort.add(nic);
}
Collections.sort(listForSort, new Comparator<NicTO>() {
@Override
public int compare(NicTO arg0, NicTO arg1) {
if (arg0.getDeviceId() < arg1.getDeviceId()) {
return -1;
} else if (arg0.getDeviceId() == arg1.getDeviceId()) {
return 0;
}
return 1;
}
});
return listForSort.toArray(new NicTO[0]);
}
private static DiskTO[] sortVolumesByDeviceId(DiskTO[] volumes) {
List<DiskTO> listForSort = new ArrayList<DiskTO>();
for (DiskTO vol : volumes) {
listForSort.add(vol);
}
Collections.sort(listForSort, new Comparator<DiskTO>() {
@Override
public int compare(DiskTO arg0, DiskTO arg1) {
if (arg0.getDiskSeq() < arg1.getDiskSeq()) {
return -1;
} else if (arg0.getDiskSeq().equals(arg1.getDiskSeq())) {
return 0;
}
return 1;
}
});
return listForSort.toArray(new DiskTO[0]);
}
private HashMap<String, Pair<ManagedObjectReference, DatastoreMO>> inferDatastoreDetailsFromDiskInfo(VmwareHypervisorHost hyperHost, VmwareContext context,
DiskTO[] disks, Command cmd) throws Exception {
HashMap<String, Pair<ManagedObjectReference, DatastoreMO>> mapIdToMors = new HashMap<String, Pair<ManagedObjectReference, DatastoreMO>>();
assert (hyperHost != null) && (context != null);
for (DiskTO vol : disks) {
if (vol.getType() != Volume.Type.ISO) {
VolumeObjectTO volumeTO = (VolumeObjectTO)vol.getData();
DataStoreTO primaryStore = volumeTO.getDataStore();
String poolUuid = primaryStore.getUuid();
if (mapIdToMors.get(poolUuid) == null) {
boolean isManaged = false;
Map<String, String> details = vol.getDetails();
if (details != null) {
isManaged = Boolean.parseBoolean(details.get(DiskTO.MANAGED));
}
if (isManaged) {
String iScsiName = details.get(DiskTO.IQN); // details should not be null for managed storage (it may or may not be null for non-managed storage)
String datastoreName = VmwareResource.getDatastoreName(iScsiName);
ManagedObjectReference morDatastore = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(hyperHost, datastoreName);
// if the datastore is not present, we need to discover the iSCSI device that will support it,
// create the datastore, and create a VMDK file in the datastore
if (morDatastore == null) {
morDatastore = _storageProcessor.prepareManagedStorage(context, hyperHost, null, iScsiName,
details.get(DiskTO.STORAGE_HOST), Integer.parseInt(details.get(DiskTO.STORAGE_PORT)),
volumeTO.getVolumeType() == Volume.Type.ROOT ? volumeTO.getName() : null,
details.get(DiskTO.CHAP_INITIATOR_USERNAME), details.get(DiskTO.CHAP_INITIATOR_SECRET),
details.get(DiskTO.CHAP_TARGET_USERNAME), details.get(DiskTO.CHAP_TARGET_SECRET),
Long.parseLong(details.get(DiskTO.VOLUME_SIZE)), cmd);
DatastoreMO dsMo = new DatastoreMO(getServiceContext(), morDatastore);
String datastoreVolumePath = dsMo.getDatastorePath((volumeTO.getVolumeType() == Volume.Type.ROOT ? volumeTO.getName() : dsMo.getName()) + ".vmdk");
volumeTO.setPath(datastoreVolumePath);
vol.setPath(datastoreVolumePath);
}
mapIdToMors.put(datastoreName, new Pair<ManagedObjectReference, DatastoreMO>(morDatastore, new DatastoreMO(context, morDatastore)));
}
else {
ManagedObjectReference morDatastore = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(hyperHost, poolUuid);
if (morDatastore == null) {
String msg = "Failed to get the mounted datastore for the volume's pool " + poolUuid;
s_logger.error(msg);
throw new Exception(msg);
}
mapIdToMors.put(poolUuid, new Pair<ManagedObjectReference, DatastoreMO>(morDatastore, new DatastoreMO(context, morDatastore)));
}
}
}
}
return mapIdToMors;
}
private DatastoreMO getDatastoreThatRootDiskIsOn(HashMap<String, Pair<ManagedObjectReference, DatastoreMO>> dataStoresDetails, DiskTO disks[]) {
Pair<ManagedObjectReference, DatastoreMO> rootDiskDataStoreDetails = null;
for (DiskTO vol : disks) {
if (vol.getType() == Volume.Type.ROOT) {
Map<String, String> details = vol.getDetails();
boolean managed = false;
if (details != null) {
managed = Boolean.parseBoolean(details.get(DiskTO.MANAGED));
}
if (managed) {
String datastoreName = VmwareResource.getDatastoreName(details.get(DiskTO.IQN));
rootDiskDataStoreDetails = dataStoresDetails.get(datastoreName);
break;
}
else {
DataStoreTO primaryStore = vol.getData().getDataStore();
rootDiskDataStoreDetails = dataStoresDetails.get(primaryStore.getUuid());
break;
}
}
}
if (rootDiskDataStoreDetails != null) {
return rootDiskDataStoreDetails.second();
}
return null;
}
private String getPvlanInfo(NicTO nicTo) {
if (nicTo.getBroadcastType() == BroadcastDomainType.Pvlan) {
return NetUtils.getIsolatedPvlanFromUri(nicTo.getBroadcastUri());
}
return null;
}
private String getVlanInfo(NicTO nicTo, String defaultVlan) {
if (nicTo.getBroadcastType() == BroadcastDomainType.Native) {
return defaultVlan;
} else if (nicTo.getBroadcastType() == BroadcastDomainType.Vlan || nicTo.getBroadcastType() == BroadcastDomainType.Pvlan) {
if (nicTo.getBroadcastUri() != null) {
if (nicTo.getBroadcastType() == BroadcastDomainType.Vlan)
// For vlan, the broadcast uri is of the form vlan://<vlanid>
// BroadcastDomainType recogniizes and handles this.
return BroadcastDomainType.getValue(nicTo.getBroadcastUri());
else
// for pvlan, the broacast uri will be of the form pvlan://<vlanid>-i<pvlanid>
// TODO consider the spread of functionality between BroadcastDomainType and NetUtils
return NetUtils.getPrimaryPvlanFromUri(nicTo.getBroadcastUri());
} else {
s_logger.warn("BroadcastType is not claimed as VLAN or PVLAN, but without vlan info in broadcast URI. Use vlan info from labeling: " + defaultVlan);
return defaultVlan;
}
} else if (nicTo.getBroadcastType() == BroadcastDomainType.Lswitch) {
// We don't need to set any VLAN id for an NVP logical switch
return null;
} else if (nicTo.getBroadcastType() == BroadcastDomainType.Storage) {
URI broadcastUri = nicTo.getBroadcastUri();
if (broadcastUri != null) {
String vlanId = BroadcastDomainType.getValue(broadcastUri);
s_logger.debug("Using VLAN [" + vlanId + "] from broadcast uri [" + broadcastUri + "]");
return vlanId;
}
}
s_logger.warn("Unrecognized broadcast type in VmwareResource, type: " + nicTo.getBroadcastType().toString() + ". Use vlan info from labeling: " + defaultVlan);
return defaultVlan;
}
private Pair<ManagedObjectReference, String> prepareNetworkFromNicInfo(HostMO hostMo, NicTO nicTo, boolean configureVServiceInNexus, VirtualMachine.Type vmType) throws Exception {
Ternary<String, String, String> switchDetails = getTargetSwitch(nicTo);
VirtualSwitchType switchType = VirtualSwitchType.getType(switchDetails.second());
String switchName = switchDetails.first();
String vlanToken = switchDetails.third();
String namePrefix = getNetworkNamePrefix(nicTo);
Pair<ManagedObjectReference, String> networkInfo = null;
s_logger.info("Prepare network on " + switchType + " " + switchName + " with name prefix: " + namePrefix);
if (VirtualSwitchType.StandardVirtualSwitch == switchType) {
networkInfo = HypervisorHostHelper.prepareNetwork(switchName, namePrefix, hostMo,
getVlanInfo(nicTo, vlanToken), nicTo.getNetworkRateMbps(), nicTo.getNetworkRateMulticastMbps(),
_opsTimeout, !namePrefix.startsWith("cloud.private"), nicTo.getBroadcastType(), nicTo.getUuid());
}
else {
String vlanId = getVlanInfo(nicTo, vlanToken);
String svlanId = null;
boolean pvlannetwork = (getPvlanInfo(nicTo) == null) ? false : true;
if (vmType != null && vmType.equals(VirtualMachine.Type.DomainRouter) && pvlannetwork) {
// plumb this network to the promiscuous vlan.
svlanId = vlanId;
} else {
// plumb this network to the isolated vlan.
svlanId = getPvlanInfo(nicTo);
}
networkInfo = HypervisorHostHelper.prepareNetwork(switchName, namePrefix, hostMo, vlanId, svlanId,
nicTo.getNetworkRateMbps(), nicTo.getNetworkRateMulticastMbps(), _opsTimeout, switchType,
_portsPerDvPortGroup, nicTo.getGateway(), configureVServiceInNexus, nicTo.getBroadcastType(), _vsmCredentials);
}
return networkInfo;
}
// return Ternary <switch name, switch tyep, vlan tagging>
private Ternary<String, String, String> getTargetSwitch(NicTO nicTo) throws CloudException {
TrafficType[] supportedTrafficTypes =
new TrafficType[] {
TrafficType.Guest,
TrafficType.Public,
TrafficType.Control,
TrafficType.Management,
TrafficType.Storage
};
TrafficType trafficType = nicTo.getType();
if (!Arrays.asList(supportedTrafficTypes).contains(trafficType)) {
throw new CloudException("Traffic type " + trafficType.toString() + " for nic " + nicTo.toString() + " is not supported.");
}
String switchName = null;
VirtualSwitchType switchType = VirtualSwitchType.StandardVirtualSwitch;
String vlanId = Vlan.UNTAGGED;
if(nicTo.getName() != null && !nicTo.getName().isEmpty()) {
// Format of network traffic label is <VSWITCH>,<VLANID>,<VSWITCHTYPE>
// If all 3 fields are mentioned then number of tokens would be 3.
// If only <VSWITCH>,<VLANID> are mentioned then number of tokens would be 2.
// Get switch details from the nicTO object
String networkName = nicTo.getName();
VmwareTrafficLabel mgmtTrafficLabelObj = new VmwareTrafficLabel(networkName, trafficType);
switchName = mgmtTrafficLabelObj.getVirtualSwitchName();
vlanId = mgmtTrafficLabelObj.getVlanId();
switchType = mgmtTrafficLabelObj.getVirtualSwitchType();
} else {
if (trafficType == TrafficType.Guest && _guestTrafficInfo != null) {
switchType = _guestTrafficInfo.getVirtualSwitchType();
switchName = _guestTrafficInfo.getVirtualSwitchName();
} else if (trafficType == TrafficType.Public && _publicTrafficInfo != null) {
switchType = _publicTrafficInfo.getVirtualSwitchType();
switchName = _publicTrafficInfo.getVirtualSwitchName();
}
}
if (switchName == null
&& (nicTo.getType() == Networks.TrafficType.Control || nicTo.getType() == Networks.TrafficType.Management || nicTo.getType() == Networks.TrafficType.Storage)) {
switchName = _privateNetworkVSwitchName;
}
if (switchType == VirtualSwitchType.NexusDistributedVirtualSwitch) {
if (trafficType == TrafficType.Management || trafficType == TrafficType.Storage) {
throw new CloudException("Unable to configure NIC " + nicTo.toString() + " as traffic type " + trafficType.toString() +
" is not supported over virtual switch type " + switchType +
". Please specify only supported type of virtual switches i.e. {vmwaresvs, vmwaredvs} in physical network traffic label.");
}
}
return new Ternary<String, String, String>(switchName, switchType.toString(), vlanId);
}
private String getNetworkNamePrefix(NicTO nicTo) throws Exception {
if (nicTo.getType() == Networks.TrafficType.Guest) {
return "cloud.guest";
} else if (nicTo.getType() == Networks.TrafficType.Control || nicTo.getType() == Networks.TrafficType.Management) {
return "cloud.private";
} else if (nicTo.getType() == Networks.TrafficType.Public) {
return "cloud.public";
} else if (nicTo.getType() == Networks.TrafficType.Storage) {
return "cloud.storage";
} else if (nicTo.getType() == Networks.TrafficType.Vpn) {
throw new Exception("Unsupported traffic type: " + nicTo.getType().toString());
} else {
throw new Exception("Unsupported traffic type: " + nicTo.getType().toString());
}
}
private VirtualMachineMO takeVmFromOtherHyperHost(VmwareHypervisorHost hyperHost, String vmName) throws Exception {
VirtualMachineMO vmMo = hyperHost.findVmOnPeerHyperHost(vmName);
if (vmMo != null) {
ManagedObjectReference morTargetPhysicalHost = hyperHost.findMigrationTarget(vmMo);
if (morTargetPhysicalHost == null) {
String msg = "VM " + vmName + " is on other host and we have no resource available to migrate and start it here";
s_logger.error(msg);
throw new Exception(msg);
}
if (!vmMo.relocate(morTargetPhysicalHost)) {
String msg = "VM " + vmName + " is on other host and we failed to relocate it here";
s_logger.error(msg);
throw new Exception(msg);
}
return vmMo;
}
return null;
}
// isoUrl sample content :
// nfs://192.168.10.231/export/home/kelven/vmware-test/secondary/template/tmpl/2/200//200-2-80f7ee58-6eff-3a2d-bcb0-59663edf6d26.iso
private Pair<String, ManagedObjectReference> getIsoDatastoreInfo(VmwareHypervisorHost hyperHost, String isoUrl) throws Exception {
assert (isoUrl != null);
int isoFileNameStartPos = isoUrl.lastIndexOf("/");
if (isoFileNameStartPos < 0) {
throw new Exception("Invalid ISO path info");
}
String isoFileName = isoUrl.substring(isoFileNameStartPos);
int templateRootPos = isoUrl.indexOf("template/tmpl");
if (templateRootPos < 0) {
throw new Exception("Invalid ISO path info");
}
String storeUrl = isoUrl.substring(0, templateRootPos - 1);
String isoPath = isoUrl.substring(templateRootPos, isoFileNameStartPos);
ManagedObjectReference morDs = prepareSecondaryDatastoreOnHost(storeUrl);
DatastoreMO dsMo = new DatastoreMO(getServiceContext(), morDs);
return new Pair<String, ManagedObjectReference>(String.format("[%s] %s%s", dsMo.getName(), isoPath, isoFileName), morDs);
}
protected Answer execute(ReadyCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource ReadyCommand: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
if (hyperHost.isHyperHostConnected()) {
return new ReadyAnswer(cmd);
} else {
return new ReadyAnswer(cmd, "Host is not in connect state");
}
} catch (Exception e) {
s_logger.error("Unexpected exception: ", e);
return new ReadyAnswer(cmd, VmwareHelper.getExceptionMessage(e));
}
}
protected Answer execute(GetHostStatsCommand cmd) {
if (s_logger.isTraceEnabled()) {
s_logger.trace("Executing resource GetHostStatsCommand: " + _gson.toJson(cmd));
}
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
HostStatsEntry hostStats = new HostStatsEntry(cmd.getHostId(), 0, 0, 0, "host", 0, 0, 0, 0);
Answer answer = new GetHostStatsAnswer(cmd, hostStats);
try {
HostStatsEntry entry = getHyperHostStats(hyperHost);
if (entry != null) {
entry.setHostId(cmd.getHostId());
answer = new GetHostStatsAnswer(cmd, entry);
}
} catch (Exception e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "Unable to execute GetHostStatsCommand due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
}
if (s_logger.isTraceEnabled()) {
s_logger.trace("GetHostStats Answer: " + _gson.toJson(answer));
}
return answer;
}
protected Answer execute(GetVmStatsCommand cmd) {
if (s_logger.isTraceEnabled()) {
s_logger.trace("Executing resource GetVmStatsCommand: " + _gson.toJson(cmd));
}
HashMap<String, VmStatsEntry> vmStatsMap = null;
try {
HashMap<String, PowerState> vmPowerStates = getVmStates();
// getVmNames should return all i-x-y values.
List<String> requestedVmNames = cmd.getVmNames();
List<String> vmNames = new ArrayList<String>();
if (requestedVmNames != null) {
for (String vmName : requestedVmNames) {
if (vmPowerStates.get(vmName) != null) {
vmNames.add(vmName);
}
}
}
if (vmNames != null) {
vmStatsMap = getVmStats(vmNames);
}
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
s_logger.error("Unable to execute GetVmStatsCommand due to : " + VmwareHelper.getExceptionMessage(e), e);
}
Answer answer = new GetVmStatsAnswer(cmd, vmStatsMap);
if (s_logger.isTraceEnabled()) {
s_logger.trace("Report GetVmStatsAnswer: " + _gson.toJson(answer));
}
return answer;
}
protected Answer execute(GetVmDiskStatsCommand cmd) {
return new GetVmDiskStatsAnswer(cmd, null, null, null);
}
protected Answer execute(CheckHealthCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CheckHealthCommand: " + _gson.toJson(cmd));
}
try {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
if (hyperHost.isHyperHostConnected()) {
return new CheckHealthAnswer(cmd, true);
}
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
s_logger.error("Unable to execute CheckHealthCommand due to " + VmwareHelper.getExceptionMessage(e), e);
}
return new CheckHealthAnswer(cmd, false);
}
protected Answer execute(StopCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource StopCommand: " + _gson.toJson(cmd));
}
// In the stop command, we're passed in the name of the VM as seen by cloudstack,
// i.e., i-x-y. This is the internal VM name.
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
try {
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(cmd.getVmName());
if (vmMo != null) {
if (cmd.checkBeforeCleanup()) {
if (getVmPowerState(vmMo) != PowerState.PowerOff) {
String msg = "StopCommand is sent for cleanup and VM " + cmd.getVmName() + " is current running. ignore it.";
s_logger.warn(msg);
return new StopAnswer(cmd, msg, false);
} else {
String msg = "StopCommand is sent for cleanup and VM " + cmd.getVmName() + " is indeed stopped already.";
s_logger.info(msg);
return new StopAnswer(cmd, msg, true);
}
}
try {
vmMo.setCustomFieldValue(CustomFieldConstants.CLOUD_NIC_MASK, "0");
vmMo.setCustomFieldValue(CustomFieldConstants.CLOUD_VM_INTERNAL_NAME, cmd.getVmName());
if (getVmPowerState(vmMo) != PowerState.PowerOff) {
if (vmMo.safePowerOff(_shutdownWaitMs)) {
return new StopAnswer(cmd, "Stop VM " + cmd.getVmName() + " Succeed", true);
} else {
String msg = "Have problem in powering off VM " + cmd.getVmName() + ", let the process continue";
s_logger.warn(msg);
return new StopAnswer(cmd, msg, true);
}
}
String msg = "VM " + cmd.getVmName() + " is already in stopped state";
s_logger.info(msg);
return new StopAnswer(cmd, msg, true);
} finally {
}
} else {
String msg = "VM " + cmd.getVmName() + " is no longer in vSphere";
s_logger.info(msg);
return new StopAnswer(cmd, msg, true);
}
} catch (Exception e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "StopCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg);
return new StopAnswer(cmd, msg, false);
}
}
protected Answer execute(RebootRouterCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource RebootRouterCommand: " + _gson.toJson(cmd));
}
RebootAnswer answer = (RebootAnswer)execute((RebootCommand)cmd);
if (answer.getResult()) {
String connectResult = connect(cmd.getVmName(), cmd.getPrivateIpAddress());
networkUsage(cmd.getPrivateIpAddress(), "create", null);
if (connectResult == null) {
return answer;
} else {
return new Answer(cmd, false, connectResult);
}
}
return answer;
}
protected Answer execute(RebootCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource RebootCommand: " + _gson.toJson(cmd));
}
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
try {
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(cmd.getVmName());
if (vmMo != null) {
try {
vmMo.rebootGuest();
return new RebootAnswer(cmd, "reboot succeeded", true);
} catch (ToolsUnavailableFaultMsg e) {
s_logger.warn("VMware tools is not installed at guest OS, we will perform hard reset for reboot");
} catch (Exception e) {
s_logger.warn("We are not able to perform gracefull guest reboot due to " + VmwareHelper.getExceptionMessage(e));
}
// continue to try with hard-reset
if (vmMo.reset()) {
return new RebootAnswer(cmd, "reboot succeeded", true);
}
String msg = "Reboot failed in vSphere. vm: " + cmd.getVmName();
s_logger.warn(msg);
return new RebootAnswer(cmd, msg, false);
} else {
String msg = "Unable to find the VM in vSphere to reboot. vm: " + cmd.getVmName();
s_logger.warn(msg);
return new RebootAnswer(cmd, msg, false);
}
} catch (Exception e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "RebootCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg);
return new RebootAnswer(cmd, msg, false);
}
}
protected Answer execute(CheckVirtualMachineCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CheckVirtualMachineCommand: " + _gson.toJson(cmd));
}
final String vmName = cmd.getVmName();
PowerState powerState = PowerState.PowerUnknown;
Integer vncPort = null;
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
try {
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(vmName);
if (vmMo != null) {
powerState = getVmPowerState(vmMo);
return new CheckVirtualMachineAnswer(cmd, powerState, vncPort);
} else {
s_logger.warn("Can not find vm " + vmName + " to execute CheckVirtualMachineCommand");
return new CheckVirtualMachineAnswer(cmd, powerState, vncPort);
}
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
s_logger.error("Unexpected exception: " + VmwareHelper.getExceptionMessage(e), e);
return new CheckVirtualMachineAnswer(cmd, powerState, vncPort);
}
}
protected Answer execute(PrepareForMigrationCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource PrepareForMigrationCommand: " + _gson.toJson(cmd));
}
VirtualMachineTO vm = cmd.getVirtualMachine();
if (s_logger.isDebugEnabled()) {
s_logger.debug("Preparing host for migrating " + vm);
}
final String vmName = vm.getName();
try {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
VmwareManager mgr = hyperHost.getContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
// find VM through datacenter (VM is not at the target host yet)
VirtualMachineMO vmMo = hyperHost.findVmOnPeerHyperHost(vmName);
if (vmMo == null) {
s_logger.info("VM " + vmName + " was not found in the cluster of host " + hyperHost.getHyperHostName() + ". Looking for the VM in datacenter.");
ManagedObjectReference dcMor = hyperHost.getHyperHostDatacenter();
DatacenterMO dcMo = new DatacenterMO(hyperHost.getContext(), dcMor);
vmMo = dcMo.findVm(vmName);
if (vmMo == null) {
String msg = "VM " + vmName + " does not exist in VMware datacenter";
s_logger.error(msg);
throw new Exception(msg);
}
}
NicTO[] nics = vm.getNics();
for (NicTO nic : nics) {
// prepare network on the host
prepareNetworkFromNicInfo(new HostMO(getServiceContext(), _morHyperHost), nic, false, cmd.getVirtualMachine().getType());
}
Pair<String, Long> secStoreUrlAndId = mgr.getSecondaryStorageStoreUrlAndId(Long.parseLong(_dcId));
String secStoreUrl = secStoreUrlAndId.first();
Long secStoreId = secStoreUrlAndId.second();
if (secStoreUrl == null) {
String msg = "secondary storage for dc " + _dcId + " is not ready yet?";
throw new Exception(msg);
}
mgr.prepareSecondaryStorageStore(secStoreUrl, secStoreId);
ManagedObjectReference morSecDs = prepareSecondaryDatastoreOnHost(secStoreUrl);
if (morSecDs == null) {
String msg = "Failed to prepare secondary storage on host, secondary store url: " + secStoreUrl;
throw new Exception(msg);
}
return new PrepareForMigrationAnswer(cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "Unexcpeted exception " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new PrepareForMigrationAnswer(cmd, msg);
}
}
protected Answer execute(MigrateCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource MigrateCommand: " + _gson.toJson(cmd));
}
final String vmName = cmd.getVmName();
try {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
ManagedObjectReference morDc = hyperHost.getHyperHostDatacenter();
// find VM through datacenter (VM is not at the target host yet)
VirtualMachineMO vmMo = hyperHost.findVmOnPeerHyperHost(vmName);
if (vmMo == null) {
String msg = "VM " + vmName + " does not exist in VMware datacenter";
s_logger.error(msg);
throw new Exception(msg);
}
VmwareHypervisorHost destHyperHost = getTargetHyperHost(new DatacenterMO(hyperHost.getContext(), morDc), cmd.getDestinationIp());
ManagedObjectReference morTargetPhysicalHost = destHyperHost.findMigrationTarget(vmMo);
if (morTargetPhysicalHost == null) {
throw new Exception("Unable to find a target capable physical host");
}
if (!vmMo.migrate(destHyperHost.getHyperHostOwnerResourcePool(), morTargetPhysicalHost)) {
throw new Exception("Migration failed");
}
return new MigrateAnswer(cmd, true, "migration succeeded", null);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "MigrationCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.warn(msg, e);
return new MigrateAnswer(cmd, false, msg, null);
}
}
protected Answer execute(MigrateWithStorageCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource MigrateWithStorageCommand: " + _gson.toJson(cmd));
}
VirtualMachineTO vmTo = cmd.getVirtualMachine();
String vmName = vmTo.getName();
VmwareHypervisorHost srcHyperHost = null;
VmwareHypervisorHost tgtHyperHost = null;
VirtualMachineMO vmMo = null;
ManagedObjectReference morDsAtTarget = null;
ManagedObjectReference morDsAtSource = null;
ManagedObjectReference morDc = null;
ManagedObjectReference morDcOfTargetHost = null;
ManagedObjectReference morTgtHost = new ManagedObjectReference();
ManagedObjectReference morTgtDatastore = new ManagedObjectReference();
VirtualMachineRelocateSpec relocateSpec = new VirtualMachineRelocateSpec();
List<VirtualMachineRelocateSpecDiskLocator> diskLocators = new ArrayList<VirtualMachineRelocateSpecDiskLocator>();
VirtualMachineRelocateSpecDiskLocator diskLocator = null;
String tgtDsName = "";
String tgtDsHost;
String tgtDsPath;
int tgtDsPort;
VolumeTO volume;
StorageFilerTO filerTo;
Set<String> mountedDatastoresAtSource = new HashSet<String>();
List<VolumeObjectTO> volumeToList = new ArrayList<VolumeObjectTO>();
Map<Long, Integer> volumeDeviceKey = new HashMap<Long, Integer>();
List<Pair<VolumeTO, StorageFilerTO>> volToFiler = cmd.getVolumeToFilerAsList();
String tgtHost = cmd.getTargetHost();
String tgtHostMorInfo = tgtHost.split("@")[0];
morTgtHost.setType(tgtHostMorInfo.split(":")[0]);
morTgtHost.setValue(tgtHostMorInfo.split(":")[1]);
try {
srcHyperHost = getHyperHost(getServiceContext());
tgtHyperHost = new HostMO(getServiceContext(), morTgtHost);
morDc = srcHyperHost.getHyperHostDatacenter();
morDcOfTargetHost = tgtHyperHost.getHyperHostDatacenter();
if (!morDc.getValue().equalsIgnoreCase(morDcOfTargetHost.getValue())) {
String msg = "Source host & target host are in different datacentesr";
throw new CloudRuntimeException(msg);
}
VmwareManager mgr = tgtHyperHost.getContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
String srcHostApiVersion = ((HostMO)srcHyperHost).getHostAboutInfo().getApiVersion();
// find VM through datacenter (VM is not at the target host yet)
vmMo = srcHyperHost.findVmOnPeerHyperHost(vmName);
if (vmMo == null) {
String msg = "VM " + vmName + " does not exist in VMware datacenter " + morDc.getValue();
s_logger.error(msg);
throw new Exception(msg);
}
vmName = vmMo.getName();
// Specify destination datastore location for each volume
for (Pair<VolumeTO, StorageFilerTO> entry : volToFiler) {
volume = entry.first();
filerTo = entry.second();
s_logger.debug("Preparing spec for volume : " + volume.getName());
morDsAtTarget = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(tgtHyperHost, filerTo.getUuid());
morDsAtSource = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(srcHyperHost, filerTo.getUuid());
if (morDsAtTarget == null) {
String msg = "Unable to find the target datastore: " + filerTo.getUuid() + " on target host: " + tgtHyperHost.getHyperHostName() + " to execute MigrateWithStorageCommand";
s_logger.error(msg);
throw new Exception(msg);
}
morTgtDatastore = morDsAtTarget;
// If host version is below 5.1 then simultaneous change of VM's datastore and host is not supported.
// So since only the datastore will be changed first, ensure the target datastore is mounted on source host.
if (srcHostApiVersion.compareTo("5.1") < 0) {
tgtDsName = filerTo.getUuid().replace("-", "");
tgtDsHost = filerTo.getHost();
tgtDsPath = filerTo.getPath();
tgtDsPort = filerTo.getPort();
// If datastore is NFS and target datastore is not already mounted on source host then mount the datastore.
if (filerTo.getType().equals(StoragePoolType.NetworkFilesystem)) {
if (morDsAtSource == null) {
morDsAtSource = srcHyperHost.mountDatastore(false, tgtDsHost, tgtDsPort, tgtDsPath, tgtDsName);
if (morDsAtSource == null) {
throw new Exception("Unable to mount NFS datastore " + tgtDsHost + ":/" + tgtDsPath + " on " + _hostName);
}
mountedDatastoresAtSource.add(tgtDsName);
s_logger.debug("Mounted datastore " + tgtDsHost + ":/" + tgtDsPath + " on " + _hostName);
}
}
// If datastore is VMFS and target datastore is not mounted or accessible to source host then fail migration.
if (filerTo.getType().equals(StoragePoolType.VMFS)) {
if (morDsAtSource == null) {
s_logger.warn("If host version is below 5.1, then target VMFS datastore(s) need to manually mounted on source host for a successful live storage migration.");
throw new Exception("Target VMFS datastore: " + tgtDsPath + " is not mounted on source host: " + _hostName);
}
DatastoreMO dsAtSourceMo = new DatastoreMO(getServiceContext(), morDsAtSource);
String srcHostValue = srcHyperHost.getMor().getValue();
if(!dsAtSourceMo.isAccessibleToHost(srcHostValue)) {
s_logger.warn("If host version is below 5.1, then target VMFS datastore(s) need to accessible to source host for a successful live storage migration.");
throw new Exception("Target VMFS datastore: " + tgtDsPath + " is not accessible on source host: " + _hostName);
}
}
morTgtDatastore = morDsAtSource;
}
if (volume.getType() == Volume.Type.ROOT) {
relocateSpec.setDatastore(morTgtDatastore);
}
diskLocator = new VirtualMachineRelocateSpecDiskLocator();
diskLocator.setDatastore(morDsAtSource);
Pair<VirtualDisk, String> diskInfo = getVirtualDiskInfo(vmMo, volume.getPath() + ".vmdk");
String vmdkAbsFile = getAbsoluteVmdkFile(diskInfo.first());
if (vmdkAbsFile != null && !vmdkAbsFile.isEmpty()) {
vmMo.updateAdapterTypeIfRequired(vmdkAbsFile);
}
int diskId = diskInfo.first().getKey();
diskLocator.setDiskId(diskId);
diskLocators.add(diskLocator);
volumeDeviceKey.put(volume.getId(), diskId);
}
// If a target datastore is provided for the VM, then by default all volumes associated with the VM will be migrated to that target datastore.
// Hence set the existing datastore as target datastore for volumes that are not to be migrated.
List<Pair<Integer, ManagedObjectReference>> diskDatastores = vmMo.getAllDiskDatastores();
for (Pair<Integer, ManagedObjectReference> diskDatastore : diskDatastores) {
if (!volumeDeviceKey.containsValue(diskDatastore.first().intValue())) {
diskLocator = new VirtualMachineRelocateSpecDiskLocator();
diskLocator.setDiskId(diskDatastore.first().intValue());
diskLocator.setDatastore(diskDatastore.second());
diskLocators.add(diskLocator);
}
}
relocateSpec.getDisk().addAll(diskLocators);
// Prepare network at target before migration
NicTO[] nics = vmTo.getNics();
for (NicTO nic : nics) {
// prepare network on the host
prepareNetworkFromNicInfo(new HostMO(getServiceContext(), morTgtHost), nic, false, vmTo.getType());
}
// Ensure secondary storage mounted on target host
Pair<String, Long> secStoreUrlAndId = mgr.getSecondaryStorageStoreUrlAndId(Long.parseLong(_dcId));
String secStoreUrl = secStoreUrlAndId.first();
Long secStoreId = secStoreUrlAndId.second();
if (secStoreUrl == null) {
String msg = "secondary storage for dc " + _dcId + " is not ready yet?";
throw new Exception(msg);
}
mgr.prepareSecondaryStorageStore(secStoreUrl, secStoreId);
ManagedObjectReference morSecDs = prepareSecondaryDatastoreOnSpecificHost(secStoreUrl, tgtHyperHost);
if (morSecDs == null) {
String msg = "Failed to prepare secondary storage on host, secondary store url: " + secStoreUrl;
throw new Exception(msg);
}
if (srcHostApiVersion.compareTo("5.1") < 0) {
// Migrate VM's volumes to target datastore(s).
if (!vmMo.changeDatastore(relocateSpec)) {
throw new Exception("Change datastore operation failed during storage migration");
} else {
s_logger.debug("Successfully migrated storage of VM " + vmName + " to target datastore(s)");
}
// Migrate VM to target host.
ManagedObjectReference morPool = tgtHyperHost.getHyperHostOwnerResourcePool();
if (!vmMo.migrate(morPool, tgtHyperHost.getMor())) {
throw new Exception("VM migration to target host failed during storage migration");
} else {
s_logger.debug("Successfully migrated VM " + vmName + " from " + _hostName + " to " + tgtHyperHost.getHyperHostName());
}
} else {
// Simultaneously migrate VM's volumes to target datastore and VM to target host.
relocateSpec.setHost(tgtHyperHost.getMor());
relocateSpec.setPool(tgtHyperHost.getHyperHostOwnerResourcePool());
if (!vmMo.changeDatastore(relocateSpec)) {
throw new Exception("Change datastore operation failed during storage migration");
} else {
s_logger.debug("Successfully migrated VM " + vmName + " from " + _hostName + " to " + tgtHyperHost.getHyperHostName() +
" and its storage to target datastore(s)");
}
}
// Consolidate VM disks.
// In case of a linked clone VM, if VM's disks are not consolidated, further VM operations such as volume snapshot, VM snapshot etc. will result in DB inconsistencies.
if (!vmMo.consolidateVmDisks()) {
s_logger.warn("VM disk consolidation failed after storage migration. Yet proceeding with VM migration.");
} else {
s_logger.debug("Successfully consolidated disks of VM " + vmName + ".");
}
// Update and return volume path and chain info for every disk because that could have changed after migration
VirtualMachineDiskInfoBuilder diskInfoBuilder = vmMo.getDiskInfoBuilder();
for (Pair<VolumeTO, StorageFilerTO> entry : volToFiler) {
volume = entry.first();
long volumeId = volume.getId();
VirtualDisk[] disks = vmMo.getAllDiskDevice();
for (VirtualDisk disk : disks) {
if (volumeDeviceKey.get(volumeId) == disk.getKey()) {
VolumeObjectTO newVol = new VolumeObjectTO();
String newPath = vmMo.getVmdkFileBaseName(disk);
String poolName = entry.second().getUuid().replace("-", "");
VirtualMachineDiskInfo diskInfo = diskInfoBuilder.getDiskInfoByBackingFileBaseName(newPath, poolName);
newVol.setId(volumeId);
newVol.setPath(newPath);
newVol.setChainInfo(_gson.toJson(diskInfo));
volumeToList.add(newVol);
break;
}
}
}
return new MigrateWithStorageAnswer(cmd, volumeToList);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encountered remote exception at vCenter, invalidating VMware session context");
invalidateServiceContext();
}
String msg = "MigrationCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.warn(msg, e);
return new MigrateWithStorageAnswer(cmd, (Exception)e);
} finally {
// Cleanup datastores mounted on source host
for (String mountedDatastore : mountedDatastoresAtSource) {
s_logger.debug("Attempting to unmount datastore " + mountedDatastore + " at " + _hostName);
try {
srcHyperHost.unmountDatastore(mountedDatastore);
} catch (Exception unmountEx) {
s_logger.debug("Failed to unmount datastore " + mountedDatastore + " at " + _hostName + ". Seems the datastore is still being used by " + _hostName +
". Please unmount manually to cleanup.");
}
s_logger.debug("Successfully unmounted datastore " + mountedDatastore + " at " + _hostName);
}
}
}
private Answer execute(MigrateVolumeCommand cmd) {
String volumePath = cmd.getVolumePath();
StorageFilerTO poolTo = cmd.getPool();
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource MigrateVolumeCommand: " + _gson.toJson(cmd));
}
String vmName = cmd.getAttachedVmName();
VirtualMachineMO vmMo = null;
VmwareHypervisorHost srcHyperHost = null;
ManagedObjectReference morDs = null;
ManagedObjectReference morDc = null;
VirtualMachineRelocateSpec relocateSpec = new VirtualMachineRelocateSpec();
List<VirtualMachineRelocateSpecDiskLocator> diskLocators = new ArrayList<VirtualMachineRelocateSpecDiskLocator>();
VirtualMachineRelocateSpecDiskLocator diskLocator = null;
String tgtDsName = "";
try {
srcHyperHost = getHyperHost(getServiceContext());
morDc = srcHyperHost.getHyperHostDatacenter();
tgtDsName = poolTo.getUuid();
// find VM in this datacenter not just in this cluster.
DatacenterMO dcMo = new DatacenterMO(getServiceContext(), morDc);
vmMo = dcMo.findVm(vmName);
if (vmMo == null) {
String msg = "VM " + vmName + " does not exist in VMware datacenter " + morDc.getValue();
s_logger.error(msg);
throw new Exception(msg);
}
vmName = vmMo.getName();
morDs = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(srcHyperHost, tgtDsName);
if (morDs == null) {
String msg = "Unable to find the mounted datastore with name: " + tgtDsName + " on source host: " + srcHyperHost.getHyperHostName() +" to execute MigrateVolumeCommand";
s_logger.error(msg);
throw new Exception(msg);
}
DatastoreMO targetDsMo = new DatastoreMO(srcHyperHost.getContext(), morDs);
String fullVolumePath = VmwareStorageLayoutHelper.getVmwareDatastorePathFromVmdkFileName(targetDsMo, vmName, volumePath + ".vmdk");
Pair<VirtualDisk, String> diskInfo = getVirtualDiskInfo(vmMo, volumePath + ".vmdk");
String vmdkAbsFile = getAbsoluteVmdkFile(diskInfo.first());
if (vmdkAbsFile != null && !vmdkAbsFile.isEmpty()) {
vmMo.updateAdapterTypeIfRequired(vmdkAbsFile);
}
int diskId = diskInfo.first().getKey();
diskLocator = new VirtualMachineRelocateSpecDiskLocator();
diskLocator.setDatastore(morDs);
diskLocator.setDiskId(diskId);
diskLocators.add(diskLocator);
if (cmd.getVolumeType() == Volume.Type.ROOT) {
relocateSpec.setDatastore(morDs);
// If a target datastore is provided for the VM, then by default all volumes associated with the VM will be migrated to that target datastore.
// Hence set the existing datastore as target datastore for volumes that are not to be migrated.
List<Pair<Integer, ManagedObjectReference>> diskDatastores = vmMo.getAllDiskDatastores();
for (Pair<Integer, ManagedObjectReference> diskDatastore : diskDatastores) {
if (diskDatastore.first().intValue() != diskId) {
diskLocator = new VirtualMachineRelocateSpecDiskLocator();
diskLocator.setDiskId(diskDatastore.first().intValue());
diskLocator.setDatastore(diskDatastore.second());
diskLocators.add(diskLocator);
}
}
}
relocateSpec.getDisk().addAll(diskLocators);
// Change datastore
if (!vmMo.changeDatastore(relocateSpec)) {
throw new Exception("Change datastore operation failed during volume migration");
} else {
s_logger.debug("Successfully migrated volume " + volumePath + " to target datastore " + tgtDsName);
}
// Consolidate VM disks.
// In case of a linked clone VM, if VM's disks are not consolidated,
// further volume operations on the ROOT volume such as volume snapshot etc. will result in DB inconsistencies.
if (!vmMo.consolidateVmDisks()) {
s_logger.warn("VM disk consolidation failed after storage migration.");
} else {
s_logger.debug("Successfully consolidated disks of VM " + vmName + ".");
}
// Update and return volume path and chain info because that could have changed after migration
if (!targetDsMo.fileExists(fullVolumePath)) {
VirtualDisk[] disks = vmMo.getAllDiskDevice();
for (VirtualDisk disk : disks)
if (disk.getKey() == diskId) {
volumePath = vmMo.getVmdkFileBaseName(disk);
}
}
VirtualMachineDiskInfoBuilder diskInfoBuilder = vmMo.getDiskInfoBuilder();
String chainInfo = _gson.toJson(diskInfoBuilder.getDiskInfoByBackingFileBaseName(volumePath, poolTo.getUuid().replace("-", "")));
MigrateVolumeAnswer answer = new MigrateVolumeAnswer(cmd, true, null, volumePath);
answer.setVolumeChainInfo(chainInfo);
return answer;
} catch (Exception e) {
String msg = "Catch Exception " + e.getClass().getName() + " due to " + e.toString();
s_logger.error(msg, e);
return new MigrateVolumeAnswer(cmd, false, msg, null);
}
}
private Pair<VirtualDisk, String> getVirtualDiskInfo(VirtualMachineMO vmMo, String srcDiskName) throws Exception {
Pair<VirtualDisk, String> deviceInfo = vmMo.getDiskDevice(srcDiskName);
if (deviceInfo == null) {
throw new Exception("No such disk device: " + srcDiskName);
}
return deviceInfo;
}
private VmwareHypervisorHost getTargetHyperHost(DatacenterMO dcMo, String destIp) throws Exception {
VmwareManager mgr = dcMo.getContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
List<ObjectContent> ocs = dcMo.getHostPropertiesOnDatacenterHostFolder(new String[] {"name", "parent"});
if (ocs != null && ocs.size() > 0) {
for (ObjectContent oc : ocs) {
HostMO hostMo = new HostMO(dcMo.getContext(), oc.getObj());
VmwareHypervisorHostNetworkSummary netSummary = hostMo.getHyperHostNetworkSummary(mgr.getManagementPortGroupByHost(hostMo));
if (destIp.equalsIgnoreCase(netSummary.getHostIp())) {
return new HostMO(dcMo.getContext(), oc.getObj());
}
}
}
throw new Exception("Unable to locate dest host by " + destIp);
}
protected Answer execute(CreateStoragePoolCommand cmd) {
if (cmd.getCreateDatastore()) {
try {
VmwareContext context = getServiceContext();
_storageProcessor.prepareManagedDatastore(context, getHyperHost(context),
cmd.getDetails().get(CreateStoragePoolCommand.DATASTORE_NAME), cmd.getDetails().get(CreateStoragePoolCommand.IQN),
cmd.getDetails().get(CreateStoragePoolCommand.STORAGE_HOST), Integer.parseInt(cmd.getDetails().get(CreateStoragePoolCommand.STORAGE_PORT)));
} catch (Exception ex) {
return new Answer(cmd, false, "Issue creating datastore");
}
}
return new Answer(cmd, true, "success");
}
protected Answer execute(ModifyTargetsCommand cmd) {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
handleTargets(cmd.getAdd(), cmd.getTargets(), (HostMO)hyperHost);
return new ModifyTargetsAnswer();
}
protected Answer execute(ModifyStoragePoolCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource ModifyStoragePoolCommand: " + _gson.toJson(cmd));
}
try {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
StorageFilerTO pool = cmd.getPool();
if (pool.getType() != StoragePoolType.NetworkFilesystem && pool.getType() != StoragePoolType.VMFS) {
throw new Exception("Unsupported storage pool type " + pool.getType());
}
ManagedObjectReference morDatastore = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(hyperHost, pool.getUuid());
if (morDatastore == null) {
morDatastore = hyperHost.mountDatastore(pool.getType() == StoragePoolType.VMFS, pool.getHost(), pool.getPort(), pool.getPath(), pool.getUuid().replace("-", ""));
}
assert (morDatastore != null);
DatastoreSummary summary = new DatastoreMO(getServiceContext(), morDatastore).getSummary();
long capacity = summary.getCapacity();
long available = summary.getFreeSpace();
Map<String, TemplateProp> tInfo = new HashMap<String, TemplateProp>();
ModifyStoragePoolAnswer answer = new ModifyStoragePoolAnswer(cmd, capacity, available, tInfo);
if (cmd.getAdd() && pool.getType() == StoragePoolType.VMFS) {
answer.setLocalDatastoreName(morDatastore.getValue());
}
return answer;
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "ModifyStoragePoolCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new Answer(cmd, false, msg);
}
}
private void handleTargets(boolean add, List<Map<String, String>> targets, HostMO host) {
if (targets != null && targets.size() > 0) {
try {
_storageProcessor.handleTargetsForHost(add, targets, host);
}
catch (Exception ex) {
s_logger.warn(ex.getMessage());
}
}
}
protected Answer execute(DeleteStoragePoolCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource DeleteStoragePoolCommand: " + _gson.toJson(cmd));
}
try {
if (cmd.getRemoveDatastore()) {
_storageProcessor.handleDatastoreAndVmdkDetach(cmd.getDetails().get(DeleteStoragePoolCommand.DATASTORE_NAME), cmd.getDetails().get(DeleteStoragePoolCommand.IQN),
cmd.getDetails().get(DeleteStoragePoolCommand.STORAGE_HOST), Integer.parseInt(cmd.getDetails().get(DeleteStoragePoolCommand.STORAGE_PORT)));
return new Answer(cmd, true, "success");
}
else {
// We will leave datastore cleanup management to vCenter. Since for cluster VMFS datastore, it will always
// be mounted by vCenter.
// VmwareHypervisorHost hyperHost = this.getHyperHost(getServiceContext());
// hyperHost.unmountDatastore(pool.getUuid());
return new Answer(cmd, true, "success");
}
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
StorageFilerTO pool = cmd.getPool();
String msg = "DeleteStoragePoolCommand (pool: " + pool.getHost() + ", path: " + pool.getPath() + ") failed due to " + VmwareHelper.getExceptionMessage(e);
return new Answer(cmd, false, msg);
}
}
public static String getDatastoreName(String str) {
return str.replace('/', '-');
}
protected Answer execute(AttachIsoCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource AttachIsoCommand: " + _gson.toJson(cmd));
}
try {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(cmd.getVmName());
if (vmMo == null) {
String msg = "Unable to find VM in vSphere to execute AttachIsoCommand, vmName: " + cmd.getVmName();
s_logger.error(msg);
throw new Exception(msg);
}
String storeUrl = cmd.getStoreUrl();
if (storeUrl == null) {
if (!cmd.getIsoPath().equalsIgnoreCase("vmware-tools.iso")) {
String msg = "ISO store root url is not found in AttachIsoCommand";
s_logger.error(msg);
throw new Exception(msg);
} else {
if (cmd.isAttach()) {
vmMo.mountToolsInstaller();
} else {
try{
if (!vmMo.unmountToolsInstaller()) {
return new Answer(cmd, false,
"Failed to unmount vmware-tools installer ISO as the corresponding CDROM device is locked by VM. Please unmount the CDROM device inside the VM and ret-try.");
}
}catch(Throwable e){
vmMo.detachIso(null);
}
}
return new Answer(cmd);
}
}
ManagedObjectReference morSecondaryDs = prepareSecondaryDatastoreOnHost(storeUrl);
String isoPath = cmd.getIsoPath();
if (!isoPath.startsWith(storeUrl)) {
assert (false);
String msg = "ISO path does not start with the secondary storage root";
s_logger.error(msg);
throw new Exception(msg);
}
int isoNameStartPos = isoPath.lastIndexOf('/');
String isoFileName = isoPath.substring(isoNameStartPos + 1);
String isoStorePathFromRoot = isoPath.substring(storeUrl.length(), isoNameStartPos);
// TODO, check if iso is already attached, or if there is a previous
// attachment
DatastoreMO secondaryDsMo = new DatastoreMO(getServiceContext(), morSecondaryDs);
String storeName = secondaryDsMo.getName();
String isoDatastorePath = String.format("[%s] %s%s", storeName, isoStorePathFromRoot, isoFileName);
if (cmd.isAttach()) {
vmMo.attachIso(isoDatastorePath, morSecondaryDs, true, false);
} else {
vmMo.detachIso(isoDatastorePath);
}
return new Answer(cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
if (cmd.isAttach()) {
String msg = "AttachIsoCommand(attach) failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new Answer(cmd, false, msg);
} else {
String msg = "AttachIsoCommand(detach) failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.warn(msg, e);
return new Answer(cmd, false, msg);
}
}
}
public synchronized ManagedObjectReference prepareSecondaryDatastoreOnHost(String storeUrl) throws Exception {
String storeName = getSecondaryDatastoreUUID(storeUrl);
URI uri = new URI(storeUrl);
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
ManagedObjectReference morDatastore = hyperHost.mountDatastore(false, uri.getHost(), 0, uri.getPath(), storeName.replace("-", ""));
if (morDatastore == null)
throw new Exception("Unable to mount secondary storage on host. storeUrl: " + storeUrl);
return morDatastore;
}
public synchronized ManagedObjectReference prepareSecondaryDatastoreOnSpecificHost(String storeUrl, VmwareHypervisorHost hyperHost) throws Exception {
String storeName = getSecondaryDatastoreUUID(storeUrl);
URI uri = new URI(storeUrl);
ManagedObjectReference morDatastore = hyperHost.mountDatastore(false, uri.getHost(), 0, uri.getPath(), storeName.replace("-", ""));
if (morDatastore == null)
throw new Exception("Unable to mount secondary storage on host. storeUrl: " + storeUrl);
return morDatastore;
}
private static String getSecondaryDatastoreUUID(String storeUrl) {
String uuid = null;
try{
uuid=UUID.nameUUIDFromBytes(storeUrl.getBytes("UTF-8")).toString();
}catch(UnsupportedEncodingException e){
s_logger.warn("Failed to create UUID from string " + storeUrl + ". Bad storeUrl or UTF-8 encoding error." );
}
return uuid;
}
protected Answer execute(ValidateSnapshotCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource ValidateSnapshotCommand: " + _gson.toJson(cmd));
}
// the command is no longer available
String expectedSnapshotBackupUuid = null;
String actualSnapshotBackupUuid = null;
String actualSnapshotUuid = null;
return new ValidateSnapshotAnswer(cmd, false, "ValidateSnapshotCommand is not supported for vmware yet", expectedSnapshotBackupUuid, actualSnapshotBackupUuid,
actualSnapshotUuid);
}
protected Answer execute(ManageSnapshotCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource ManageSnapshotCommand: " + _gson.toJson(cmd));
}
long snapshotId = cmd.getSnapshotId();
/*
* "ManageSnapshotCommand",
* "{\"_commandSwitch\":\"-c\",\"_volumePath\":\"i-2-3-KY-ROOT\",\"_snapshotName\":\"i-2-3-KY_i-2-3-KY-ROOT_20101102203827\",\"_snapshotId\":1,\"_vmName\":\"i-2-3-KY\"}"
*/
boolean success = false;
String cmdSwitch = cmd.getCommandSwitch();
String snapshotOp = "Unsupported snapshot command." + cmdSwitch;
if (cmdSwitch.equals(ManageSnapshotCommand.CREATE_SNAPSHOT)) {
snapshotOp = "create";
} else if (cmdSwitch.equals(ManageSnapshotCommand.DESTROY_SNAPSHOT)) {
snapshotOp = "destroy";
}
String details = "ManageSnapshotCommand operation: " + snapshotOp + " Failed for snapshotId: " + snapshotId;
String snapshotUUID = null;
// snapshot operation (create or destroy) is handled inside BackupSnapshotCommand(), we just fake
// a success return here
snapshotUUID = UUID.randomUUID().toString();
success = true;
details = null;
return new ManageSnapshotAnswer(cmd, snapshotId, snapshotUUID, success, details);
}
protected Answer execute(BackupSnapshotCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource BackupSnapshotCommand: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return mgr.getStorageManager().execute(this, cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String details = "BackupSnapshotCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(details, e);
return new BackupSnapshotAnswer(cmd, false, details, null, true);
}
}
protected Answer execute(CreateVMSnapshotCommand cmd) {
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return mgr.getStorageManager().execute(this, cmd);
} catch (Exception e) {
e.printStackTrace();
return new CreateVMSnapshotAnswer(cmd, false, "");
}
}
protected Answer execute(DeleteVMSnapshotCommand cmd) {
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return mgr.getStorageManager().execute(this, cmd);
} catch (Exception e) {
e.printStackTrace();
return new DeleteVMSnapshotAnswer(cmd, false, "");
}
}
protected Answer execute(RevertToVMSnapshotCommand cmd) {
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return mgr.getStorageManager().execute(this, cmd);
} catch (Exception e) {
e.printStackTrace();
return new RevertToVMSnapshotAnswer(cmd, false, "");
}
}
protected Answer execute(CreateVolumeFromSnapshotCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CreateVolumeFromSnapshotCommand: " + _gson.toJson(cmd));
}
String details = null;
boolean success = false;
String newVolumeName = UUID.randomUUID().toString();
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return mgr.getStorageManager().execute(this, cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
details = "CreateVolumeFromSnapshotCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(details, e);
}
return new CreateVolumeFromSnapshotAnswer(cmd, success, details, newVolumeName);
}
protected Answer execute(CreatePrivateTemplateFromVolumeCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CreatePrivateTemplateFromVolumeCommand: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return mgr.getStorageManager().execute(this, cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String details = "CreatePrivateTemplateFromVolumeCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(details, e);
return new CreatePrivateTemplateAnswer(cmd, false, details);
}
}
protected Answer execute(final UpgradeSnapshotCommand cmd) {
return new Answer(cmd, true, "success");
}
protected Answer execute(CreatePrivateTemplateFromSnapshotCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CreatePrivateTemplateFromSnapshotCommand: " + _gson.toJson(cmd));
}
try {
VmwareManager mgr = getServiceContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return mgr.getStorageManager().execute(this, cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String details = "CreatePrivateTemplateFromSnapshotCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(details, e);
return new CreatePrivateTemplateAnswer(cmd, false, details);
}
}
protected Answer execute(GetStorageStatsCommand cmd) {
if (s_logger.isTraceEnabled()) {
s_logger.trace("Executing resource GetStorageStatsCommand: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
ManagedObjectReference morDs = HypervisorHostHelper.findDatastoreWithBackwardsCompatibility(hyperHost, cmd.getStorageId());
if (morDs != null) {
DatastoreMO datastoreMo = new DatastoreMO(context, morDs);
DatastoreSummary summary = datastoreMo.getSummary();
assert (summary != null);
long capacity = summary.getCapacity();
long free = summary.getFreeSpace();
long used = capacity - free;
if (s_logger.isDebugEnabled()) {
s_logger.debug("Datastore summary info, storageId: " + cmd.getStorageId() + ", localPath: " + cmd.getLocalPath() + ", poolType: " +
cmd.getPooltype() + ", capacity: " + capacity + ", free: " + free + ", used: " + used);
}
if (summary.getCapacity() <= 0) {
s_logger.warn("Something is wrong with vSphere NFS datastore, rebooting ESX(ESXi) host should help");
}
return new GetStorageStatsAnswer(cmd, capacity, used);
} else {
String msg =
"Could not find datastore for GetStorageStatsCommand storageId : " + cmd.getStorageId() + ", localPath: " + cmd.getLocalPath() + ", poolType: " +
cmd.getPooltype();
s_logger.error(msg);
return new GetStorageStatsAnswer(cmd, msg);
}
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg =
"Unable to execute GetStorageStatsCommand(storageId : " + cmd.getStorageId() + ", localPath: " + cmd.getLocalPath() + ", poolType: " + cmd.getPooltype() +
") due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new GetStorageStatsAnswer(cmd, msg);
}
}
protected Answer execute(GetVncPortCommand cmd) {
if (s_logger.isTraceEnabled()) {
s_logger.trace("Executing resource GetVncPortCommand: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
assert (hyperHost instanceof HostMO);
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(cmd.getName());
if (vmMo == null) {
if (s_logger.isDebugEnabled()) {
s_logger.debug("Unable to find the owner VM for GetVncPortCommand on host " + hyperHost.getHyperHostName() + ", try within datacenter");
}
vmMo = hyperHost.findVmOnPeerHyperHost(cmd.getName());
if (vmMo == null) {
throw new Exception("Unable to find VM in vSphere, vm: " + cmd.getName());
}
}
Pair<String, Integer> portInfo = vmMo.getVncPort(mgr.getManagementPortGroupByHost((HostMO)hyperHost));
if (s_logger.isTraceEnabled()) {
s_logger.trace("Found vnc port info. vm: " + cmd.getName() + " host: " + portInfo.first() + ", vnc port: " + portInfo.second());
}
return new GetVncPortAnswer(cmd, portInfo.first(), portInfo.second());
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "GetVncPortCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new GetVncPortAnswer(cmd, msg);
}
}
protected Answer execute(SetupCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource SetupCommand: " + _gson.toJson(cmd));
}
return new SetupAnswer(cmd, false);
}
protected Answer execute(MaintainCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource MaintainCommand: " + _gson.toJson(cmd));
}
return new MaintainAnswer(cmd, "Put host in maintaince");
}
protected Answer execute(PingTestCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource PingTestCommand: " + _gson.toJson(cmd));
}
String controlIp = cmd.getRouterIp();
if (controlIp != null) {
String args = " -c 1 -n -q " + cmd.getPrivateIp();
try {
VmwareManager mgr = getServiceContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
Pair<Boolean, String> result = SshHelper.sshExecute(controlIp, DefaultDomRSshPort, "root", mgr.getSystemVMKeyFile(), null, "/bin/ping" + args);
if (result.first())
return new Answer(cmd);
} catch (Exception e) {
s_logger.error("Unable to execute ping command on DomR (" + controlIp + "), domR may not be ready yet. failure due to "
+ VmwareHelper.getExceptionMessage(e), e);
}
return new Answer(cmd, false, "PingTestCommand failed");
} else {
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
try {
HostMO hostMo = (HostMO)hyperHost;
ClusterMO clusterMo = new ClusterMO(context, hostMo.getHyperHostCluster());
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
List<Pair<ManagedObjectReference, String>> hosts = clusterMo.getClusterHosts();
for (Pair<ManagedObjectReference, String> entry : hosts) {
HostMO hostInCluster = new HostMO(context, entry.first());
String hostIp = hostInCluster.getHostManagementIp(mgr.getManagementPortGroupName());
if (hostIp != null && hostIp.equals(cmd.getComputingHostIp())) {
if (hostInCluster.isHyperHostConnected())
return new Answer(cmd);
else
return new Answer(cmd, false, "PingTestCommand failed");
}
}
} catch (Exception e) {
s_logger.error("Unable to execute ping command on host (" + cmd.getComputingHostIp() + "). failure due to "
+ VmwareHelper.getExceptionMessage(e), e);
}
return new Answer(cmd, false, "PingTestCommand failed");
}
}
protected Answer execute(CheckOnHostCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CheckOnHostCommand: " + _gson.toJson(cmd));
}
return new CheckOnHostAnswer(cmd, null, "Not Implmeneted");
}
protected Answer execute(ModifySshKeysCommand cmd) {
//do not log the command contents for this command. do NOT log the ssh keys
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource ModifySshKeysCommand.");
}
return new Answer(cmd);
}
@Override
public PrimaryStorageDownloadAnswer execute(PrimaryStorageDownloadCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource PrimaryStorageDownloadCommand: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return (PrimaryStorageDownloadAnswer)mgr.getStorageManager().execute(this, cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "PrimaryStorageDownloadCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new PrimaryStorageDownloadAnswer(msg);
}
}
protected Answer execute(PvlanSetupCommand cmd) {
// Pvlan related operations are performed in the start/stop command paths
// for vmware. This function is implemented to support mgmt layer code
// that issue this command. Note that pvlan operations are supported only
// in Distributed Virtual Switch environments for vmware deployments.
return new Answer(cmd, true, "success");
}
protected Answer execute(UnregisterVMCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource UnregisterVMCommand: " + _gson.toJson(cmd));
}
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
try {
DatacenterMO dataCenterMo = new DatacenterMO(getServiceContext(), hyperHost.getHyperHostDatacenter());
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(cmd.getVmName());
if (vmMo != null) {
try {
VirtualMachineFileLayoutEx vmFileLayout = vmMo.getFileLayout();
context.getService().unregisterVM(vmMo.getMor());
if (cmd.getCleanupVmFiles()) {
deleteUnregisteredVmFiles(vmFileLayout, dataCenterMo, false);
}
return new Answer(cmd, true, "unregister succeeded");
} catch (Exception e) {
s_logger.warn("We are not able to unregister VM " + VmwareHelper.getExceptionMessage(e));
}
String msg = "Expunge failed in vSphere. vm: " + cmd.getVmName();
s_logger.warn(msg);
return new Answer(cmd, false, msg);
} else {
String msg = "Unable to find the VM in vSphere to unregister, assume it is already removed. VM: " + cmd.getVmName();
s_logger.warn(msg);
return new Answer(cmd, true, msg);
}
} catch (Exception e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "UnregisterVMCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg);
return new Answer(cmd, false, msg);
}
}
/**
* UnregisterNicCommand is used to remove a portgroup created for this
* specific nic. The portgroup will have the name set to the UUID of the
* nic. Introduced to cleanup the portgroups created for each nic that is
* plugged into an lswitch (Nicira NVP plugin)
*
* @param cmd
* @return
*/
protected Answer execute(UnregisterNicCommand cmd) {
s_logger.info("Executing resource UnregisterNicCommand: " + _gson.toJson(cmd));
if (_guestTrafficInfo == null) {
return new Answer(cmd, false, "No Guest Traffic Info found, unable to determine where to clean up");
}
try {
if (_guestTrafficInfo.getVirtualSwitchType() != VirtualSwitchType.StandardVirtualSwitch) {
// For now we only need to cleanup the nvp specific portgroups
// on the standard switches
return new Answer(cmd, true, "Nothing to do");
}
s_logger.debug("Cleaning up portgroup " + cmd.getNicUuid() + " on switch " + _guestTrafficInfo.getVirtualSwitchName());
VmwareContext context = getServiceContext();
VmwareHypervisorHost host = getHyperHost(context);
ManagedObjectReference clusterMO = host.getHyperHostCluster();
// Get a list of all the hosts in this cluster
@SuppressWarnings("unchecked")
List<ManagedObjectReference> hosts = (List<ManagedObjectReference>)context.getVimClient().getDynamicProperty(clusterMO, "host");
if (hosts == null) {
return new Answer(cmd, false, "No hosts in cluster, which is pretty weird");
}
for (ManagedObjectReference hostMOR : hosts) {
HostMO hostMo = new HostMO(context, hostMOR);
hostMo.deletePortGroup(cmd.getNicUuid().toString());
s_logger.debug("Removed portgroup " + cmd.getNicUuid() + " from host " + hostMo.getHostName());
}
return new Answer(cmd, true, "Unregistered resources for NIC " + cmd.getNicUuid());
} catch (Exception e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "UnregisterVMCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg);
return new Answer(cmd, false, msg);
}
}
public void cleanupNetwork(HostMO hostMo, NetworkDetails netDetails) {
// we will no longer cleanup VLAN networks in order to support native VMware HA
/*
* assert(netDetails.getName() != null); try { synchronized(this) { NetworkMO networkMo = new
* NetworkMO(hostMo.getContext(), netDetails.getNetworkMor()); ManagedObjectReference[] vms =
* networkMo.getVMsOnNetwork(); if(vms == null || vms.length == 0) { if(s_logger.isInfoEnabled()) {
* s_logger.info("Cleanup network as it is currently not in use: " + netDetails.getName()); }
*
* hostMo.deletePortGroup(netDetails.getName()); } } } catch(Throwable e) {
* s_logger.warn("Unable to cleanup network due to exception, skip for next time"); }
*/
}
@Override
public CopyVolumeAnswer execute(CopyVolumeCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource CopyVolumeCommand: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
return (CopyVolumeAnswer)mgr.getStorageManager().execute(this, cmd);
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
String msg = "CopyVolumeCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new CopyVolumeAnswer(cmd, false, msg, null, null);
}
}
@Override
public void disconnected() {
}
@Override
public IAgentControl getAgentControl() {
return null;
}
@Override
public PingCommand getCurrentStatus(long id) {
try {
gcAndKillHungWorkerVMs();
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
try {
if (!hyperHost.isHyperHostConnected()) {
return null;
}
} catch (Exception e) {
s_logger.error("Unexpected exception", e);
return null;
}
return new PingRoutingCommand(getType(), id, syncHostVmStates());
} finally {
recycleServiceContext();
}
}
private void gcAndKillHungWorkerVMs() {
try {
// take the chance to do left-over dummy VM cleanup from previous run
VmwareContext context = getServiceContext();
VmwareHypervisorHost hyperHost = getHyperHost(context);
VmwareManager mgr = hyperHost.getContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
if (hyperHost.isHyperHostConnected()) {
mgr.gcLeftOverVMs(context);
s_logger.info("Scan hung worker VM to recycle");
int workerKey = ((HostMO)hyperHost).getCustomFieldKey("VirtualMachine", CustomFieldConstants.CLOUD_WORKER);
int workerTagKey = ((HostMO)hyperHost).getCustomFieldKey("VirtualMachine", CustomFieldConstants.CLOUD_WORKER_TAG);
String workerPropName = String.format("value[%d]", workerKey);
String workerTagPropName = String.format("value[%d]", workerTagKey);
// GC worker that has been running for too long
ObjectContent[] ocs = hyperHost.getVmPropertiesOnHyperHost(new String[] {"name", "config.template", workerPropName, workerTagPropName,});
if (ocs != null) {
for (ObjectContent oc : ocs) {
List<DynamicProperty> props = oc.getPropSet();
if (props != null) {
boolean template = false;
boolean isWorker = false;
String workerTag = null;
for (DynamicProperty prop : props) {
if (prop.getName().equals("config.template")) {
template = (Boolean)prop.getVal();
} else if (prop.getName().equals(workerPropName)) {
CustomFieldStringValue val = (CustomFieldStringValue)prop.getVal();
if (val != null && val.getValue() != null && val.getValue().equalsIgnoreCase("true"))
isWorker = true;
} else if (prop.getName().equals(workerTagPropName)) {
CustomFieldStringValue val = (CustomFieldStringValue)prop.getVal();
workerTag = val.getValue();
}
}
VirtualMachineMO vmMo = new VirtualMachineMO(hyperHost.getContext(), oc.getObj());
if (!template && isWorker) {
boolean recycle = false;
recycle = mgr.needRecycle(workerTag);
if (recycle) {
s_logger.info("Recycle pending worker VM: " + vmMo.getName());
vmMo.powerOff();
vmMo.detachAllDisks();
vmMo.destroy();
}
}
}
}
}
} else {
s_logger.error("Host is no longer connected.");
}
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext();
}
}
}
@Override
public Type getType() {
return com.cloud.host.Host.Type.Routing;
}
@Override
public StartupCommand[] initialize() {
try {
String hostApiVersion = "4.1";
VmwareContext context = getServiceContext();
try {
VmwareHypervisorHost hyperHost = getHyperHost(context);
assert (hyperHost instanceof HostMO);
if (!((HostMO)hyperHost).isHyperHostConnected()) {
s_logger.info("Host " + hyperHost.getHyperHostName() + " is not in connected state");
return null;
}
((HostMO)hyperHost).enableVncOnHostFirewall();
AboutInfo aboutInfo = ((HostMO)hyperHost).getHostAboutInfo();
hostApiVersion = aboutInfo.getApiVersion();
} catch (Exception e) {
String msg = "VmwareResource intialize() failed due to : " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg);
invalidateServiceContext();
return null;
}
StartupRoutingCommand cmd = new StartupRoutingCommand();
fillHostInfo(cmd);
cmd.setHypervisorType(HypervisorType.VMware);
cmd.setCluster(_cluster);
cmd.setHypervisorVersion(hostApiVersion);
List<StartupStorageCommand> storageCmds = initializeLocalStorage();
StartupCommand[] answerCmds = new StartupCommand[1 + storageCmds.size()];
answerCmds[0] = cmd;
for (int i = 0; i < storageCmds.size(); i++) {
answerCmds[i + 1] = storageCmds.get(i);
}
return answerCmds;
} finally {
recycleServiceContext();
}
}
private List<StartupStorageCommand> initializeLocalStorage() {
List<StartupStorageCommand> storageCmds = new ArrayList<StartupStorageCommand>();
VmwareContext context = getServiceContext();
try {
VmwareHypervisorHost hyperHost = getHyperHost(context);
if (hyperHost instanceof HostMO) {
HostMO hostMo = (HostMO)hyperHost;
List<Pair<ManagedObjectReference, String>> dsList = hostMo.getLocalDatastoreOnHost();
for (Pair<ManagedObjectReference, String> dsPair : dsList) {
DatastoreMO dsMo = new DatastoreMO(context, dsPair.first());
String poolUuid = dsMo.getCustomFieldValue(CustomFieldConstants.CLOUD_UUID);
if (poolUuid == null || poolUuid.isEmpty()) {
poolUuid = UUID.randomUUID().toString();
dsMo.setCustomFieldValue(CustomFieldConstants.CLOUD_UUID, poolUuid);
}
DatastoreSummary dsSummary = dsMo.getSummary();
String address = hostMo.getHostName();
StoragePoolInfo pInfo =
new StoragePoolInfo(poolUuid, address, dsMo.getMor().getValue(), "", StoragePoolType.VMFS, dsSummary.getCapacity(), dsSummary.getFreeSpace());
StartupStorageCommand cmd = new StartupStorageCommand();
cmd.setName(poolUuid);
cmd.setPoolInfo(pInfo);
cmd.setGuid(poolUuid); // give storage host the same UUID as the local storage pool itself
cmd.setResourceType(Storage.StorageResourceType.STORAGE_POOL);
cmd.setDataCenter(_dcId);
cmd.setPod(_pod);
cmd.setCluster(_cluster);
s_logger.info("Add local storage startup command: " + _gson.toJson(cmd));
storageCmds.add(cmd);
}
} else {
s_logger.info("Cluster host does not support local storage, skip it");
}
} catch (Exception e) {
String msg = "initializing local storage failed due to : " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg);
invalidateServiceContext();
throw new CloudRuntimeException(msg);
}
return storageCmds;
}
protected void fillHostInfo(StartupRoutingCommand cmd) {
VmwareContext serviceContext = getServiceContext();
Map<String, String> details = cmd.getHostDetails();
if (details == null) {
details = new HashMap<String, String>();
}
try {
fillHostHardwareInfo(serviceContext, cmd);
fillHostNetworkInfo(serviceContext, cmd);
fillHostDetailsInfo(serviceContext, details);
} catch (RuntimeFaultFaultMsg e) {
s_logger.error("RuntimeFault while retrieving host info: " + e.toString(), e);
throw new CloudRuntimeException("RuntimeFault while retrieving host info");
} catch (RemoteException e) {
s_logger.error("RemoteException while retrieving host info: " + e.toString(), e);
invalidateServiceContext();
throw new CloudRuntimeException("RemoteException while retrieving host info");
} catch (Exception e) {
s_logger.error("Exception while retrieving host info: " + e.toString(), e);
invalidateServiceContext();
throw new CloudRuntimeException("Exception while retrieving host info: " + e.toString());
}
cmd.setHostDetails(details);
cmd.setName(_url);
cmd.setGuid(_guid);
cmd.setDataCenter(_dcId);
cmd.setIqn(getIqn());
cmd.setPod(_pod);
cmd.setCluster(_cluster);
cmd.setVersion(VmwareResource.class.getPackage().getImplementationVersion());
}
private String getIqn() {
try {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
if (hyperHost instanceof HostMO) {
HostMO host = (HostMO)hyperHost;
HostStorageSystemMO hostStorageSystem = host.getHostStorageSystemMO();
for (HostHostBusAdapter hba : hostStorageSystem.getStorageDeviceInfo().getHostBusAdapter()) {
if (hba instanceof HostInternetScsiHba) {
return ((HostInternetScsiHba)hba).getIScsiName();
}
}
}
}
catch (Exception ex) {
s_logger.info("Could not locate an IQN for this host.");
}
return null;
}
private void fillHostHardwareInfo(VmwareContext serviceContext, StartupRoutingCommand cmd) throws RuntimeFaultFaultMsg, RemoteException, Exception {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
VmwareHypervisorHostResourceSummary summary = hyperHost.getHyperHostResourceSummary();
if (s_logger.isInfoEnabled()) {
s_logger.info("Startup report on host hardware info. " + _gson.toJson(summary));
}
cmd.setCaps("hvm");
cmd.setDom0MinMemory(0);
cmd.setSpeed(summary.getCpuSpeed());
cmd.setCpuSockets(summary.getCpuSockets());
cmd.setCpus((int)summary.getCpuCount());
cmd.setMemory(summary.getMemoryBytes());
}
private void fillHostNetworkInfo(VmwareContext serviceContext, StartupRoutingCommand cmd) throws RuntimeFaultFaultMsg, RemoteException {
try {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
assert (hyperHost instanceof HostMO);
VmwareManager mgr = hyperHost.getContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
VmwareHypervisorHostNetworkSummary summary = hyperHost.getHyperHostNetworkSummary(mgr.getManagementPortGroupByHost((HostMO)hyperHost));
if (summary == null) {
throw new Exception("No ESX(i) host found");
}
if (s_logger.isInfoEnabled()) {
s_logger.info("Startup report on host network info. " + _gson.toJson(summary));
}
cmd.setPrivateIpAddress(summary.getHostIp());
cmd.setPrivateNetmask(summary.getHostNetmask());
cmd.setPrivateMacAddress(summary.getHostMacAddress());
cmd.setStorageIpAddress(summary.getHostIp());
cmd.setStorageNetmask(summary.getHostNetmask());
cmd.setStorageMacAddress(summary.getHostMacAddress());
} catch (Throwable e) {
String msg = "querying host network info failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
throw new CloudRuntimeException(msg);
}
}
private void fillHostDetailsInfo(VmwareContext serviceContext, Map<String, String> details) throws Exception {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
if (hyperHost.isHAEnabled()) {
details.put("NativeHA", "true");
}
}
protected HashMap<String, HostVmStateReportEntry> syncHostVmStates() {
try {
return getHostVmStateReport();
} catch (Exception e) {
return new HashMap<String, HostVmStateReportEntry>();
}
}
protected OptionValue[] configureVnc(OptionValue[] optionsToMerge, VmwareHypervisorHost hyperHost, String vmName, String vncPassword, String keyboardLayout)
throws Exception {
VirtualMachineMO vmMo = hyperHost.findVmOnHyperHost(vmName);
VmwareManager mgr = hyperHost.getContext().getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
if (!mgr.beginExclusiveOperation(600))
throw new Exception("Unable to begin exclusive operation, lock time out");
try {
int maxVncPorts = 64;
int vncPort = 0;
Random random = new Random();
HostMO vmOwnerHost = vmMo.getRunningHost();
ManagedObjectReference morParent = vmOwnerHost.getParentMor();
HashMap<String, Integer> portInfo;
if (morParent.getType().equalsIgnoreCase("ClusterComputeResource")) {
ClusterMO clusterMo = new ClusterMO(vmOwnerHost.getContext(), morParent);
portInfo = clusterMo.getVmVncPortsOnCluster();
} else {
portInfo = vmOwnerHost.getVmVncPortsOnHost();
}
// allocate first at 5900 - 5964 range
Collection<Integer> existingPorts = portInfo.values();
int val = random.nextInt(maxVncPorts);
int startVal = val;
do {
if (!existingPorts.contains(5900 + val)) {
vncPort = 5900 + val;
break;
}
val = (++val) % maxVncPorts;
} while (val != startVal);
if (vncPort == 0) {
s_logger.info("we've run out of range for ports between 5900-5964 for the cluster, we will try port range at 59000-60000");
Pair<Integer, Integer> additionalRange = mgr.getAddiionalVncPortRange();
maxVncPorts = additionalRange.second();
val = random.nextInt(maxVncPorts);
startVal = val;
do {
if (!existingPorts.contains(additionalRange.first() + val)) {
vncPort = additionalRange.first() + val;
break;
}
val = (++val) % maxVncPorts;
} while (val != startVal);
}
if (vncPort == 0) {
throw new Exception("Unable to find an available VNC port on host");
}
if (s_logger.isInfoEnabled()) {
s_logger.info("Configure VNC port for VM " + vmName + ", port: " + vncPort + ", host: " + vmOwnerHost.getHyperHostName());
}
return VmwareHelper.composeVncOptions(optionsToMerge, true, vncPassword, vncPort, keyboardLayout);
} finally {
try {
mgr.endExclusiveOperation();
} catch (Throwable e) {
assert (false);
s_logger.error("Unexpected exception ", e);
}
}
}
private VirtualMachineGuestOsIdentifier translateGuestOsIdentifier(String cpuArchitecture, String guestOs, String cloudGuestOs) {
if (cpuArchitecture == null) {
s_logger.warn("CPU arch is not set, default to i386. guest os: " + guestOs);
cpuArchitecture = "i386";
}
if(cloudGuestOs == null) {
s_logger.warn("Guest OS mapping name is not set for guest os: " + guestOs);
}
VirtualMachineGuestOsIdentifier identifier = null;
try {
if (cloudGuestOs != null) {
identifier = VirtualMachineGuestOsIdentifier.fromValue(cloudGuestOs);
s_logger.debug("Using mapping name : " + identifier.toString());
}
} catch (IllegalArgumentException e) {
s_logger.warn("Unable to find Guest OS Identifier in VMware for mapping name: " + cloudGuestOs + ". Continuing with defaults.");
}
if (identifier != null) {
return identifier;
}
if (cpuArchitecture.equalsIgnoreCase("x86_64")) {
return VirtualMachineGuestOsIdentifier.OTHER_GUEST_64;
}
return VirtualMachineGuestOsIdentifier.OTHER_GUEST;
}
private HashMap<String, HostVmStateReportEntry> getHostVmStateReport() throws Exception {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
int key = ((HostMO)hyperHost).getCustomFieldKey("VirtualMachine", CustomFieldConstants.CLOUD_VM_INTERNAL_NAME);
if (key == 0) {
s_logger.warn("Custom field " + CustomFieldConstants.CLOUD_VM_INTERNAL_NAME + " is not registered ?!");
}
String instanceNameCustomField = "value[" + key + "]";
// CLOUD_VM_INTERNAL_NAME stores the internal CS generated vm name. This was earlier stored in name. Now, name can be either the hostname or
// the internal CS name, but the custom field CLOUD_VM_INTERNAL_NAME always stores the internal CS name.
ObjectContent[] ocs = hyperHost.getVmPropertiesOnHyperHost(new String[] {"name", "runtime.powerState", "config.template", instanceNameCustomField});
HashMap<String, HostVmStateReportEntry> newStates = new HashMap<String, HostVmStateReportEntry>();
if (ocs != null && ocs.length > 0) {
for (ObjectContent oc : ocs) {
List<DynamicProperty> objProps = oc.getPropSet();
if (objProps != null) {
boolean isTemplate = false;
String name = null;
String VMInternalCSName = null;
VirtualMachinePowerState powerState = VirtualMachinePowerState.POWERED_OFF;
for (DynamicProperty objProp : objProps) {
if (objProp.getName().equals("config.template")) {
if (objProp.getVal().toString().equalsIgnoreCase("true")) {
isTemplate = true;
}
} else if (objProp.getName().equals("runtime.powerState")) {
powerState = (VirtualMachinePowerState)objProp.getVal();
} else if (objProp.getName().equals("name")) {
name = (String)objProp.getVal();
} else if (objProp.getName().contains(instanceNameCustomField)) {
if (objProp.getVal() != null)
VMInternalCSName = ((CustomFieldStringValue)objProp.getVal()).getValue();
} else {
assert (false);
}
}
if (VMInternalCSName != null)
name = VMInternalCSName;
if (!isTemplate) {
newStates.put(name, new HostVmStateReportEntry(convertPowerState(powerState), hyperHost.getHyperHostName()));
}
}
}
}
return newStates;
}
private HashMap<String, PowerState> getVmStates() throws Exception {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
int key = ((HostMO)hyperHost).getCustomFieldKey("VirtualMachine", CustomFieldConstants.CLOUD_VM_INTERNAL_NAME);
if (key == 0) {
s_logger.warn("Custom field " + CustomFieldConstants.CLOUD_VM_INTERNAL_NAME + " is not registered ?!");
}
String instanceNameCustomField = "value[" + key + "]";
// CLOUD_VM_INTERNAL_NAME stores the internal CS generated vm name. This was earlier stored in name. Now, name can be either the hostname or
// the internal CS name, but the custom field CLOUD_VM_INTERNAL_NAME always stores the internal CS name.
ObjectContent[] ocs = hyperHost.getVmPropertiesOnHyperHost(new String[] {"name", "runtime.powerState", "config.template", instanceNameCustomField});
HashMap<String, PowerState> newStates = new HashMap<String, PowerState>();
if (ocs != null && ocs.length > 0) {
for (ObjectContent oc : ocs) {
List<DynamicProperty> objProps = oc.getPropSet();
if (objProps != null) {
boolean isTemplate = false;
String name = null;
String VMInternalCSName = null;
VirtualMachinePowerState powerState = VirtualMachinePowerState.POWERED_OFF;
for (DynamicProperty objProp : objProps) {
if (objProp.getName().equals("config.template")) {
if (objProp.getVal().toString().equalsIgnoreCase("true")) {
isTemplate = true;
}
} else if (objProp.getName().equals("runtime.powerState")) {
powerState = (VirtualMachinePowerState)objProp.getVal();
} else if (objProp.getName().equals("name")) {
name = (String)objProp.getVal();
} else if (objProp.getName().contains(instanceNameCustomField)) {
if (objProp.getVal() != null)
VMInternalCSName = ((CustomFieldStringValue)objProp.getVal()).getValue();
} else {
assert (false);
}
}
if (VMInternalCSName != null)
name = VMInternalCSName;
if (!isTemplate) {
newStates.put(name, convertPowerState(powerState));
}
}
}
}
return newStates;
}
private HashMap<String, VmStatsEntry> getVmStats(List<String> vmNames) throws Exception {
VmwareHypervisorHost hyperHost = getHyperHost(getServiceContext());
HashMap<String, VmStatsEntry> vmResponseMap = new HashMap<String, VmStatsEntry>();
ManagedObjectReference perfMgr = getServiceContext().getServiceContent().getPerfManager();
VimPortType service = getServiceContext().getService();
PerfCounterInfo rxPerfCounterInfo = null;
PerfCounterInfo txPerfCounterInfo = null;
List<PerfCounterInfo> cInfo = getServiceContext().getVimClient().getDynamicProperty(perfMgr, "perfCounter");
for (PerfCounterInfo info : cInfo) {
if ("net".equalsIgnoreCase(info.getGroupInfo().getKey())) {
if ("transmitted".equalsIgnoreCase(info.getNameInfo().getKey())) {
txPerfCounterInfo = info;
}
if ("received".equalsIgnoreCase(info.getNameInfo().getKey())) {
rxPerfCounterInfo = info;
}
}
}
int key = ((HostMO)hyperHost).getCustomFieldKey("VirtualMachine", CustomFieldConstants.CLOUD_VM_INTERNAL_NAME);
if (key == 0) {
s_logger.warn("Custom field " + CustomFieldConstants.CLOUD_VM_INTERNAL_NAME + " is not registered ?!");
}
String instanceNameCustomField = "value[" + key + "]";
final String numCpuStr = "summary.config.numCpu";
final String cpuUseStr = "summary.quickStats.overallCpuUsage";
final String guestMemUseStr = "summary.quickStats.guestMemoryUsage";
final String memLimitStr = "resourceConfig.memoryAllocation.limit";
final String memMbStr = "config.hardware.memoryMB";
final String allocatedCpuStr = "summary.runtime.maxCpuUsage";
ObjectContent[] ocs =
hyperHost.getVmPropertiesOnHyperHost(new String[] {"name", numCpuStr, cpuUseStr ,guestMemUseStr ,memLimitStr ,memMbStr,allocatedCpuStr ,instanceNameCustomField});
if (ocs != null && ocs.length > 0) {
for (ObjectContent oc : ocs) {
List<DynamicProperty> objProps = oc.getPropSet();
if (objProps != null) {
String name = null;
String numberCPUs = null;
double maxCpuUsage = 0;
String memlimit = null;
String memkb = null;
String guestMemusage = null;
String vmNameOnVcenter = null;
String vmInternalCSName = null;
double allocatedCpu = 0;
for (DynamicProperty objProp : objProps) {
if (objProp.getName().equals("name")) {
vmNameOnVcenter = objProp.getVal().toString();
} else if (objProp.getName().contains(instanceNameCustomField)) {
if (objProp.getVal() != null)
vmInternalCSName = ((CustomFieldStringValue)objProp.getVal()).getValue();
}else if(objProp.getName().equals(guestMemusage)){
guestMemusage = objProp.getVal().toString();
}else if (objProp.getName().equals(numCpuStr)) {
numberCPUs = objProp.getVal().toString();
} else if (objProp.getName().equals(cpuUseStr)) {
maxCpuUsage = NumberUtils.toDouble(objProp.getVal().toString());
} else if (objProp.getName().equals(memLimitStr)) {
memlimit = objProp.getVal().toString();
} else if (objProp.getName().equals(memMbStr)) {
memkb = objProp.getVal().toString();
} else if (objProp.getName().equals(allocatedCpuStr)){
allocatedCpu = NumberUtils.toDouble(objProp.getVal().toString());
}
}
maxCpuUsage = (maxCpuUsage/allocatedCpu)*100;
new VirtualMachineMO(hyperHost.getContext(), oc.getObj());
if (vmInternalCSName != null) {
name = vmInternalCSName;
} else {
name = vmNameOnVcenter;
}
if (!vmNames.contains(name)) {
continue;
}
ManagedObjectReference vmMor = hyperHost.findVmOnHyperHost(name).getMor();
assert (vmMor != null);
ArrayList<PerfMetricId> vmNetworkMetrics = new ArrayList<PerfMetricId>();
// get all the metrics from the available sample period
List<PerfMetricId> perfMetrics = service.queryAvailablePerfMetric(perfMgr, vmMor, null, null, null);
if (perfMetrics != null) {
for (int index = 0; index < perfMetrics.size(); ++index) {
if (((rxPerfCounterInfo != null) && (perfMetrics.get(index).getCounterId() == rxPerfCounterInfo.getKey())) ||
((txPerfCounterInfo != null) && (perfMetrics.get(index).getCounterId() == txPerfCounterInfo.getKey()))) {
vmNetworkMetrics.add(perfMetrics.get(index));
}
}
}
double networkReadKBs = 0;
double networkWriteKBs = 0;
long sampleDuration = 0;
if (vmNetworkMetrics.size() != 0) {
PerfQuerySpec qSpec = new PerfQuerySpec();
qSpec.setEntity(vmMor);
PerfMetricId[] availableMetricIds = vmNetworkMetrics.toArray(new PerfMetricId[0]);
qSpec.getMetricId().addAll(Arrays.asList(availableMetricIds));
List<PerfQuerySpec> qSpecs = new ArrayList<PerfQuerySpec>();
qSpecs.add(qSpec);
List<PerfEntityMetricBase> values = service.queryPerf(perfMgr, qSpecs);
for (int i = 0; i < values.size(); ++i) {
List<PerfSampleInfo> infos = ((PerfEntityMetric)values.get(i)).getSampleInfo();
if (infos != null && infos.size() > 0) {
int endMs = infos.get(infos.size() - 1).getTimestamp().getSecond() * 1000 + infos.get(infos.size() - 1).getTimestamp().getMillisecond();
int beginMs = infos.get(0).getTimestamp().getSecond() * 1000 + infos.get(0).getTimestamp().getMillisecond();
sampleDuration = (endMs - beginMs) / 1000;
List<PerfMetricSeries> vals = ((PerfEntityMetric)values.get(i)).getValue();
for (int vi = 0; ((vals != null) && (vi < vals.size())); ++vi) {
if (vals.get(vi) instanceof PerfMetricIntSeries) {
PerfMetricIntSeries val = (PerfMetricIntSeries)vals.get(vi);
List<Long> perfValues = val.getValue();
Long sumRate = 0L;
for (int j = 0; j < infos.size(); j++) { // Size of the array matches the size as the PerfSampleInfo
sumRate += perfValues.get(j);
}
Long averageRate = sumRate / infos.size();
if (vals.get(vi).getId().getCounterId() == rxPerfCounterInfo.getKey()) {
networkReadKBs = sampleDuration * averageRate; //get the average RX rate multiplied by sampled duration
}
if (vals.get(vi).getId().getCounterId() == txPerfCounterInfo.getKey()) {
networkWriteKBs = sampleDuration * averageRate;//get the average TX rate multiplied by sampled duration
}
}
}
}
}
}
vmResponseMap.put(name, new VmStatsEntry( NumberUtils.toDouble(memkb)*1024,NumberUtils.toDouble(guestMemusage)*1024,NumberUtils.toDouble(memlimit)*1024, maxCpuUsage, networkReadKBs, networkWriteKBs, NumberUtils.toInt(numberCPUs), "vm"));
}
}
}
return vmResponseMap;
}
protected String networkUsage(final String privateIpAddress, final String option, final String ethName) {
String args = null;
if (option.equals("get")) {
args = "-g";
} else if (option.equals("create")) {
args = "-c";
} else if (option.equals("reset")) {
args = "-r";
} else if (option.equals("addVif")) {
args = "-a";
args += ethName;
} else if (option.equals("deleteVif")) {
args = "-d";
args += ethName;
}
ExecutionResult result = executeInVR(privateIpAddress, "netusage.sh", args);
if (!result.isSuccess()) {
return null;
}
return result.getDetails();
}
private long[] getNetworkStats(String privateIP) {
String result = networkUsage(privateIP, "get", null);
long[] stats = new long[2];
if (result != null) {
try {
String[] splitResult = result.split(":");
int i = 0;
while (i < splitResult.length - 1) {
stats[0] += Long.parseLong(splitResult[i++]);
stats[1] += Long.parseLong(splitResult[i++]);
}
} catch (Throwable e) {
s_logger.warn("Unable to parse return from script return of network usage command: " + e.toString(), e);
}
}
return stats;
}
protected String connect(final String vmName, final String ipAddress, final int port) {
long startTick = System.currentTimeMillis();
// wait until we have at least been waiting for _ops_timeout time or
// at least have tried _retry times, this is to coordinate with system
// VM patching/rebooting time that may need
int retry = _retry;
while (System.currentTimeMillis() - startTick <= _opsTimeout || --retry > 0) {
s_logger.info("Trying to connect to " + ipAddress);
try (SocketChannel sch = SocketChannel.open();) {
sch.configureBlocking(true);
sch.socket().setSoTimeout(5000);
InetSocketAddress addr = new InetSocketAddress(ipAddress, port);
sch.connect(addr);
return null;
} catch (IOException e) {
s_logger.info("Could not connect to " + ipAddress + " due to " + e.toString());
if (e instanceof ConnectException) {
// if connection is refused because of VM is being started,
// we give it more sleep time
// to avoid running out of retry quota too quickly
try {
Thread.sleep(5000);
} catch (InterruptedException ex) {
s_logger.debug("[ignored] interupted while waiting to retry connect after failure.", e);
}
}
}
try {
Thread.sleep(1000);
} catch (InterruptedException ex) {
s_logger.debug("[ignored] interupted while waiting to retry connect.");
}
}
s_logger.info("Unable to logon to " + ipAddress);
return "Unable to connect";
}
protected String connect(final String vmname, final String ipAddress) {
return connect(vmname, ipAddress, 3922);
}
public static PowerState getVmState(VirtualMachineMO vmMo) throws Exception {
VirtualMachineRuntimeInfo runtimeInfo = vmMo.getRuntimeInfo();
return convertPowerState(runtimeInfo.getPowerState());
}
private static PowerState convertPowerState(VirtualMachinePowerState powerState) {
return s_powerStatesTable.get(powerState);
}
public static PowerState getVmPowerState(VirtualMachineMO vmMo) throws Exception {
VirtualMachineRuntimeInfo runtimeInfo = vmMo.getRuntimeInfo();
return convertPowerState(runtimeInfo.getPowerState());
}
private static HostStatsEntry getHyperHostStats(VmwareHypervisorHost hyperHost) throws Exception {
ComputeResourceSummary hardwareSummary = hyperHost.getHyperHostHardwareSummary();
if (hardwareSummary == null)
return null;
HostStatsEntry entry = new HostStatsEntry();
entry.setEntityType("host");
double cpuUtilization = ((double)(hardwareSummary.getTotalCpu() - hardwareSummary.getEffectiveCpu()) / (double)hardwareSummary.getTotalCpu() * 100);
entry.setCpuUtilization(cpuUtilization);
entry.setTotalMemoryKBs(hardwareSummary.getTotalMemory() / 1024);
entry.setFreeMemoryKBs(hardwareSummary.getEffectiveMemory() * 1024);
return entry;
}
private static String getRouterSshControlIp(NetworkElementCommand cmd) {
String routerIp = cmd.getAccessDetail(NetworkElementCommand.ROUTER_IP);
String routerGuestIp = cmd.getAccessDetail(NetworkElementCommand.ROUTER_GUEST_IP);
String zoneNetworkType = cmd.getAccessDetail(NetworkElementCommand.ZONE_NETWORK_TYPE);
if (routerGuestIp != null && zoneNetworkType != null && NetworkType.valueOf(zoneNetworkType) == NetworkType.Basic) {
if (s_logger.isDebugEnabled())
s_logger.debug("In Basic zone mode, use router's guest IP for SSH control. guest IP : " + routerGuestIp);
return routerGuestIp;
}
if (s_logger.isDebugEnabled())
s_logger.debug("Use router's private IP for SSH control. IP : " + routerIp);
return routerIp;
}
@Override
public void setAgentControl(IAgentControl agentControl) {
}
@Override
public boolean configure(String name, Map<String, Object> params) throws ConfigurationException {
try {
_name = name;
_url = (String)params.get("url");
_username = (String)params.get("username");
_password = (String)params.get("password");
_dcId = (String)params.get("zone");
_pod = (String)params.get("pod");
_cluster = (String)params.get("cluster");
_guid = (String)params.get("guid");
String[] tokens = _guid.split("@");
_vCenterAddress = tokens[1];
_morHyperHost = new ManagedObjectReference();
String[] hostTokens = tokens[0].split(":");
_morHyperHost.setType(hostTokens[0]);
_morHyperHost.setValue(hostTokens[1]);
_guestTrafficInfo = (VmwareTrafficLabel)params.get("guestTrafficInfo");
_publicTrafficInfo = (VmwareTrafficLabel)params.get("publicTrafficInfo");
VmwareContext context = getServiceContext();
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
if (mgr == null) {
throw new ConfigurationException("Invalid vmwareContext: vmwareMgr stock object is not set or cleared.");
}
mgr.setupResourceStartupParams(params);
CustomFieldsManagerMO cfmMo = new CustomFieldsManagerMO(context, context.getServiceContent().getCustomFieldsManager());
cfmMo.ensureCustomFieldDef("Datastore", CustomFieldConstants.CLOUD_UUID);
if (_publicTrafficInfo != null && _publicTrafficInfo.getVirtualSwitchType() != VirtualSwitchType.StandardVirtualSwitch || _guestTrafficInfo != null &&
_guestTrafficInfo.getVirtualSwitchType() != VirtualSwitchType.StandardVirtualSwitch) {
cfmMo.ensureCustomFieldDef("DistributedVirtualPortgroup", CustomFieldConstants.CLOUD_GC_DVP);
}
cfmMo.ensureCustomFieldDef("Network", CustomFieldConstants.CLOUD_GC);
cfmMo.ensureCustomFieldDef("VirtualMachine", CustomFieldConstants.CLOUD_UUID);
cfmMo.ensureCustomFieldDef("VirtualMachine", CustomFieldConstants.CLOUD_NIC_MASK);
cfmMo.ensureCustomFieldDef("VirtualMachine", CustomFieldConstants.CLOUD_VM_INTERNAL_NAME);
cfmMo.ensureCustomFieldDef("VirtualMachine", CustomFieldConstants.CLOUD_WORKER);
cfmMo.ensureCustomFieldDef("VirtualMachine", CustomFieldConstants.CLOUD_WORKER_TAG);
VmwareHypervisorHost hostMo = this.getHyperHost(context);
_hostName = hostMo.getHyperHostName();
if (_guestTrafficInfo.getVirtualSwitchType() == VirtualSwitchType.NexusDistributedVirtualSwitch ||
_publicTrafficInfo.getVirtualSwitchType() == VirtualSwitchType.NexusDistributedVirtualSwitch) {
_privateNetworkVSwitchName = mgr.getPrivateVSwitchName(Long.parseLong(_dcId), HypervisorType.VMware);
_vsmCredentials = mgr.getNexusVSMCredentialsByClusterId(Long.parseLong(_cluster));
}
if (_privateNetworkVSwitchName == null) {
_privateNetworkVSwitchName = (String)params.get("private.network.vswitch.name");
}
String value = (String)params.get("vmware.recycle.hung.wokervm");
if (value != null && value.equalsIgnoreCase("true"))
_recycleHungWorker = true;
value = (String)params.get("vmware.root.disk.controller");
if (value != null && value.equalsIgnoreCase("scsi"))
_rootDiskController = DiskControllerType.scsi;
else if (value != null && value.equalsIgnoreCase("ide"))
_rootDiskController = DiskControllerType.ide;
else
_rootDiskController = DiskControllerType.osdefault;
Integer intObj = (Integer)params.get("ports.per.dvportgroup");
if (intObj != null)
_portsPerDvPortGroup = intObj.intValue();
s_logger.info("VmwareResource network configuration info." + " private traffic over vSwitch: " + _privateNetworkVSwitchName + ", public traffic over " +
_publicTrafficInfo.getVirtualSwitchType() + " : " + _publicTrafficInfo.getVirtualSwitchName() + ", guest traffic over " +
_guestTrafficInfo.getVirtualSwitchType() + " : " + _guestTrafficInfo.getVirtualSwitchName());
Boolean boolObj = (Boolean)params.get("vmware.create.full.clone");
if (boolObj != null && boolObj.booleanValue()) {
_fullCloneFlag = true;
} else {
_fullCloneFlag = false;
}
boolObj = (Boolean)params.get("vm.instancename.flag");
if (boolObj != null && boolObj.booleanValue()) {
_instanceNameFlag = true;
} else {
_instanceNameFlag = false;
}
value = (String)params.get("scripts.timeout");
int timeout = NumbersUtil.parseInt(value, 1440) * 1000;
storageNfsVersion = NfsSecondaryStorageResource.retrieveNfsVersionFromParams(params);
_storageProcessor = new VmwareStorageProcessor((VmwareHostService)this, _fullCloneFlag, (VmwareStorageMount)mgr, timeout, this, _shutdownWaitMs, null, storageNfsVersion);
storageHandler = new VmwareStorageSubsystemCommandHandler(_storageProcessor, storageNfsVersion);
_vrResource = new VirtualRoutingResource(this);
if (!_vrResource.configure(name, params)) {
throw new ConfigurationException("Unable to configure VirtualRoutingResource");
}
if (s_logger.isTraceEnabled()) {
s_logger.trace("Successfully configured VmwareResource.");
}
return true;
} catch (Exception e) {
s_logger.error("Unexpected Exception ", e);
throw new ConfigurationException("Failed to configure VmwareResource due to unexpect exception.");
} finally {
recycleServiceContext();
}
}
@Override
public String getName() {
return _name;
}
@Override
public boolean start() {
return true;
}
@Override
public boolean stop() {
return true;
}
public VmwareContext getServiceContext() {
return getServiceContext(null);
}
public void invalidateServiceContext() {
invalidateServiceContext(null);
}
public VmwareHypervisorHost getHyperHost(VmwareContext context) {
return getHyperHost(context, null);
}
@Override
public VmwareContext getServiceContext(Command cmd) {
VmwareContext context = null;
if(s_serviceContext.get() != null) {
context = s_serviceContext.get();
String poolKey = VmwareContextPool.composePoolKey(_vCenterAddress, _username);
// Before re-using the thread local context, ensure it corresponds to the right vCenter API session and that it is valid to make calls.
if(context.getPoolKey().equals(poolKey)) {
if (context.validate()) {
if (s_logger.isTraceEnabled()) {
s_logger.trace("ThreadLocal context is still valid, just reuse");
}
return context;
} else {
s_logger.info("Validation of the context failed, dispose and use a new one");
invalidateServiceContext(context);
}
} else {
// Exisitng ThreadLocal context corresponds to a different vCenter API session. Why has it not been recycled?
s_logger.warn("ThreadLocal VMware context: " + poolKey + " doesn't correspond to the right vCenter. Expected VMware context: " + context.getPoolKey());
}
}
try {
context = VmwareContextFactory.getContext(_vCenterAddress, _username, _password);
s_serviceContext.set(context);
} catch (Exception e) {
s_logger.error("Unable to connect to vSphere server: " + _vCenterAddress, e);
throw new CloudRuntimeException("Unable to connect to vSphere server: " + _vCenterAddress);
}
return context;
}
@Override
public void invalidateServiceContext(VmwareContext context) {
assert (s_serviceContext.get() == context);
s_serviceContext.set(null);
if (context != null)
context.close();
}
private static void recycleServiceContext() {
VmwareContext context = s_serviceContext.get();
if (s_logger.isTraceEnabled()) {
s_logger.trace("Reset threadlocal context to null");
}
s_serviceContext.set(null);
if (context != null) {
assert (context.getPool() != null);
if (s_logger.isTraceEnabled()) {
s_logger.trace("Recycling threadlocal context to pool");
}
context.getPool().registerContext(context);
}
}
@Override
public VmwareHypervisorHost getHyperHost(VmwareContext context, Command cmd) {
if (_morHyperHost.getType().equalsIgnoreCase("HostSystem")) {
return new HostMO(context, _morHyperHost);
}
return new ClusterMO(context, _morHyperHost);
}
@Override
@DB
public String getWorkerName(VmwareContext context, Command cmd, int workerSequence) {
VmwareManager mgr = context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
String vmName = mgr.composeWorkerName();
assert (cmd != null);
context.getStockObject(VmwareManager.CONTEXT_STOCK_NAME);
// TODO: Fix this? long checkPointId = vmwareMgr.pushCleanupCheckpoint(this._guid, vmName);
// TODO: Fix this? cmd.setContextParam("checkpoint", String.valueOf(checkPointId));
return vmName;
}
@Override
public void setName(String name) {
// TODO Auto-generated method stub
}
@Override
public void setConfigParams(Map<String, Object> params) {
// TODO Auto-generated method stub
}
@Override
public Map<String, Object> getConfigParams() {
// TODO Auto-generated method stub
return null;
}
@Override
public int getRunLevel() {
// TODO Auto-generated method stub
return 0;
}
@Override
public void setRunLevel(int level) {
// TODO Auto-generated method stub
}
@Override
public Answer execute(DestroyCommand cmd) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Executing resource DestroyCommand to evict template from storage pool: " + _gson.toJson(cmd));
}
try {
VmwareContext context = getServiceContext(null);
VmwareHypervisorHost hyperHost = getHyperHost(context, null);
VolumeTO vol = cmd.getVolume();
VirtualMachineMO vmMo = findVmOnDatacenter(context, hyperHost, vol);
if (vmMo != null && vmMo.isTemplate()) {
if (s_logger.isInfoEnabled()) {
s_logger.info("Destroy template volume " + vol.getPath());
}
vmMo.destroy();
} else {
if (s_logger.isInfoEnabled()) {
s_logger.info("Template volume " + vol.getPath() + " is not found, no need to delete.");
}
}
return new Answer(cmd, true, "Success");
} catch (Throwable e) {
if (e instanceof RemoteException) {
s_logger.warn("Encounter remote exception to vCenter, invalidate VMware session context");
invalidateServiceContext(null);
}
String msg = "DestroyCommand failed due to " + VmwareHelper.getExceptionMessage(e);
s_logger.error(msg, e);
return new Answer(cmd, false, msg);
}
}
/**
* Use data center to look for vm, instead of randomly picking up a cluster<br/>
* (in multiple cluster environments vm could not be found if wrong cluster was chosen)
* @param context vmware context
* @param hyperHost vmware hv host
* @param vol volume
* @return a virtualmachinemo if could be found on datacenter.
* @throws Exception if there is an error while finding vm
* @throws CloudRuntimeException if datacenter cannot be found
*/
protected VirtualMachineMO findVmOnDatacenter(VmwareContext context, VmwareHypervisorHost hyperHost, VolumeTO vol) throws Exception {
DatacenterMO dcMo = new DatacenterMO(context, hyperHost.getHyperHostDatacenter());
if (dcMo.getMor() == null) {
String msg = "Unable to find VMware DC";
s_logger.error(msg);
throw new CloudRuntimeException(msg);
}
return dcMo.findVm(vol.getPath());
}
private String getAbsoluteVmdkFile(VirtualDisk disk) {
String vmdkAbsFile = null;
VirtualDeviceBackingInfo backingInfo = disk.getBacking();
if (backingInfo instanceof VirtualDiskFlatVer2BackingInfo) {
VirtualDiskFlatVer2BackingInfo diskBackingInfo = (VirtualDiskFlatVer2BackingInfo)backingInfo;
vmdkAbsFile = diskBackingInfo.getFileName();
}
return vmdkAbsFile;
}
}