/************************************************************************* * * * This file is part of the 20n/act project. * * 20n/act enables DNA prediction for synthetic biology/bioengineering. * * Copyright (C) 2017 20n Labs, Inc. * * * * Please direct all queries to act@20n.com. * * * * This program is free software: you can redistribute it and/or modify * * it under the terms of the GNU General Public License as published by * * the Free Software Foundation, either version 3 of the License, or * * (at your option) any later version. * * * * This program is distributed in the hope that it will be useful, * * but WITHOUT ANY WARRANTY; without even the implied warranty of * * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * * GNU General Public License for more details. * * * * You should have received a copy of the GNU General Public License * * along with this program. If not, see <http://www.gnu.org/licenses/>. * * * *************************************************************************/ package com.act.biointerpretation.analysis; import com.act.analysis.similarity.ROBinning; import com.act.biointerpretation.mechanisminspection.Ero; import com.act.biointerpretation.mechanisminspection.ErosCorpus; import org.junit.Assert; import org.junit.Test; import java.util.ArrayList; import java.util.List; public class RoBinningTest { @Test public void testAliphaticRODoesNotMatchWithAromaticCompoundAndViceVersa() throws Exception { Ero aromaticRO = new Ero(); aromaticRO.setId(1); aromaticRO.setRo("[H][c:6]1[c:7][c:1][c:2][c:3][c:4]1>>[C:1](=[O:7])1[C,c:2]=[C,c:3][C:4](=[O:8])[C,c:5]=[C,c:6]1"); Ero aliphaticRO = new Ero(); aliphaticRO.setId(2); aliphaticRO.setRo("[C:9]([H])[C:10]([H])>>[C:9]=[C:10]"); ErosCorpus erosCorpus = new ErosCorpus(); List<Ero> eros = new ArrayList<>(); eros.add(aromaticRO); eros.add(aliphaticRO); erosCorpus.setRos(eros); ROBinning roBinning = new ROBinning(erosCorpus, null); roBinning.init(); String aromaticInchi = "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H"; String aliphaticInchi = "InChI=1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3"; List<Integer> aromaticResult = roBinning.processChemical(aromaticInchi); Assert.assertEquals("Benzene should only match one RO", 1, aromaticResult.size()); Assert.assertEquals("Benzene should only match the aromatic RO", 1, aromaticResult.get(0).intValue()); List<Integer> aliphaticResult = roBinning.processChemical(aliphaticInchi); Assert.assertEquals("Butanol should only match one RO", 1, aliphaticResult.size()); Assert.assertEquals("Butanol should only match the aliphatic RO", 2, aliphaticResult.get(0).intValue()); } @Test public void testROIsBeingSplitProperlyAndMatchedAgainst() throws Exception { Ero aromaticRO = new Ero(); aromaticRO.setId(1); aromaticRO.setRo("[H][c:6]1[c:7][c:1][c:2][c:3][c:4]1.[C:9]([H])[C:10]([H])>>[C:1](=[O:7])1[C,c:2]=[C,c:3][C:4](=[O:8])[C,c:5]=[C,c:6]1.[C:9]=[C:10]"); ErosCorpus erosCorpus = new ErosCorpus(); List<Ero> eros = new ArrayList<>(); eros.add(aromaticRO); erosCorpus.setRos(eros); ROBinning roBinning = new ROBinning(erosCorpus, null); roBinning.init(); String aromaticInchi = "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H"; String aliphaticInchi = "InChI=1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3"; List<Integer> aromaticResult = roBinning.processChemical(aromaticInchi); Assert.assertEquals("Benzene should only match one RO", 1, aromaticResult.size()); Assert.assertEquals("Benzene should only match the RO since one half of it contains an aromatic compound and it " + "does not match anything in the product side", 1, aromaticResult.get(0).intValue()); List<Integer> aliphaticResult = roBinning.processChemical(aliphaticInchi); Assert.assertEquals("Butanol should only match one RO", 1, aliphaticResult.size()); Assert.assertEquals("Butanol should only match the RO since one half of it contains an aliphatic compound and it " + "does not match anything in the product side", 1, aliphaticResult.get(0).intValue()); } }